McNA343

A detailed overview of the chemical compound McNA343

{{Infobox drug | name = McNA343 | image = McNA343_structure.png | width = 200 | alt = | caption = Chemical structure of McNA343 | IUPAC_name = 4-[[N-(3-chlorophenyl)carbamoyl]oxy]-2-butynyltrimethylammonium chloride | CAS_number = 132-03-2 | PubChem = 3033960 | ChemSpiderID = 2298530 | UNII = 7X7F4T5RNN | KEGG = D05001 | ChEMBL = 2104660 | C=14 | H=20 | Cl=2 | N=2 | O=2 | SMILES = C[N+](C)(C)CC#CCOC(=O)NC1=CC(=CC=C1)Cl }}

McNA343 is a selective muscarinic acetylcholine receptor agonist, primarily targeting the M1 subtype of muscarinic receptors. It is used in scientific research to study the role of M1 receptors in various physiological and pathological processes.

Chemical Properties

McNA343 is a quaternary ammonium compound with the IUPAC name 4-[[N-(3-chlorophenyl)carbamoyl]oxy]-2-butynyltrimethylammonium chloride. It is characterized by its ability to selectively bind to and activate M1 muscarinic receptors, which are a subtype of the G protein-coupled receptor family.

Pharmacology

McNA343 acts as an agonist at the M1 muscarinic acetylcholine receptor, which is predominantly expressed in the central nervous system, including the cerebral cortex and hippocampus. Activation of M1 receptors by McNA343 can lead to various cellular responses, including the modulation of neurotransmitter release, enhancement of cognitive function, and potential neuroprotective effects.

Mechanism of Action

The mechanism of action of McNA343 involves the binding to the orthosteric site of the M1 receptor, leading to a conformational change that activates the receptor. This activation triggers downstream signaling pathways, such as the phospholipase C pathway, resulting in the release of intracellular calcium and activation of protein kinase C.

Research Applications

McNA343 is widely used in research to explore the physiological roles of M1 receptors. Studies have investigated its effects on learning and memory, as well as its potential therapeutic applications in Alzheimer's disease and other neurodegenerative disorders. Additionally, McNA343 is used to study the role of M1 receptors in schizophrenia and other psychiatric conditions.

Safety and Toxicology

As a research chemical, McNA343 is not approved for human use. Its safety profile is primarily established through in vitro and animal studies. Researchers handling McNA343 should follow appropriate safety protocols to minimize exposure and potential risks.

Also see

• Muscarinic acetylcholine receptor
• M1 receptor
• G protein-coupled receptor
• Neurotransmitter
• Alzheimer's disease

Template:Muscarinic receptor modulators