1cP-LSD: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
Line 1: Line 1:
[[File:1CP-LSD_structure.svg|thumb|1CP-LSD_structure.svg]] {{Short description|Psychedelic drug}}
{{Short description|A psychedelic compound related to LSD}}
{{Drugbox
{{Drugbox
| verifiedrevid = 477318705
| verifiedrevid = 477002123
| IUPAC_name = (6aR,9R)-4-propionyl-N,N-diethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide
| IUPAC_name = 1-cyclopropionyl-d-lysergic acid diethylamide
| image = 1cP-LSD_structure.png
| image = 1CP-LSD structure.svg
| image2 = 1cP-LSD blotter.jpg
| width = 200
| width = 200
| legal_UK = Class A
| width2 = 200
| legal_DE = NpSG
}}
| legal_CA = Schedule III
 
| legal_US = Unscheduled
'''1cP-LSD''' (1-cyclopropionyl-d-lysergic acid diethylamide) is a [[psychedelic]] compound that is structurally related to [[LSD]] (lysergic acid diethylamide). It is part of a class of substances known as [[lysergamides]], which are known for their potent effects on the human mind, often inducing altered states of consciousness, visual hallucinations, and changes in perception.
| CAS_number = 2077406-16-8
 
| ChemSpiderID = 58191448
==Chemical Structure and Properties==
| PubChem = 129828694
1cP-LSD is a derivative of LSD, with a cyclopropionyl group attached to the nitrogen of the indole ring. This modification is believed to affect the compound's pharmacokinetics, potentially altering its onset, duration, and intensity of effects compared to LSD. The chemical formula of 1cP-LSD is C23H29N3O2, and it has a molecular weight of 379.50 g/mol.
| C = 23
 
| H = 29
==Pharmacology==
| N = 3
1cP-LSD is thought to act primarily as a partial agonist at the [[serotonin receptor|5-HT2A receptor]], similar to other psychedelics. This interaction is believed to be responsible for its psychoactive effects. The compound may also interact with other serotonin receptors, contributing to its overall pharmacological profile.
| O = 2
 
| smiles = CCC(=O)C1=CNC2=C1C3CC(CC4=C3C(=CN4CC(=O)N(C)C)N(C)C)N2
==Effects==
| StdInChI = 1S/C23H29N3O2/c1-5-17(27)19-15-11-21-20-9-7-14(8-10-24-21)18(20)12-16(19)22(25-13-15)23(28)26(3)4/h13-14,18,24H,5-12H2,1-4H3
The effects of 1cP-LSD are reported to be similar to those of LSD, including:
| StdInChIKey = QXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZQXKZQXJZ
* Visual and auditory hallucinations
* Altered perception of time and space
* Enhanced introspection and emotional experiences
* Synesthesia (e.g., "seeing" sounds or "hearing" colors)
* Euphoria and a sense of well-being
 
The onset of effects typically occurs within 30 to 90 minutes after ingestion, with the peak effects lasting 6 to 10 hours, followed by a gradual comedown.
 
==Legal Status==
The legal status of 1cP-LSD varies by country. In some jurisdictions, it is considered a controlled substance, while in others, it may be legal or exist in a legal gray area. Users should be aware of the laws in their region before obtaining or using 1cP-LSD.
 
==Safety and Risks==
As with other psychedelics, the use of 1cP-LSD carries potential risks, including:
* Psychological distress or "bad trips"
* Anxiety and paranoia
* Potential for triggering latent mental health disorders
* Physical risks associated with impaired judgment and perception
 
Users are advised to approach the use of 1cP-LSD with caution, ensuring a safe and supportive environment and considering the potential psychological effects.
 
==Also see==
* [[LSD]]
* [[Psychedelic drug]]
* [[Serotonin receptor]]
* [[Lysergamide]]
 
{{Psychedelics}}
{{Psychoactive drugs}}
 
[[Category:Psychedelic drugs]]
[[Category:Lysergamides]]
[[Category:Serotonin receptor agonists]]

Revision as of 02:45, 11 December 2024

A psychedelic compound related to LSD


1cP-LSD
INN
Drug class
Routes of administration
Pregnancy category
Bioavailability
Metabolism
Elimination half-life
Excretion
Legal status
CAS Number
PubChem
DrugBank
ChemSpider
KEGG


1cP-LSD (1-cyclopropionyl-d-lysergic acid diethylamide) is a psychedelic compound that is structurally related to LSD (lysergic acid diethylamide). It is part of a class of substances known as lysergamides, which are known for their potent effects on the human mind, often inducing altered states of consciousness, visual hallucinations, and changes in perception.

Chemical Structure and Properties

1cP-LSD is a derivative of LSD, with a cyclopropionyl group attached to the nitrogen of the indole ring. This modification is believed to affect the compound's pharmacokinetics, potentially altering its onset, duration, and intensity of effects compared to LSD. The chemical formula of 1cP-LSD is C23H29N3O2, and it has a molecular weight of 379.50 g/mol.

Pharmacology

1cP-LSD is thought to act primarily as a partial agonist at the 5-HT2A receptor, similar to other psychedelics. This interaction is believed to be responsible for its psychoactive effects. The compound may also interact with other serotonin receptors, contributing to its overall pharmacological profile.

Effects

The effects of 1cP-LSD are reported to be similar to those of LSD, including:

  • Visual and auditory hallucinations
  • Altered perception of time and space
  • Enhanced introspection and emotional experiences
  • Synesthesia (e.g., "seeing" sounds or "hearing" colors)
  • Euphoria and a sense of well-being

The onset of effects typically occurs within 30 to 90 minutes after ingestion, with the peak effects lasting 6 to 10 hours, followed by a gradual comedown.

Legal Status

The legal status of 1cP-LSD varies by country. In some jurisdictions, it is considered a controlled substance, while in others, it may be legal or exist in a legal gray area. Users should be aware of the laws in their region before obtaining or using 1cP-LSD.

Safety and Risks

As with other psychedelics, the use of 1cP-LSD carries potential risks, including:

  • Psychological distress or "bad trips"
  • Anxiety and paranoia
  • Potential for triggering latent mental health disorders
  • Physical risks associated with impaired judgment and perception

Users are advised to approach the use of 1cP-LSD with caution, ensuring a safe and supportive environment and considering the potential psychological effects.

Also see