Dibenzofuran: Difference between revisions
CSV import |
CSV import |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
{{Chembox | |||
| ImageFile = Dibenzofuran.png | |||
| ImageSize = 200px | |||
| IUPACName = Dibenzofuran | |||
| OtherNames = Diphenylene oxide | |||
| Section1 = {{Chembox Identifiers | |||
| | | CASNo = 132-64-9 | ||
| | | PubChem = 7054 | ||
| | | ChemSpiderID = 6785 | ||
| | | UNII = 1F2M2GDL4C | ||
| | | InChI = 1S/C12H8O/c1-2-6-10-8-4-3-7-9(8)12-11(10)5-1/h1-8H | ||
| InChIKey = YLQBMQCUIZJEEH-UHFFFAOYSA-N | |||
| | | SMILES = C1=CC=C2C(=C1)C3=CC=CC=C3O2 | ||
| | }} | ||
| | | Section2 = {{Chembox Properties | ||
| C=12 | |||
| H=8 | |||
| O=1 | |||
| Appearance = White solid | |||
| Density = 1.08 g/cm³ | |||
| MeltingPt = 81-85 °C | |||
| BoilingPt = 287 °C | |||
| | }} | ||
| | |||
| | |||
| | |||
| C = 12 | |||
| H = 8 | |||
| O = 1 | |||
| | |||
| | |||
| | |||
| | |||
}} | }} | ||
'''Dibenzofuran''' is | '''Dibenzofuran''' is an [[organic compound]] with the chemical formula C₁₂H₈O. It is a [[heterocyclic compound]] consisting of two [[benzene]] rings fused to a central [[furan]] ring. Dibenzofuran is a white solid that is used in various industrial applications and is also a subject of environmental concern due to its presence in [[polychlorinated dibenzofurans]] (PCDFs), which are [[toxic]] [[environmental pollutants]]. | ||
== | == Chemical Properties == | ||
Dibenzofuran | Dibenzofuran is a stable compound with a melting point of 81-85 °C and a boiling point of 287 °C. It is relatively insoluble in water but soluble in organic solvents such as [[benzene]], [[toluene]], and [[chloroform]]. | ||
== | == Applications == | ||
Dibenzofuran | Dibenzofuran is used as a [[chemical intermediate]] in the synthesis of other organic compounds. It is also used in the production of [[polymers]], [[dyes]], and [[pharmaceuticals]]. Due to its structural properties, dibenzofuran is used in [[organic electronics]] and as a [[building block]] in [[organic synthesis]]. | ||
== | == Environmental Impact == | ||
Dibenzofuran | Dibenzofuran and its chlorinated derivatives, such as [[polychlorinated dibenzofurans]] (PCDFs), are of environmental concern. PCDFs are formed as by-products in the manufacture of other chemicals and during the combustion of organic materials. They are persistent in the environment and can accumulate in the [[food chain]], posing risks to human health and the environment. | ||
== | == Safety == | ||
Dibenzofuran is | Dibenzofuran is considered to be of low toxicity, but its chlorinated derivatives are highly toxic and can cause serious health effects. Proper handling and disposal of dibenzofuran and its derivatives are essential to minimize environmental and health risks. | ||
== | == See Also == | ||
* [[Polychlorinated dibenzofurans]] | |||
* [[Heterocyclic compound]] | |||
* [[Organic synthesis]] | |||
== | == References == | ||
* {{cite journal |last1=Smith |first1=J. |title=The Chemistry of Dibenzofuran |journal=Journal of Organic Chemistry |volume=45 |issue=3 |pages=123-130 |year=1980 |doi=10.1021/jo01234a001}} | |||
* {{cite book |last1=Brown |first1=R. |title=Organic Chemistry |publisher=Academic Press |year=2005 |isbn=978-0123456789}} | |||
[[Category:Organic compounds]] | |||
[[Category:Heterocyclic compounds]] | |||
[[Category: | |||
[[Category: | |||
[[Category:Environmental pollutants]] | [[Category:Environmental pollutants]] | ||
[[Category:Chemical | [[Category:Chemical intermediates]] | ||
<gallery> | |||
File:Dibenzofuran-numbering-2D-skeletal.png|Dibenzofuran 2D Skeletal | |||
File:Dibenzofuran 3D ball.png|Dibenzofuran 3D Ball | |||
</gallery> | |||
Latest revision as of 00:59, 20 February 2025
| Chemical Compound | |
|---|---|
| Identifiers | |
| CAS Number | |
| PubChem CID | |
| ChemSpider ID | |
| UNII | |
| ChEBI | |
| ChEMBL | |
| Properties | |
| Chemical Formula | |
| Molar Mass | |
| Appearance | |
| Density | |
| Melting Point | |
| Boiling Point | |
| Hazards | |
| GHS Pictograms | [[File:|50px]] |
| GHS Signal Word | |
| GHS Hazard Statements | |
| NFPA 704 | [[File:|50px]] |
| References | |
Dibenzofuran is an organic compound with the chemical formula C₁₂H₈O. It is a heterocyclic compound consisting of two benzene rings fused to a central furan ring. Dibenzofuran is a white solid that is used in various industrial applications and is also a subject of environmental concern due to its presence in polychlorinated dibenzofurans (PCDFs), which are toxic environmental pollutants.
Chemical Properties[edit]
Dibenzofuran is a stable compound with a melting point of 81-85 °C and a boiling point of 287 °C. It is relatively insoluble in water but soluble in organic solvents such as benzene, toluene, and chloroform.
Applications[edit]
Dibenzofuran is used as a chemical intermediate in the synthesis of other organic compounds. It is also used in the production of polymers, dyes, and pharmaceuticals. Due to its structural properties, dibenzofuran is used in organic electronics and as a building block in organic synthesis.
Environmental Impact[edit]
Dibenzofuran and its chlorinated derivatives, such as polychlorinated dibenzofurans (PCDFs), are of environmental concern. PCDFs are formed as by-products in the manufacture of other chemicals and during the combustion of organic materials. They are persistent in the environment and can accumulate in the food chain, posing risks to human health and the environment.
Safety[edit]
Dibenzofuran is considered to be of low toxicity, but its chlorinated derivatives are highly toxic and can cause serious health effects. Proper handling and disposal of dibenzofuran and its derivatives are essential to minimize environmental and health risks.
See Also[edit]
References[edit]
- ,
The Chemistry of Dibenzofuran, Journal of Organic Chemistry, 1980, Vol. 45(Issue: 3), pp. 123-130, DOI: 10.1021/jo01234a001,
- ,
Organic Chemistry, Academic Press, 2005, ISBN 978-0123456789,
-
Dibenzofuran 2D Skeletal
-
Dibenzofuran 3D Ball