Medifoxamine: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
CSV import
 
Line 1: Line 1:
'''Medifoxamine''' is an [[antidepressant]] and [[anxiolytic]] drug that was formerly used in [[France]] for the treatment of [[depression]] and [[anxiety disorders]], but has since been discontinued. Medifoxamine is a [[dopamine reuptake inhibitor]], and is unique among most antidepressants in that it does not inhibit the reuptake of [[serotonin]] or [[norepinephrine]]. It also has [[anticholinergic]] properties.
{{Short description|An atypical antidepressant}}
{{Drugbox
| verifiedrevid = 477318123
| image = [[File:Medifoxamine.svg|thumb|Chemical structure of Medifoxamine]]
| IUPAC_name = 2-(3,4-dimethoxyphenyl)-2-methylaminopropan-1-one
| tradename = Clédial, Gerdaxyl
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| protein_bound =
| metabolism = Hepatic
| elimination_half-life =
| excretion = Renal
| CAS_number = 3239-44-9
| ATC_prefix = N06
| ATC_suffix = AX09
| PubChem = 4053
| DrugBank = DB08998
| ChemSpiderID = 3913
| UNII = 0T493YFU8O
| KEGG = D07355
| ChEMBL = 2104660
| C=12
| H=17
| N=1
| O=3
| smiles = CC(C(=O)C1=CC(=C(C=C1)OC)OC)NC
| StdInChI = 1S/C12H17NO3/c1-8(13-2)12(14)9-5-6-10(15-3)11(7-9)16-4/h5-8,13H,1-4H3
| StdInChIKey = ZJQJHFOYQZKEMV-UHFFFAOYSA-N
}}
 
'''Medifoxamine''' is an [[atypical antidepressant]] that was developed in the 1970s and used primarily in [[France]] and other European countries. It is known for its unique pharmacological profile, which distinguishes it from other [[antidepressants]] such as [[selective serotonin reuptake inhibitors]] (SSRIs) and [[tricyclic antidepressants]] (TCAs).


==Pharmacology==
==Pharmacology==
Medifoxamine acts as a [[dopamine reuptake inhibitor]] and [[sigma receptor]] agonist. It does not inhibit the reuptake of [[serotonin]] or [[norepinephrine]]. Medifoxamine also has [[anticholinergic]] properties, which can lead to side effects such as dry mouth, constipation, and cognitive impairment in some patients.
Medifoxamine acts as a [[serotonin]] and [[dopamine]] reuptake inhibitor, which contributes to its antidepressant effects. Unlike many other antidepressants, it does not significantly affect the reuptake of [[norepinephrine]]. This selective action is thought to reduce the incidence of certain side effects commonly associated with other antidepressant classes.


==Medical uses==
Additionally, medifoxamine has been shown to possess [[anxiolytic]] properties, making it potentially useful in the treatment of [[anxiety disorders]]. Its mechanism of action also includes modulation of [[GABAergic]] activity, which may contribute to its calming effects.
Medifoxamine was primarily used for the treatment of [[depression]] and [[anxiety disorders]]. It was particularly effective in patients with depression who also suffered from anxiety, due to its dual action as an antidepressant and anxiolytic.


==Side effects==
==Clinical Use==
The most common side effects of medifoxamine include dry mouth, constipation, and cognitive impairment, which are likely due to its [[anticholinergic]] properties. Other side effects can include dizziness, nausea, and insomnia.
Medifoxamine was primarily prescribed for the treatment of [[major depressive disorder]] and [[anxiety disorders]]. It was favored for its relatively mild side effect profile compared to other antidepressants available at the time. Patients reported fewer issues with [[sedation]], [[weight gain]], and [[sexual dysfunction]], which are common side effects of many antidepressants.


==History==
==Side Effects==
Medifoxamine was developed in the 1970s by the French pharmaceutical company [[Institut de Recherches Internationales Servier|Servier]]. It was marketed in France under the brand name Clédial. However, it has since been discontinued and is no longer available.
While medifoxamine is generally well-tolerated, some patients may experience side effects such as [[nausea]], [[dizziness]], and [[headache]]. Rarely, it may cause [[allergic reactions]] or [[hepatic]] issues, necessitating regular monitoring of liver function during treatment.


==See also==
==Discontinuation==
* [[List of antidepressants]]
Medifoxamine was eventually withdrawn from the market due to concerns over [[hepatotoxicity]], which is the potential for causing liver damage. Despite its efficacy and favorable side effect profile, the risk of liver damage led to its discontinuation in the late 1990s.
* [[List of anxiolytics]]


{{stub}}
==Related pages==
* [[Antidepressant]]
* [[Serotonin]]
* [[Dopamine]]
* [[Anxiety disorder]]
* [[Hepatotoxicity]]


[[Category:Antidepressants]]
[[Category:Antidepressants]]
[[Category:Anxiolytics]]
[[Category:Withdrawn drugs]]
[[Category:Serotonin reuptake inhibitors]]
[[Category:Dopamine reuptake inhibitors]]
[[Category:Dopamine reuptake inhibitors]]
[[Category:Sigma agonists]]
[[Category:Discontinued drugs]]
[[Category:French drugs]]
<gallery>
File:Medifoxamine.svg|Medifoxamine
</gallery>
<gallery>
File:Medifoxamine.svg|Medifoxamine
</gallery>

Latest revision as of 11:16, 23 March 2025

An atypical antidepressant


Medifoxamine
[[File:
Chemical structure of Medifoxamine
|frameless|220px|alt=|]]
INN
Drug class
Routes of administration Oral
Pregnancy category
Bioavailability
Metabolism Hepatic
Elimination half-life
Excretion Renal
Legal status Rx-only
CAS Number 3239-44-9
PubChem 4053
DrugBank DB08998
ChemSpider 3913
KEGG D07355


Medifoxamine is an atypical antidepressant that was developed in the 1970s and used primarily in France and other European countries. It is known for its unique pharmacological profile, which distinguishes it from other antidepressants such as selective serotonin reuptake inhibitors (SSRIs) and tricyclic antidepressants (TCAs).

Pharmacology[edit]

Medifoxamine acts as a serotonin and dopamine reuptake inhibitor, which contributes to its antidepressant effects. Unlike many other antidepressants, it does not significantly affect the reuptake of norepinephrine. This selective action is thought to reduce the incidence of certain side effects commonly associated with other antidepressant classes.

Additionally, medifoxamine has been shown to possess anxiolytic properties, making it potentially useful in the treatment of anxiety disorders. Its mechanism of action also includes modulation of GABAergic activity, which may contribute to its calming effects.

Clinical Use[edit]

Medifoxamine was primarily prescribed for the treatment of major depressive disorder and anxiety disorders. It was favored for its relatively mild side effect profile compared to other antidepressants available at the time. Patients reported fewer issues with sedation, weight gain, and sexual dysfunction, which are common side effects of many antidepressants.

Side Effects[edit]

While medifoxamine is generally well-tolerated, some patients may experience side effects such as nausea, dizziness, and headache. Rarely, it may cause allergic reactions or hepatic issues, necessitating regular monitoring of liver function during treatment.

Discontinuation[edit]

Medifoxamine was eventually withdrawn from the market due to concerns over hepatotoxicity, which is the potential for causing liver damage. Despite its efficacy and favorable side effect profile, the risk of liver damage led to its discontinuation in the late 1990s.

Related pages[edit]