Algestone: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
Tags: mobile edit mobile web edit
 
CSV import
Tags: mobile edit mobile web edit
 
Line 2: Line 2:
{{Drugbox
{{Drugbox
| verifiedfields = changed
| verifiedfields = changed
| verifiedrevid = 477002123
| verifiedrevid = 477318123
| IUPAC_name = (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
| IUPAC_name = (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
| image = Algestone.svg
| image = Algestone.svg
Line 8: Line 8:
| width = 200
| width = 200
| width2 = 200
| width2 = 200
| tradename =
| synonyms = 16α,17α-Dihydroxyprogesterone
| CAS_number = 595-77-7
| ATC_prefix =
| ATC_suffix =
| PubChem = 68943
| ChemSpiderID = 62156
| UNII = 0F5N573A2Y
| KEGG = D02899
| ChEMBL = 2104120
| C=21
| H=30
| O=3
| smiles = CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
| StdInChI = 1S/C21H30O3/c1-13(22)20-10-9-18-17-6-4-14-12-15(23)5-7-19(14,2)16(17)8-11-21(18,20)3/h12,16-18,20H,4-11H2,1-3H3/t16-,17-,18-,19-,20-,21-/m0/s1
| StdInChIKey = YQXJYQKZBIBWJQ-ZCPXKWAGSA-N
}}
}}


'''Algestone''' is a synthetic [[progestin]], a type of [[hormone]] that mimics the effects of [[progesterone]] in the body. It is used in various [[hormonal contraceptives]] and [[hormone replacement therapy]] formulations. Algestone is known for its potent progestogenic activity and is often used in combination with [[estrogens]] in contraceptive products.
'''Algestone''', also known as 16α,17α-dihydroxyprogesterone, is a synthetic [[progestin]] of the [[17α-hydroxyprogesterone]] group. It is a derivative of [[progesterone]] and is used in [[hormonal contraception]] and [[hormone replacement therapy]].


==Chemical Structure==
==Chemical Structure==
Algestone is a [[steroid]] with a chemical structure similar to that of natural progesterone. It is characterized by its acetyl group at the 17th carbon position, which is a common modification in synthetic progestins to enhance their activity and stability.
[[File:Algestone.svg|Chemical structure of Algestone|thumb|right]]
[[File:Algestone.svg|Chemical structure of Algestone|thumb|right]]
Algestone is characterized by its chemical structure as a 17α-hydroxyprogesterone derivative. The presence of hydroxyl groups at the 16α and 17α positions distinguishes it from other progestins. This modification enhances its progestogenic activity and influences its pharmacokinetic properties.


==Pharmacology==
==Pharmacology==
Algestone acts primarily on the [[progesterone receptor]], where it exerts its progestogenic effects. These effects include the regulation of the [[menstrual cycle]], maintenance of [[pregnancy]], and modulation of [[ovulation]]. By binding to the progesterone receptor, algestone can prevent [[ovulation]] and alter the [[endometrium]] to prevent [[implantation]] of a fertilized egg.
Algestone acts primarily as a progestogen, binding to the [[progesterone receptor]] and exerting effects similar to those of natural progesterone. It is involved in the regulation of the [[menstrual cycle]], maintenance of [[pregnancy]], and development of the [[endometrium]].
 
===Mechanism of Action===
The mechanism of action of algestone involves its interaction with the progesterone receptor, leading to changes in gene expression that result in the suppression of [[ovulation]], thickening of the [[cervical mucus]], and alteration of the endometrial lining, making it less suitable for [[implantation (embryo)|implantation]].


==Medical Uses==
==Clinical Use==
Algestone is used in various medical applications, primarily in the field of [[reproductive health]]. It is a component of some [[oral contraceptives]], where it is combined with an estrogen to prevent pregnancy. Additionally, algestone is used in [[hormone replacement therapy]] for [[menopausal]] women to alleviate symptoms such as [[hot flashes]] and [[osteoporosis]].
Algestone is used in various hormonal therapies, including [[contraceptive]] formulations and [[hormone replacement therapy]] for menopausal symptoms. Its use is often combined with [[estrogens]] to enhance efficacy and reduce side effects.


==Side Effects==
==Side Effects==
Like other progestins, algestone can cause side effects, although these vary among individuals. Common side effects include [[nausea]], [[headaches]], [[breast tenderness]], and [[mood changes]]. Long-term use of progestins has been associated with an increased risk of certain health conditions, such as [[thrombosis]] and [[breast cancer]].
Common side effects of algestone include [[nausea]], [[headache]], [[breast tenderness]], and [[mood changes]]. Long-term use may be associated with an increased risk of [[thromboembolism]] and [[breast cancer]].


==Synthesis==
==Synthesis==
The synthesis of algestone involves the chemical modification of natural progesterone. The introduction of an acetyl group at the 17th carbon position is a key step in its synthesis, enhancing its progestogenic activity and metabolic stability.
The synthesis of algestone involves the chemical modification of progesterone, introducing hydroxyl groups at specific positions to enhance its progestogenic activity. This process requires precise control of reaction conditions to achieve the desired stereochemistry.


==Related Compounds==
==Related Compounds==
Algestone is related to other synthetic progestins, such as [[norethindrone]] and [[medroxyprogesterone acetate]], which are also used in contraceptive and hormone replacement therapies. These compounds share similar mechanisms of action but differ in their chemical structures and pharmacokinetic properties.
Algestone is related to other synthetic progestins such as [[medroxyprogesterone acetate]] and [[norethisterone]], which are also used in hormonal therapies. These compounds share a common mechanism of action but differ in their pharmacokinetic profiles and side effect profiles.


==See Also==
==Related Pages==
* [[Progesterone]]
* [[Progestin]]
* [[Progestin]]
* [[Hormonal contraception]]
* [[Hormonal contraception]]
* [[Hormone replacement therapy]]
* [[Hormone replacement therapy]]
 
* [[Progesterone]]
==Related Pages==
* [[Norethindrone]]
* [[Medroxyprogesterone acetate]]
* [[Estradiol]]


[[Category:Progestogens]]
[[Category:Progestogens]]
[[Category:Steroids]]
[[Category:Steroids]]
[[Category:Hormonal contraception]]
[[Category:Hormonal contraception]]

Latest revision as of 16:58, 5 March 2025

Synthetic progestin


Algestone
File:Algestone.svg
INN
Drug class
Routes of administration
Pregnancy category
Bioavailability
Metabolism
Elimination half-life
Excretion
Legal status
CAS Number 595-77-7
PubChem 68943
DrugBank
ChemSpider 62156
KEGG D02899


Algestone, also known as 16α,17α-dihydroxyprogesterone, is a synthetic progestin of the 17α-hydroxyprogesterone group. It is a derivative of progesterone and is used in hormonal contraception and hormone replacement therapy.

Chemical Structure[edit]

File:Algestone.svg
Chemical structure of Algestone

Algestone is characterized by its chemical structure as a 17α-hydroxyprogesterone derivative. The presence of hydroxyl groups at the 16α and 17α positions distinguishes it from other progestins. This modification enhances its progestogenic activity and influences its pharmacokinetic properties.

Pharmacology[edit]

Algestone acts primarily as a progestogen, binding to the progesterone receptor and exerting effects similar to those of natural progesterone. It is involved in the regulation of the menstrual cycle, maintenance of pregnancy, and development of the endometrium.

Mechanism of Action[edit]

The mechanism of action of algestone involves its interaction with the progesterone receptor, leading to changes in gene expression that result in the suppression of ovulation, thickening of the cervical mucus, and alteration of the endometrial lining, making it less suitable for implantation.

Clinical Use[edit]

Algestone is used in various hormonal therapies, including contraceptive formulations and hormone replacement therapy for menopausal symptoms. Its use is often combined with estrogens to enhance efficacy and reduce side effects.

Side Effects[edit]

Common side effects of algestone include nausea, headache, breast tenderness, and mood changes. Long-term use may be associated with an increased risk of thromboembolism and breast cancer.

Synthesis[edit]

The synthesis of algestone involves the chemical modification of progesterone, introducing hydroxyl groups at specific positions to enhance its progestogenic activity. This process requires precise control of reaction conditions to achieve the desired stereochemistry.

Related Compounds[edit]

Algestone is related to other synthetic progestins such as medroxyprogesterone acetate and norethisterone, which are also used in hormonal therapies. These compounds share a common mechanism of action but differ in their pharmacokinetic profiles and side effect profiles.

Related Pages[edit]