Medifoxamine: Difference between revisions
CSV import |
CSV import |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
'''Medifoxamine''' is an [[antidepressant]] | {{Short description|An atypical antidepressant}} | ||
{{Drugbox | |||
| verifiedrevid = 477318123 | |||
| image = [[File:Medifoxamine.svg|thumb|Chemical structure of Medifoxamine]] | |||
| IUPAC_name = 2-(3,4-dimethoxyphenyl)-2-methylaminopropan-1-one | |||
| tradename = Clédial, Gerdaxyl | |||
| legal_status = Rx-only | |||
| routes_of_administration = Oral | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = Hepatic | |||
| elimination_half-life = | |||
| excretion = Renal | |||
| CAS_number = 3239-44-9 | |||
| ATC_prefix = N06 | |||
| ATC_suffix = AX09 | |||
| PubChem = 4053 | |||
| DrugBank = DB08998 | |||
| ChemSpiderID = 3913 | |||
| UNII = 0T493YFU8O | |||
| KEGG = D07355 | |||
| ChEMBL = 2104660 | |||
| C=12 | |||
| H=17 | |||
| N=1 | |||
| O=3 | |||
| smiles = CC(C(=O)C1=CC(=C(C=C1)OC)OC)NC | |||
| StdInChI = 1S/C12H17NO3/c1-8(13-2)12(14)9-5-6-10(15-3)11(7-9)16-4/h5-8,13H,1-4H3 | |||
| StdInChIKey = ZJQJHFOYQZKEMV-UHFFFAOYSA-N | |||
}} | |||
'''Medifoxamine''' is an [[atypical antidepressant]] that was developed in the 1970s and used primarily in [[France]] and other European countries. It is known for its unique pharmacological profile, which distinguishes it from other [[antidepressants]] such as [[selective serotonin reuptake inhibitors]] (SSRIs) and [[tricyclic antidepressants]] (TCAs). | |||
==Pharmacology== | ==Pharmacology== | ||
Medifoxamine acts as a [[ | Medifoxamine acts as a [[serotonin]] and [[dopamine]] reuptake inhibitor, which contributes to its antidepressant effects. Unlike many other antidepressants, it does not significantly affect the reuptake of [[norepinephrine]]. This selective action is thought to reduce the incidence of certain side effects commonly associated with other antidepressant classes. | ||
Additionally, medifoxamine has been shown to possess [[anxiolytic]] properties, making it potentially useful in the treatment of [[anxiety disorders]]. Its mechanism of action also includes modulation of [[GABAergic]] activity, which may contribute to its calming effects. | |||
== | ==Clinical Use== | ||
Medifoxamine was primarily prescribed for the treatment of [[major depressive disorder]] and [[anxiety disorders]]. It was favored for its relatively mild side effect profile compared to other antidepressants available at the time. Patients reported fewer issues with [[sedation]], [[weight gain]], and [[sexual dysfunction]], which are common side effects of many antidepressants. | |||
== | ==Side Effects== | ||
While medifoxamine is generally well-tolerated, some patients may experience side effects such as [[nausea]], [[dizziness]], and [[headache]]. Rarely, it may cause [[allergic reactions]] or [[hepatic]] issues, necessitating regular monitoring of liver function during treatment. | |||
== | ==Discontinuation== | ||
Medifoxamine was eventually withdrawn from the market due to concerns over [[hepatotoxicity]], which is the potential for causing liver damage. Despite its efficacy and favorable side effect profile, the risk of liver damage led to its discontinuation in the late 1990s. | |||
==Related pages== | |||
* [[Antidepressant]] | |||
* [[Serotonin]] | |||
* [[Dopamine]] | |||
* [[Anxiety disorder]] | |||
* [[Hepatotoxicity]] | |||
[[Category:Antidepressants]] | [[Category:Antidepressants]] | ||
[[Category: | [[Category:Withdrawn drugs]] | ||
[[Category:Serotonin reuptake inhibitors]] | |||
[[Category:Dopamine reuptake inhibitors]] | [[Category:Dopamine reuptake inhibitors]] | ||
Latest revision as of 11:16, 23 March 2025
An atypical antidepressant
| Medifoxamine | |
|---|---|
| [[File: | |
| INN | |
| Drug class | |
| Routes of administration | Oral |
| Pregnancy category | |
| Bioavailability | |
| Metabolism | Hepatic |
| Elimination half-life | |
| Excretion | Renal |
| Legal status | Rx-only |
| CAS Number | 3239-44-9 |
| PubChem | 4053 |
| DrugBank | DB08998 |
| ChemSpider | 3913 |
| KEGG | D07355 |
Medifoxamine is an atypical antidepressant that was developed in the 1970s and used primarily in France and other European countries. It is known for its unique pharmacological profile, which distinguishes it from other antidepressants such as selective serotonin reuptake inhibitors (SSRIs) and tricyclic antidepressants (TCAs).
Pharmacology[edit]
Medifoxamine acts as a serotonin and dopamine reuptake inhibitor, which contributes to its antidepressant effects. Unlike many other antidepressants, it does not significantly affect the reuptake of norepinephrine. This selective action is thought to reduce the incidence of certain side effects commonly associated with other antidepressant classes.
Additionally, medifoxamine has been shown to possess anxiolytic properties, making it potentially useful in the treatment of anxiety disorders. Its mechanism of action also includes modulation of GABAergic activity, which may contribute to its calming effects.
Clinical Use[edit]
Medifoxamine was primarily prescribed for the treatment of major depressive disorder and anxiety disorders. It was favored for its relatively mild side effect profile compared to other antidepressants available at the time. Patients reported fewer issues with sedation, weight gain, and sexual dysfunction, which are common side effects of many antidepressants.
Side Effects[edit]
While medifoxamine is generally well-tolerated, some patients may experience side effects such as nausea, dizziness, and headache. Rarely, it may cause allergic reactions or hepatic issues, necessitating regular monitoring of liver function during treatment.
Discontinuation[edit]
Medifoxamine was eventually withdrawn from the market due to concerns over hepatotoxicity, which is the potential for causing liver damage. Despite its efficacy and favorable side effect profile, the risk of liver damage led to its discontinuation in the late 1990s.
