4-AcO-DMT: Difference between revisions
CSV import |
CSV import |
||
| Line 1: | Line 1: | ||
{{Short description|A synthetic psychedelic compound}} | |||
{{Drugbox | |||
| verifiedrevid = 477318295 | |||
| IUPAC_name = 3-[2-(dimethylamino)ethyl]-1H-indol-4-yl acetate | |||
| image = 4-AcO-DMT.svg | |||
| width = 200 | |||
| legal_status = Unscheduled | |||
| routes_of_administration = Oral, Insufflation, Intravenous | |||
| CAS_number = 92292-84-7 | |||
| PubChem = 443378 | |||
| ChemSpiderID = 391759 | |||
| UNII = 6K3X4POA0S | |||
| C=14 | |||
| H=18 | |||
| N=2 | |||
| O=2 | |||
| smiles = CC(=O)OC1=CC2=C(C=C1)C(=CN2)CCN(C)C | |||
}} | |||
4-Acetoxy-N,N-dimethyltryptamine (4-AcO-DMT) is a synthetic psychedelic compound that is structurally | '''4-Acetoxy-N,N-dimethyltryptamine''' ('''4-AcO-DMT''') is a synthetic [[psychedelic]] compound that is structurally related to [[psilocybin]], the active ingredient in [[magic mushrooms]]. It is a member of the [[tryptamine]] class of compounds and is known for its psychedelic effects, which are similar to those of [[psilocin]] and [[DMT]]. | ||
== Chemical Structure and Properties == | ==Chemical Structure and Properties== | ||
4-AcO-DMT is the acetylated form of [[psilocin]], which is the active metabolite of [[psilocybin]]. Its chemical structure consists of an indole ring, which is a common feature of tryptamines, with an acetoxy group at the 4-position and a dimethylaminoethyl side chain. The molecular formula of 4-AcO-DMT is C<sub>14</sub>H<sub>18</sub>N<sub>2</sub>O<sub>2</sub>. | |||
4-AcO-DMT | ==Pharmacology== | ||
4-AcO-DMT is believed to act as a prodrug to [[psilocin]], meaning that it is metabolized in the body to produce psilocin, which then exerts its effects on the brain. Psilocin primarily acts as a partial agonist at the [[5-HT2A receptor]], which is a subtype of the [[serotonin receptor]]. This interaction is thought to be responsible for the psychedelic effects of 4-AcO-DMT. | |||
== | ==Effects== | ||
The effects of 4-AcO-DMT are similar to those of [[psilocybin]] and [[DMT]], and can include: | |||
* Altered perception of time and space | |||
* Visual and auditory hallucinations | |||
* Enhanced introspection and emotional experiences | |||
* Altered thought processes | |||
* Euphoria | |||
The onset of effects typically occurs within 20 to 40 minutes when taken orally, with the peak effects lasting for 2 to 4 hours, and the total duration of effects lasting 4 to 6 hours. | |||
== | ==Legal Status== | ||
The legal status of 4-AcO-DMT varies by country. In some jurisdictions, it is considered a controlled substance, while in others it remains unscheduled. It is important to check local laws and regulations regarding its use and possession. | |||
==Research and Use== | |||
4-AcO-DMT has been used in [[psychedelic research]] to study its effects on the brain and its potential therapeutic applications. Some researchers are interested in its potential to treat conditions such as [[depression]], [[anxiety]], and [[PTSD]]. However, more research is needed to fully understand its safety and efficacy. | |||
== | ==Also see== | ||
* [[Psilocybin]] | |||
* [[Psilocin]] | |||
* [[DMT]] | |||
* [[Tryptamine]] | |||
* [[Psychedelic therapy]] | |||
{{Psychedelics}} | |||
{{Tryptamines}} | |||
[[Category:Psychedelic tryptamines]] | |||
[[Category:Serotonin receptor agonists]] | |||
[[Category:Acetate esters]] | |||
Revision as of 05:53, 11 December 2024
A synthetic psychedelic compound
| 4-AcO-DMT | |
|---|---|
| File:4-AcO-DMT.svg | |
| INN | |
| Drug class | |
| Routes of administration | Oral, Insufflation, Intravenous |
| Pregnancy category | |
| Bioavailability | |
| Metabolism | |
| Elimination half-life | |
| Excretion | |
| Legal status | Unscheduled |
| CAS Number | 92292-84-7 |
| PubChem | 443378 |
| DrugBank | |
| ChemSpider | 391759 |
| KEGG | |
4-Acetoxy-N,N-dimethyltryptamine (4-AcO-DMT) is a synthetic psychedelic compound that is structurally related to psilocybin, the active ingredient in magic mushrooms. It is a member of the tryptamine class of compounds and is known for its psychedelic effects, which are similar to those of psilocin and DMT.
Chemical Structure and Properties
4-AcO-DMT is the acetylated form of psilocin, which is the active metabolite of psilocybin. Its chemical structure consists of an indole ring, which is a common feature of tryptamines, with an acetoxy group at the 4-position and a dimethylaminoethyl side chain. The molecular formula of 4-AcO-DMT is C14H18N2O2.
Pharmacology
4-AcO-DMT is believed to act as a prodrug to psilocin, meaning that it is metabolized in the body to produce psilocin, which then exerts its effects on the brain. Psilocin primarily acts as a partial agonist at the 5-HT2A receptor, which is a subtype of the serotonin receptor. This interaction is thought to be responsible for the psychedelic effects of 4-AcO-DMT.
Effects
The effects of 4-AcO-DMT are similar to those of psilocybin and DMT, and can include:
- Altered perception of time and space
- Visual and auditory hallucinations
- Enhanced introspection and emotional experiences
- Altered thought processes
- Euphoria
The onset of effects typically occurs within 20 to 40 minutes when taken orally, with the peak effects lasting for 2 to 4 hours, and the total duration of effects lasting 4 to 6 hours.
Legal Status
The legal status of 4-AcO-DMT varies by country. In some jurisdictions, it is considered a controlled substance, while in others it remains unscheduled. It is important to check local laws and regulations regarding its use and possession.
Research and Use
4-AcO-DMT has been used in psychedelic research to study its effects on the brain and its potential therapeutic applications. Some researchers are interested in its potential to treat conditions such as depression, anxiety, and PTSD. However, more research is needed to fully understand its safety and efficacy.
Also see
| Tryptamines |
|---|
|
|