3-MeO-PCE: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
Line 1: Line 1:
{{Short description|A dissociative anesthetic drug}}
{{DISPLAYTITLE:3-MeO-PCE}}
{{Drugbox
| verifiedrevid = 477318123
| IUPAC_name = 2-(3-methoxyphenyl)-2-(ethylamino)cyclohexan-1-one
| image = 3-MeO-PCE.svg
| width = 200px
| legal_status = Uncontrolled
| routes_of_administration = Oral, Insufflation, Intravenous
| CAS_number = 1364933-54-9
| PubChem = 11905492
| ChemSpiderID = 10037792
| UNII = 3F8A2Q8G5V
| C=15
| H=21
| N=1
| O=2
| smiles = CCNC1(CCCCC1=O)c2cccc(OC)c2
}}


'''3-Methoxyeticyclidine''' ('''3-MeO-PCE''') is a [[dissociative anesthetic]] of the [[arylcyclohexylamine]] class. It is chemically related to [[phencyclidine]] (PCP) and [[3-MeO-PCP]].
== 3-MeO-PCE ==


==Pharmacology==
[[File:3-MeO-PCE.svg|thumb|right|Chemical structure of 3-MeO-PCE]]
3-MeO-PCE acts primarily as an [[NMDA receptor antagonist]], which leads to its dissociative effects. By inhibiting the NMDA receptor, 3-MeO-PCE disrupts the normal function of the [[glutamate]] neurotransmitter system, which is crucial for [[synaptic plasticity]], [[memory]], and [[learning]].


==Effects==
'''3-Methoxyeticyclidine''' ('''3-MeO-PCE''') is a [[dissociative anesthetic]] of the [[arylcyclohexylamine]] class. It is chemically related to [[phencyclidine]] (PCP) and [[methoxetamine]] (MXE), and is known for its [[psychoactive]] effects. 3-MeO-PCE is used in [[research]] settings and has been encountered as a [[designer drug]].
The effects of 3-MeO-PCE can vary significantly depending on the dose and the individual. Common effects include:
* Dissociation
* Euphoria
* Altered perception of time and space
* Visual and auditory hallucinations
* Analgesia


At higher doses, users may experience more profound dissociation, leading to a state often referred to as "hole" or "K-hole," similar to the effects of [[ketamine]].
== Chemical Structure and Properties ==


==Chemistry==
3-MeO-PCE is a derivative of [[eticyclidine]] (PCE), with a methoxy group at the 3-position of the [[phenyl ring]]. Its chemical formula is C15H23NO, and it has a molecular weight of 233.35 g/mol. The presence of the methoxy group is thought to influence its [[pharmacological]] properties, differentiating it from other arylcyclohexylamines.
3-MeO-PCE is a derivative of [[eticyclidine]] (PCE), with a methoxy group attached to the third carbon of the phenyl ring. Its chemical structure is similar to that of [[3-MeO-PCP]], differing only in the length of the carbon chain attached to the nitrogen atom.


==Legal status==
== Pharmacology ==
The legal status of 3-MeO-PCE varies by country. In some jurisdictions, it is classified as a controlled substance, while in others, it remains unscheduled. Users should be aware of the legal implications of possessing or using 3-MeO-PCE in their region.


==Safety and toxicity==
3-MeO-PCE acts primarily as an [[NMDA receptor antagonist]], similar to other dissociatives like [[ketamine]] and PCP. This action is responsible for its dissociative effects, which include [[analgesia]], [[anesthesia]], and [[hallucinations]]. The compound may also interact with other [[neurotransmitter]] systems, contributing to its complex [[psychotropic]] profile.
The safety profile of 3-MeO-PCE is not well-established, and its use carries potential risks. Users may experience adverse effects such as:
* Nausea
* Vomiting
* Anxiety
* Paranoia
* Psychosis


Long-term use may lead to [[tolerance]], [[dependence]], and potential [[neurotoxicity]].
== Effects ==


==Related pages==
The effects of 3-MeO-PCE can vary depending on the dose and individual [[sensitivity]]. Common effects include:
* [[Phencyclidine]]
 
* [[3-MeO-PCP]]
* Dissociation and [[depersonalization]]
* Euphoria and [[stimulation]]
* Altered [[perception]] of time and space
* [[Visual]] and [[auditory]] hallucinations
* [[Cognitive]] and [[memory]] impairment
 
At higher doses, 3-MeO-PCE can cause more intense dissociative states, which may be accompanied by [[motor]] impairment and [[nausea]].
 
== Legal Status ==
 
The legal status of 3-MeO-PCE varies by country. In some jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of approved medical use. In others, it may be unscheduled but subject to [[analogue]] laws.
 
== Safety and Risks ==
 
The use of 3-MeO-PCE carries several risks, particularly at high doses or when combined with other substances. Potential risks include:
 
* [[Psychosis]] and [[agitation]]
* [[Cardiovascular]] effects such as increased [[heart rate]] and [[blood pressure]]
* [[Respiratory depression]]
* [[Addiction]] and [[tolerance]]
 
Users should exercise caution and be aware of the potential for [[adverse reactions]].
 
== Related Compounds ==
 
3-MeO-PCE is part of a broader class of arylcyclohexylamines, which includes:
 
* [[Phencyclidine]] (PCP)
* [[Ketamine]]
* [[Ketamine]]
* [[Methoxetamine]] (MXE)
* [[Dextromethorphan]] (DXM)
These compounds share similar mechanisms of action but differ in their potency, duration, and subjective effects.
== Related Pages ==
* [[Dissociative drug]]
* [[Dissociative drug]]
 
* [[NMDA receptor antagonist]]
==Gallery==
* [[Designer drug]]
<gallery>
File:3-MeO-PCE.svg|Chemical structure of 3-MeO-PCE
</gallery>


[[Category:Dissociative drugs]]
[[Category:Dissociative drugs]]
[[Category:Arylcyclohexylamines]]
[[Category:Arylcyclohexylamines]]

Latest revision as of 03:30, 13 February 2025


3-MeO-PCE[edit]

Chemical structure of 3-MeO-PCE

3-Methoxyeticyclidine (3-MeO-PCE) is a dissociative anesthetic of the arylcyclohexylamine class. It is chemically related to phencyclidine (PCP) and methoxetamine (MXE), and is known for its psychoactive effects. 3-MeO-PCE is used in research settings and has been encountered as a designer drug.

Chemical Structure and Properties[edit]

3-MeO-PCE is a derivative of eticyclidine (PCE), with a methoxy group at the 3-position of the phenyl ring. Its chemical formula is C15H23NO, and it has a molecular weight of 233.35 g/mol. The presence of the methoxy group is thought to influence its pharmacological properties, differentiating it from other arylcyclohexylamines.

Pharmacology[edit]

3-MeO-PCE acts primarily as an NMDA receptor antagonist, similar to other dissociatives like ketamine and PCP. This action is responsible for its dissociative effects, which include analgesia, anesthesia, and hallucinations. The compound may also interact with other neurotransmitter systems, contributing to its complex psychotropic profile.

Effects[edit]

The effects of 3-MeO-PCE can vary depending on the dose and individual sensitivity. Common effects include:

At higher doses, 3-MeO-PCE can cause more intense dissociative states, which may be accompanied by motor impairment and nausea.

Legal Status[edit]

The legal status of 3-MeO-PCE varies by country. In some jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of approved medical use. In others, it may be unscheduled but subject to analogue laws.

Safety and Risks[edit]

The use of 3-MeO-PCE carries several risks, particularly at high doses or when combined with other substances. Potential risks include:

Users should exercise caution and be aware of the potential for adverse reactions.

Related Compounds[edit]

3-MeO-PCE is part of a broader class of arylcyclohexylamines, which includes:

These compounds share similar mechanisms of action but differ in their potency, duration, and subjective effects.

Related Pages[edit]

Retrieved from "https://wikimd.com/index.php?title=3-MeO-PCE&oldid=6290046"