Pyrazolam: Difference between revisions
Tag: Undo |
CSV import |
||
| Line 1: | Line 1: | ||
[[ | {{Short description|A benzodiazepine derivative}} | ||
== | {{Drugbox | ||
| verifiedfields = changed | |||
| verifiedrevid = 477002123 | |||
| IUPAC_name = 8-bromo-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine | |||
| image = Pyrazolam_structure.png | |||
| width = 200 | |||
| CAS_number = 39241-27-5 | |||
| PubChem = 9827100 | |||
| ChemSpiderID = 8003030 | |||
| UNII = 3F0I74K3X7 | |||
| C=16 | |||
| H=12 | |||
| Br=1 | |||
| N=5 | |||
| smiles = CN1C2=NC=NN2C3=C(C=C(C=C3)Br)C4=CC=CC=C4C1 | |||
}} | |||
'''Pyrazolam''' is a derivative | '''Pyrazolam''' is a [[benzodiazepine]] derivative that was first synthesized in the 1970s. It is known for its anxiolytic properties and is used primarily in research settings. Unlike many other benzodiazepines, pyrazolam is not commonly prescribed for therapeutic use. | ||
== | ==Chemical Structure and Properties== | ||
Pyrazolam belongs to the [[triazolobenzodiazepine]] class, which is characterized by the fusion of a triazole ring to the benzodiazepine structure. The chemical formula for pyrazolam is C<sub>16</sub>H<sub>12</sub>BrN<sub>5</sub>. It is structurally related to other benzodiazepines such as [[alprazolam]] and [[bromazepam]]. | |||
Pyrazolam | ==Pharmacology== | ||
Pyrazolam acts as a [[positive allosteric modulator]] of the [[GABA<sub>A</sub> receptor]], which enhances the effect of the neurotransmitter [[gamma-aminobutyric acid]] (GABA). This action results in increased [[inhibitory neurotransmission]] in the brain, leading to its anxiolytic effects. Pyrazolam has a high affinity for the benzodiazepine site on the GABA<sub>A</sub> receptor, which contributes to its potency. | |||
=== | ==Effects== | ||
The primary effects of pyrazolam include: | |||
* Anxiolytic: Reduction of anxiety and stress. | |||
* Sedative: Induction of calmness and relaxation. | |||
* Muscle relaxant: Reduction of muscle tension. | |||
Unlike some other benzodiazepines, pyrazolam is reported to have minimal [[hypnotic]] effects, making it less likely to induce sleep. | |||
==Usage== | |||
Pyrazolam is not approved for medical use in most countries and is primarily used in research settings to study the effects of benzodiazepines on the central nervous system. It is sometimes encountered in the [[designer drug]] market, where it is sold as a research chemical. | |||
==Legal Status== | |||
The legal status of pyrazolam varies by country. In some jurisdictions, it is classified as a controlled substance, while in others, it remains unscheduled. Researchers and users should be aware of the legal implications of possessing or using pyrazolam in their respective regions. | |||
==Safety and Toxicity== | |||
As with other benzodiazepines, the use of pyrazolam carries the risk of [[dependence]] and [[withdrawal symptoms]]. Overdose can lead to severe [[central nervous system depression]], respiratory depression, and potentially fatal outcomes. Caution is advised when using pyrazolam, especially in combination with other central nervous system depressants such as [[alcohol]] or [[opioids]]. | |||
== | ==Related Pages== | ||
* [[Benzodiazepine]] | |||
* [[GABA<sub>A</sub> receptor]] | |||
* [[Anxiolytic]] | |||
* [[Triazolobenzodiazepine]] | |||
[[Category:Benzodiazepines]] | |||
[[Category:Anxiolytics]] | |||
[[Category:Research chemicals]] | |||
[[Category: | |||
Revision as of 19:04, 22 March 2025
A benzodiazepine derivative
| Pyrazolam | |
|---|---|
| File:Pyrazolam structure.png | |
| INN | |
| Drug class | |
| Routes of administration | |
| Pregnancy category | |
| Bioavailability | |
| Metabolism | |
| Elimination half-life | |
| Excretion | |
| Legal status | |
| CAS Number | 39241-27-5 |
| PubChem | 9827100 |
| DrugBank | |
| ChemSpider | 8003030 |
| KEGG | |
Pyrazolam is a benzodiazepine derivative that was first synthesized in the 1970s. It is known for its anxiolytic properties and is used primarily in research settings. Unlike many other benzodiazepines, pyrazolam is not commonly prescribed for therapeutic use.
Chemical Structure and Properties
Pyrazolam belongs to the triazolobenzodiazepine class, which is characterized by the fusion of a triazole ring to the benzodiazepine structure. The chemical formula for pyrazolam is C16H12BrN5. It is structurally related to other benzodiazepines such as alprazolam and bromazepam.
Pharmacology
Pyrazolam acts as a positive allosteric modulator of the [[GABAA receptor]], which enhances the effect of the neurotransmitter gamma-aminobutyric acid (GABA). This action results in increased inhibitory neurotransmission in the brain, leading to its anxiolytic effects. Pyrazolam has a high affinity for the benzodiazepine site on the GABAA receptor, which contributes to its potency.
Effects
The primary effects of pyrazolam include:
- Anxiolytic: Reduction of anxiety and stress.
- Sedative: Induction of calmness and relaxation.
- Muscle relaxant: Reduction of muscle tension.
Unlike some other benzodiazepines, pyrazolam is reported to have minimal hypnotic effects, making it less likely to induce sleep.
Usage
Pyrazolam is not approved for medical use in most countries and is primarily used in research settings to study the effects of benzodiazepines on the central nervous system. It is sometimes encountered in the designer drug market, where it is sold as a research chemical.
Legal Status
The legal status of pyrazolam varies by country. In some jurisdictions, it is classified as a controlled substance, while in others, it remains unscheduled. Researchers and users should be aware of the legal implications of possessing or using pyrazolam in their respective regions.
Safety and Toxicity
As with other benzodiazepines, the use of pyrazolam carries the risk of dependence and withdrawal symptoms. Overdose can lead to severe central nervous system depression, respiratory depression, and potentially fatal outcomes. Caution is advised when using pyrazolam, especially in combination with other central nervous system depressants such as alcohol or opioids.
Related Pages
- Benzodiazepine
- [[GABAA receptor]]
- Anxiolytic
- Triazolobenzodiazepine