Methandriol: Difference between revisions
CSV import |
CSV import |
||
| Line 1: | Line 1: | ||
{{Short description|An anabolic steroid}} | |||
{{Drugbox | |||
| verifiedfields = changed | |||
| verifiedrevid = 477002295 | |||
| IUPAC_name = 17α-Methylandrost-5-ene-3β,17β-diol | |||
| image = Methandriol.svg | |||
| image_size = 200px | |||
| image_alt = Structural formula of Methandriol | |||
| width = | |||
| alt = | |||
| CAS_number = 521-10-8 | |||
| ATC_prefix = | |||
| ATC_suffix = | |||
| PubChem = 3032564 | |||
| DrugBank = DB01436 | |||
| ChemSpiderID = 2290000 | |||
| UNII = 1JQS135EYN | |||
| KEGG = D05032 | |||
| ChEBI = 34858 | |||
| ChEMBL = 2104524 | |||
| C=20 | |||
| H=32 | |||
| O=2 | |||
| smiles = CC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](CC[C@]4(C)[C@@H]3CC[C@]12C)O | |||
| StdInChI = 1S/C20H32O2/c1-13(2)14-5-6-15-16-7-8-18-17(16)9-10-20(3)19(18)11-12-21,22/h7-8,13-14,16-17,19-22H,5-6,9-12H2,1-4H3/t16-,17-,19+,20+/m1/s1 | |||
| StdInChIKey = YAPQBXQYLJRXSA-CQKQYVBDSA-N | |||
}} | |||
'''Methandriol''' is a synthetic [[anabolic steroid]] and a derivative of [[testosterone]]. It is known for its ability to promote muscle growth and enhance physical performance. Methandriol is used in veterinary medicine and has been marketed under various brand names. | |||
Methandriol | ==Chemical Structure and Properties== | ||
[[File:Methandriol.svg|thumb|right|Structural formula of Methandriol]] | |||
Methandriol is chemically known as 17α-Methylandrost-5-ene-3β,17β-diol. It is a [[17α-alkylated]] derivative of [[androstenediol]], which is a naturally occurring [[androgen]]. The presence of the 17α-methyl group in methandriol increases its oral bioavailability, allowing it to be administered orally. | |||
== | ==Pharmacology== | ||
Methandriol exhibits both [[anabolic]] and [[androgenic]] properties. It binds to [[androgen receptors]] in muscle tissue, promoting protein synthesis and muscle growth. The anabolic effects of methandriol are utilized in veterinary medicine to improve weight gain and muscle mass in livestock. | |||
Methandriol is used in medicine | ==Medical Uses== | ||
Methandriol is primarily used in veterinary medicine. It has been used to promote growth in animals such as cattle and sheep. In humans, methandriol has been used in the past for its anabolic effects, but its use is limited due to the availability of other anabolic steroids with more favorable safety profiles. | |||
== Side | ==Side Effects== | ||
The use of methandriol can lead to several side effects, particularly when used in high doses or for extended periods. Common side effects include [[liver toxicity]], [[hypertension]], and [[acne]]. Due to its androgenic properties, methandriol can also cause [[virilization]] in women, leading to the development of male characteristics. | |||
==Legal Status== | |||
Methandriol is classified as a controlled substance in many countries due to its potential for abuse and adverse health effects. Its use is restricted to veterinary applications in most jurisdictions. | |||
== Legal | |||
==Related Pages== | |||
* [[Anabolic steroid]] | * [[Anabolic steroid]] | ||
* [[ | * [[Androgen]] | ||
* [[ | * [[Testosterone]] | ||
* [[ | * [[Androstenediol]] | ||
[[Category:Anabolic steroids]] | [[Category:Anabolic steroids]] | ||
[[Category: | [[Category:Androgens and anabolic steroids]] | ||
[[Category: | [[Category:Veterinary drugs]] | ||
Latest revision as of 11:20, 23 March 2025
An anabolic steroid
| Methandriol | |
|---|---|
| File:Methandriol.svg | |
| INN | |
| Drug class | |
| Routes of administration | |
| Pregnancy category | |
| Bioavailability | |
| Metabolism | |
| Elimination half-life | |
| Excretion | |
| Legal status | |
| CAS Number | 521-10-8 |
| PubChem | 3032564 |
| DrugBank | DB01436 |
| ChemSpider | 2290000 |
| KEGG | D05032 |
Methandriol is a synthetic anabolic steroid and a derivative of testosterone. It is known for its ability to promote muscle growth and enhance physical performance. Methandriol is used in veterinary medicine and has been marketed under various brand names.
Chemical Structure and Properties[edit]
Methandriol is chemically known as 17α-Methylandrost-5-ene-3β,17β-diol. It is a 17α-alkylated derivative of androstenediol, which is a naturally occurring androgen. The presence of the 17α-methyl group in methandriol increases its oral bioavailability, allowing it to be administered orally.
Pharmacology[edit]
Methandriol exhibits both anabolic and androgenic properties. It binds to androgen receptors in muscle tissue, promoting protein synthesis and muscle growth. The anabolic effects of methandriol are utilized in veterinary medicine to improve weight gain and muscle mass in livestock.
Medical Uses[edit]
Methandriol is primarily used in veterinary medicine. It has been used to promote growth in animals such as cattle and sheep. In humans, methandriol has been used in the past for its anabolic effects, but its use is limited due to the availability of other anabolic steroids with more favorable safety profiles.
Side Effects[edit]
The use of methandriol can lead to several side effects, particularly when used in high doses or for extended periods. Common side effects include liver toxicity, hypertension, and acne. Due to its androgenic properties, methandriol can also cause virilization in women, leading to the development of male characteristics.
Legal Status[edit]
Methandriol is classified as a controlled substance in many countries due to its potential for abuse and adverse health effects. Its use is restricted to veterinary applications in most jurisdictions.