Acetylmethadol: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
Line 1: Line 1:
{{Short description|Synthetic opioid analgesic}}
{{Short description|A synthetic opioid analgesic}}
{{Drugbox
{{Drugbox
| verifiedfields = changed
| verifiedfields = changed
| verifiedrevid = 477318680
| verifiedrevid = 477002123
| image = Acetylmethadol.svg
| image = Acetylmethadol.svg
| image_size = 200px
| image_size = 200px
| IUPAC_name = 6-(Dimethylamino)-4,4-diphenyl-3-hexanone acetate
| image_alt = Structural formula of acetylmethadol
| CAS_number = 509-74-0
| ATC_prefix = N07
| ATC_suffix = BC03
| PubChem = 5284590
| DrugBank = DB01450
| ChemSpiderID = 4447600
| UNII = 0F5U9N377L
| KEGG = D02763
| ChEMBL = 2104660
| C=23
| H=31
| N=1
| O=2
| smiles = CC(=O)OC(CC(C)N(C)C)C(=O)C1=CC=CC=C1C2=CC=CC=C2
}}
}}


'''Acetylmethadol''' is a synthetic opioid analgesic that is chemically related to [[methadone]]. It is used primarily in the treatment of opioid dependence. Acetylmethadol is a racemic mixture, meaning it contains equal parts of two enantiomers, which are mirror images of each other.
'''Acetylmethadol''' is a synthetic opioid analgesic that is chemically related to [[methadone]]. It is used primarily in the treatment of [[opioid dependence]] and is known for its long-acting properties. Acetylmethadol is a racemic mixture, meaning it contains two enantiomers, which are mirror images of each other.


==Pharmacology==
==Pharmacology==
Acetylmethadol acts as an agonist at the [[mu-opioid receptor]], which is responsible for its analgesic and euphoric effects. It is metabolized in the liver to form [[LAAM]] (levo-alpha-acetylmethadol), which is also an active opioid agonist. The drug has a long half-life, allowing for less frequent dosing compared to other opioids.
Acetylmethadol acts on the [[mu-opioid receptor]] in the [[central nervous system]], producing effects similar to those of other opioids, such as [[analgesia]], [[euphoria]], and [[respiratory depression]]. Its long duration of action makes it suitable for use in [[opioid substitution therapy]].


==Medical use==
==Synthesis and Structure==
Acetylmethadol is used in the management of opioid dependence. It is administered orally and is typically used in a controlled clinical setting. The long duration of action makes it suitable for maintenance therapy, reducing the need for frequent dosing and helping to stabilize patients.
The chemical structure of acetylmethadol is similar to that of methadone, with the addition of an acetyl group. This modification affects its pharmacokinetics, allowing for a longer duration of action. The structural formula of acetylmethadol is depicted in the image on the right.


==Side effects==
[[File:Acetylmethadol.svg|thumb|right|200px|Structural formula of acetylmethadol]]
Common side effects of acetylmethadol include:
* [[Nausea]]
* [[Vomiting]]
* [[Constipation]]
* [[Drowsiness]]
* [[Dizziness]]


Serious side effects can include respiratory depression, which is a risk with all opioid medications.
==Clinical Use==
Acetylmethadol is used in the management of opioid dependence, providing a longer-acting alternative to methadone. It is administered orally and is typically used in a controlled clinical setting. The drug helps to reduce withdrawal symptoms and cravings in individuals undergoing treatment for opioid addiction.


==Legal status==
==Side Effects==
Acetylmethadol is a controlled substance in many countries due to its potential for abuse and dependence. It is classified under various schedules depending on the jurisdiction.
Common side effects of acetylmethadol include [[nausea]], [[vomiting]], [[constipation]], and [[drowsiness]]. As with other opioids, there is a risk of [[addiction]] and [[overdose]], particularly if the drug is not used as prescribed.
 
==Regulation==
Due to its potential for abuse and addiction, acetylmethadol is classified as a controlled substance in many countries. Its use is typically restricted to specific medical settings and requires careful monitoring by healthcare professionals.


==Related pages==
==Related pages==
* [[Methadone]]
* [[Methadone]]
* [[Opioid dependence]]
* [[Opioid dependence]]
* [[LAAM]]
* [[Opioid receptor]]
* [[Mu-opioid receptor]]
 
==Gallery==
<gallery>
File:Acetylmethadol.svg|Chemical structure of Acetylmethadol
</gallery>


[[Category:Opioids]]
[[Category:Opioids]]
[[Category:Synthetic opioids]]
[[Category:Synthetic opioids]]
[[Category:Analgesics]]
[[Category:Analgesics]]

Latest revision as of 10:59, 15 February 2025

A synthetic opioid analgesic


Acetylmethadol
File:Acetylmethadol.svg
INN
Drug class
Routes of administration
Pregnancy category
Bioavailability
Metabolism
Elimination half-life
Excretion
Legal status
CAS Number
PubChem
DrugBank
ChemSpider
KEGG


Acetylmethadol is a synthetic opioid analgesic that is chemically related to methadone. It is used primarily in the treatment of opioid dependence and is known for its long-acting properties. Acetylmethadol is a racemic mixture, meaning it contains two enantiomers, which are mirror images of each other.

Pharmacology[edit]

Acetylmethadol acts on the mu-opioid receptor in the central nervous system, producing effects similar to those of other opioids, such as analgesia, euphoria, and respiratory depression. Its long duration of action makes it suitable for use in opioid substitution therapy.

Synthesis and Structure[edit]

The chemical structure of acetylmethadol is similar to that of methadone, with the addition of an acetyl group. This modification affects its pharmacokinetics, allowing for a longer duration of action. The structural formula of acetylmethadol is depicted in the image on the right.

File:Acetylmethadol.svg
Structural formula of acetylmethadol

Clinical Use[edit]

Acetylmethadol is used in the management of opioid dependence, providing a longer-acting alternative to methadone. It is administered orally and is typically used in a controlled clinical setting. The drug helps to reduce withdrawal symptoms and cravings in individuals undergoing treatment for opioid addiction.

Side Effects[edit]

Common side effects of acetylmethadol include nausea, vomiting, constipation, and drowsiness. As with other opioids, there is a risk of addiction and overdose, particularly if the drug is not used as prescribed.

Regulation[edit]

Due to its potential for abuse and addiction, acetylmethadol is classified as a controlled substance in many countries. Its use is typically restricted to specific medical settings and requires careful monitoring by healthcare professionals.

Related pages[edit]