Amenamevir

From WikiMD's WELLNESSPEDIA

Amenamevir

{{Drugbox | Verifiedfields = changed | verifiedrevid = 477002015 | IUPAC_name = (2S)-2-[[4-(2-amino-1,3-thiazol-4-yl)phenyl]methyl]-1,4-dioxaspiro[4.5]decane-2,3-dione | image = Amenamevir.svg | width = 200 | tradename = | Drugs.com = | pregnancy_AU = | pregnancy_US = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number = 841301-32-4 | ATC_prefix = | ATC_suffix = | PubChem = 11525743 | DrugBank = | ChemSpiderID = 9702971 | UNII = | KEGG = | ChEBI = | ChEMBL = | synonyms = ASP2151 | C=16 | H=16 | N=2 | O=4 | S=1 | smiles = O=C1OC2(CCCCC2)C1(Cc3ccc(cc3)c4nc(sc4)N)O | StdInChI = 1S/C16H16N2O4S/c17-15-18-12(11-23-15)10-8-6-9(7-10)5-16(20)13(19)22-14(16)21-4-2-1-3-11-21/h6-8,11H,1-5H2,(H2,17,18) | StdInChIKey = QXKJXQFZKQJZQF-UHFFFAOYSA-N }}

Amenamevir is an antiviral drug that is used for the treatment of herpes zoster (shingles). It is a member of the oxadiazole class of compounds and works by inhibiting the helicase-primase complex of the herpes simplex virus (HSV) and varicella-zoster virus (VZV).

Mechanism of Action[edit]

Amenamevir targets the helicase-primase complex, which is essential for the replication of HSV and VZV. By inhibiting this complex, amenamevir prevents the viral DNA from unwinding and replicating, thereby halting the spread of the virus within the host.

Clinical Use[edit]

Amenamevir is primarily used to treat herpes zoster, a condition caused by the reactivation of the varicella-zoster virus. It is particularly useful in patients who are resistant to other antiviral medications such as acyclovir and valacyclovir.

Side Effects[edit]

Common side effects of amenamevir include headache, nausea, and diarrhea. More severe side effects are rare but can include allergic reactions and liver enzyme abnormalities.

Related Compounds[edit]

Amenamevir is related to other antiviral drugs such as acyclovir, valacyclovir, and famciclovir. These drugs also target the replication mechanisms of herpes viruses but through different mechanisms.

See Also[edit]

References[edit]



This antiviral drug related article is a stub. You can help WikiMD by expanding it.