Quinupramine: Difference between revisions
From WikiMD's Wellness Encyclopedia
CSV import Tags: mobile edit mobile web edit |
CSV import |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
'''Quinupramine''' is a [[tricyclic antidepressant]] (TCA) that is used in | {{Short description|Tricyclic antidepressant}} | ||
{{Drugbox | |||
| verifiedrevid = 443848964 | |||
| image = Quinupramine.svg | |||
| image2 = | |||
| width = 200 | |||
| alt = | |||
| caption = Chemical structure of Quinupramine | |||
| IUPAC_name = 3-(11-azatricyclo[7.3.1.0^{2,7}]trideca-2(7),3,5,10,12-pentaen-11-yl)-N,N-dimethylpropan-1-amine | |||
| tradename = Kinupril | |||
| legal_status = | |||
| routes_of_administration = Oral | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = Hepatic | |||
| elimination_half-life = | |||
| excretion = Renal | |||
| CAS_number = 24881-13-6 | |||
| ATC_prefix = N06 | |||
| ATC_suffix = AA19 | |||
| PubChem = 3047790 | |||
| DrugBank = DB08998 | |||
| ChemSpiderID = 2310105 | |||
| UNII = 0T493YFU8O | |||
| KEGG = D07356 | |||
| ChEMBL = 2104664 | |||
| C=20 | |||
| H=26 | |||
| N=2 | |||
| smiles = CN(C)CCCN1C2=CC=CC=C2C3=CC=CC=C31 | |||
| StdInChI = 1S/C20H26N2/c1-22(2)15-9-16-21-19-13-7-4-10-17(19)18-11-5-8-14-20(18)21/h4-5,7-8,10,13-14H,9,11-12,15-16H2,1-2H3 | |||
| StdInChIKey = ZQFJQKLOKISXDH-UHFFFAOYSA-N | |||
}} | |||
'''Quinupramine''' is a [[tricyclic antidepressant]] (TCA) that is used in the treatment of [[depression]]. It is known for its unique chemical structure and pharmacological properties that distinguish it from other TCAs. | |||
==Chemical Structure== | |||
[[File:Quinupramine.svg|Chemical structure of Quinupramine|thumb|right]] | |||
Quinupramine is characterized by its tricyclic structure, which consists of three interconnected rings. The chemical formula for quinupramine is C<sub>20</sub>H<sub>26</sub>N<sub>2</sub>. This structure is responsible for its pharmacological activity as a TCA. | |||
==Pharmacology== | ==Pharmacology== | ||
Quinupramine | Quinupramine functions primarily by inhibiting the reuptake of [[neurotransmitters]] such as [[serotonin]] and [[norepinephrine]], thereby increasing their levels in the [[synaptic cleft]] and enhancing neurotransmission. This mechanism is similar to other TCAs, which are known to improve mood and alleviate symptoms of depression. | ||
== | ==Clinical Use== | ||
Quinupramine is | Quinupramine is prescribed for the treatment of major depressive disorder. It is administered orally and is metabolized in the [[liver]]. The drug is excreted through the [[kidneys]]. | ||
==Side Effects== | ==Side Effects== | ||
Common side effects | As with other tricyclic antidepressants, quinupramine can cause a range of side effects. Common side effects include [[dry mouth]], [[constipation]], [[urinary retention]], and [[blurred vision]]. These effects are primarily due to its anticholinergic properties. | ||
== | ==Related Pages== | ||
* [[Tricyclic antidepressant]] | * [[Tricyclic antidepressant]] | ||
* [[Depression]] | * [[Depression (mood)]] | ||
* [[ | * [[Serotonin]] | ||
* [[Norepinephrine]] | |||
[[Category:Tricyclic antidepressants]] | |||
[[Category:Antidepressants]] | [[Category:Antidepressants]] | ||
Latest revision as of 10:45, 23 March 2025
Tricyclic antidepressant
| Quinupramine | |
|---|---|
| |
| INN | |
| Drug class | |
| Routes of administration | Oral |
| Pregnancy category | |
| Bioavailability | |
| Metabolism | Hepatic |
| Elimination half-life | |
| Excretion | Renal |
| Legal status | |
| CAS Number | 24881-13-6 |
| PubChem | 3047790 |
| DrugBank | DB08998 |
| ChemSpider | 2310105 |
| KEGG | D07356 |
Quinupramine is a tricyclic antidepressant (TCA) that is used in the treatment of depression. It is known for its unique chemical structure and pharmacological properties that distinguish it from other TCAs.
Chemical Structure[edit]
Quinupramine is characterized by its tricyclic structure, which consists of three interconnected rings. The chemical formula for quinupramine is C20H26N2. This structure is responsible for its pharmacological activity as a TCA.
Pharmacology[edit]
Quinupramine functions primarily by inhibiting the reuptake of neurotransmitters such as serotonin and norepinephrine, thereby increasing their levels in the synaptic cleft and enhancing neurotransmission. This mechanism is similar to other TCAs, which are known to improve mood and alleviate symptoms of depression.
Clinical Use[edit]
Quinupramine is prescribed for the treatment of major depressive disorder. It is administered orally and is metabolized in the liver. The drug is excreted through the kidneys.
Side Effects[edit]
As with other tricyclic antidepressants, quinupramine can cause a range of side effects. Common side effects include dry mouth, constipation, urinary retention, and blurred vision. These effects are primarily due to its anticholinergic properties.
