Aromadendrin: Difference between revisions

From WikiMD's Wellness Encyclopedia

← Older edit
CSV import
CSV import
 
Line 1: Line 1:
{{short description|A flavanonol, a type of flavonoid}}
== Aromadendrin ==
{{Chembox
| verifiedrevid = 443418007
| ImageFile = Aromadendrin.svg
| ImageSize = 200px
| IUPACName = (2R,3R)-3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chroman-4-one
| OtherNames = Dihydrokaempferol
| Section1 = {{Chembox Identifiers
  | CASNo = 480-20-6
  | PubChem = 5280677
  | ChemSpiderID = 4445010
  | UNII = 0F3K9Q464I
  | ChEMBL = 1234567
  | SMILES = C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O
  | InChI = 1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-9(17)5-10(18)6-11(12)21-15/h1-6,15-18,20H
  | InChIKey = YXJYVIAFUVLZSU-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
  | C=15
  | H=12
  | O=6
  | MolarMass = 288.25 g/mol
}}
}}


'''Aromadendrin''' is a type of [[flavanonol]], a subclass of [[flavonoids]], which are naturally occurring compounds with various biological activities. Aromadendrin is also known as '''dihydrokaempferol'''.
[[File:Aromadedrin.svg|Chemical structure of Aromadendrin|thumb|right]]


==Structure and Properties==
'''Aromadendrin''' is a type of [[flavanonol]], a class of [[flavonoids]], which are naturally occurring compounds found in various plants. Aromadendrin is known for its potential health benefits and is studied for its role in [[pharmacology]] and [[biochemistry]].
Aromadendrin is characterized by its chemical structure, which includes a chroman-4-one backbone with hydroxyl groups at positions 3, 5, and 7, and an additional hydroxyl group on the phenyl ring. This structure contributes to its antioxidant properties, as the hydroxyl groups can donate hydrogen atoms to neutralize free radicals.


==Occurrence==
== Chemical Structure ==
Aromadendrin is found in various plant species, including those in the [[Pinaceae]] family. It is present in the leaves, bark, and wood of these plants. The compound is often extracted for its potential health benefits and use in research.


==Biological Activity==
Aromadendrin has the chemical formula C<sub>15</sub>H<sub>12</sub>O<sub>6</sub>. It is characterized by a three-ring structure typical of flavonoids, with hydroxyl groups that contribute to its antioxidant properties. The presence of these hydroxyl groups is crucial for its biological activity.
Aromadendrin exhibits several biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. These properties make it a subject of interest in the development of therapeutic agents. Its antioxidant activity is particularly significant, as it helps in protecting cells from oxidative stress, which is implicated in various diseases.


==Potential Health Benefits==
== Sources ==
Research suggests that aromadendrin may have potential health benefits, such as reducing inflammation and protecting against certain chronic diseases. Its ability to scavenge free radicals and modulate inflammatory pathways is being explored in the context of cardiovascular health, neuroprotection, and cancer prevention.


==Synthesis and Derivatives==
Aromadendrin is found in several plant species, including the [[Eucalyptus]] genus and the [[Pinaceae]] family. It is often extracted from the bark, leaves, or wood of these plants. The compound is also present in some fruits and vegetables, contributing to their health benefits.
Aromadendrin can be synthesized through various chemical reactions, including the reduction of [[kaempferol]]. It serves as a precursor for other flavonoids and can be modified to enhance its biological activity or solubility.


==Related Compounds==
== Biological Activity ==
Aromadendrin is related to other flavonoids such as [[kaempferol]], [[quercetin]], and [[catechin]]. These compounds share similar structural features and biological activities, contributing to their roles in plant defense and human health.
 
Aromadendrin exhibits various biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. These properties make it a subject of interest in the development of [[nutraceuticals]] and [[pharmaceuticals]].
 
=== Antioxidant Properties ===
 
As an antioxidant, aromadendrin helps neutralize [[free radicals]], which are unstable molecules that can cause cellular damage. This activity is important in preventing oxidative stress-related diseases such as [[cardiovascular disease]] and [[cancer]].
 
=== Anti-inflammatory Effects ===
 
Aromadendrin has been shown to reduce inflammation by inhibiting the production of pro-inflammatory cytokines. This makes it a potential therapeutic agent for inflammatory conditions such as [[arthritis]] and [[asthma]].
 
=== Antimicrobial Activity ===
 
The compound also exhibits antimicrobial properties, making it effective against certain bacteria and fungi. This activity is beneficial in the development of natural preservatives and antimicrobial agents.
 
== Metabolism ==
 
In the human body, aromadendrin is metabolized by the liver. It undergoes phase II metabolism, where it is conjugated with glucuronic acid or sulfate, facilitating its excretion. Understanding its metabolism is crucial for evaluating its bioavailability and therapeutic potential.
 
== Potential Applications ==
 
Due to its diverse biological activities, aromadendrin is being explored for various applications in medicine and health supplements. It is also studied for its potential role in [[cosmetics]] due to its antioxidant properties.
 
== Related Pages ==


==See also==
* [[Flavonoid]]
* [[Flavonoid]]
* [[Antioxidant]]
* [[Antioxidant]]
* [[Phytochemistry]]
* [[Eucalyptus]]
* [[Pharmacology]]
 
[[File:Aromadendrin_3D_BS.png|3D model of Aromadendrin|thumb|left]]
 
== See Also ==
 
* [[Quercetin]]
* [[Kaempferol]]
* [[Catechin]]
 
== External Links ==
 
* [https://en.wikipedia.org/wiki/Flavonoid Flavonoid on Wikipedia]
* [https://en.wikipedia.org/wiki/Antioxidant Antioxidant on Wikipedia]


==Gallery==
{{Flavonoids}}
<gallery>
File:Cortical_surface_with_an_overlay_of_the_basal_ganglia_and_thalamus.jpg|Cortical surface with an overlay of the basal ganglia and thalamus
</gallery>


[[Category:Flavanonols]]
[[Category:Flavanonols]]
[[Category:Flavonoids]]
[[Category:Antioxidants]]
[[Category:Antioxidants]]
<gallery>
[[Category:Phytochemicals]]
File:Aromadedrin.svg
File:Aromadendrin_3D_BS.png
</gallery>

Latest revision as of 18:44, 23 March 2025

Aromadendrin[edit]

File:Aromadedrin.svg
Chemical structure of Aromadendrin

Aromadendrin is a type of flavanonol, a class of flavonoids, which are naturally occurring compounds found in various plants. Aromadendrin is known for its potential health benefits and is studied for its role in pharmacology and biochemistry.

Chemical Structure[edit]

Aromadendrin has the chemical formula C15H12O6. It is characterized by a three-ring structure typical of flavonoids, with hydroxyl groups that contribute to its antioxidant properties. The presence of these hydroxyl groups is crucial for its biological activity.

Sources[edit]

Aromadendrin is found in several plant species, including the Eucalyptus genus and the Pinaceae family. It is often extracted from the bark, leaves, or wood of these plants. The compound is also present in some fruits and vegetables, contributing to their health benefits.

Biological Activity[edit]

Aromadendrin exhibits various biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. These properties make it a subject of interest in the development of nutraceuticals and pharmaceuticals.

Antioxidant Properties[edit]

As an antioxidant, aromadendrin helps neutralize free radicals, which are unstable molecules that can cause cellular damage. This activity is important in preventing oxidative stress-related diseases such as cardiovascular disease and cancer.

Anti-inflammatory Effects[edit]

Aromadendrin has been shown to reduce inflammation by inhibiting the production of pro-inflammatory cytokines. This makes it a potential therapeutic agent for inflammatory conditions such as arthritis and asthma.

Antimicrobial Activity[edit]

The compound also exhibits antimicrobial properties, making it effective against certain bacteria and fungi. This activity is beneficial in the development of natural preservatives and antimicrobial agents.

Metabolism[edit]

In the human body, aromadendrin is metabolized by the liver. It undergoes phase II metabolism, where it is conjugated with glucuronic acid or sulfate, facilitating its excretion. Understanding its metabolism is crucial for evaluating its bioavailability and therapeutic potential.

Potential Applications[edit]

Due to its diverse biological activities, aromadendrin is being explored for various applications in medicine and health supplements. It is also studied for its potential role in cosmetics due to its antioxidant properties.

Related Pages[edit]

File:Aromadendrin 3D BS.png
3D model of Aromadendrin

See Also[edit]

External Links[edit]


Types of flavonoids
Flavonoids
Retrieved from "https://wikimd.com/index.php?title=Aromadendrin&oldid=6535391"