3F-NEB: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
Line 1: Line 1:
{{Short description|Synthetic cannabinoid}}
{{Short description|A synthetic stimulant drug}}
{{Drugbox
{{Drugbox
| verifiedfields = changed
| verifiedfields = changed
| verifiedrevid = 477318752
| verifiedrevid = 477002547
| IUPAC_name = (1-(5-fluoropentyl)-1H-indazole-3-carbonyl)-L-valine methyl ester
| IUPAC_name = 1-(3-fluorophenyl)-2-(ethylamino)butan-1-one
| image = 3F-NEB_structure.png
| image = 3F-NEB_structure.png
| width = 200
| image_size = 200px
| legal_status = Legal status varies by jurisdiction
| routes_of_administration = Inhalation, oral
| CAS_number = 1800101-60-3
| PubChem = 11902592
| ChemSpiderID = 10028509
| UNII = 7X9V3Y0H3F
| C=20 | H=27 | F=1 | N=3 | O=3
| smiles = COC(=O)[C@@H](NC(=O)c1nn(CCCCC(F)F)c2ccccc12)C(C)C
}}
}}


'''3F-NEB''' is a synthetic [[cannabinoid]] that has been used in scientific research and is often found in [[designer drug]]s. It is a potent agonist of the [[cannabinoid receptor]]s, which are part of the [[endocannabinoid system]] in the human body.
'''3F-NEB''' is a synthetic stimulant drug of the [[cathinone]] class. It is chemically related to other synthetic cathinones such as [[3-FMC]] and [[4-FMC]].


==Chemical Structure and Properties==
==Chemical structure==
3F-NEB is chemically classified as an indazole-based synthetic cannabinoid. Its full chemical name is (1-(5-fluoropentyl)-1H-indazole-3-carbonyl)-L-valine methyl ester. The compound features a fluorinated pentyl chain, which is a common modification in synthetic cannabinoids to enhance their potency and metabolic stability.
3F-NEB is a fluorinated derivative of [[NEB (drug)|NEB]], with the chemical formula C<sub>12</sub>H<sub>16</sub>FNO. It features a fluorine atom attached to the phenyl ring, which is a common modification in synthetic cathinones to alter their pharmacological properties.
 
The molecular formula of 3F-NEB is C<sub>20</sub>H<sub>27</sub>FN<sub>3</sub>O<sub>3</sub>, and it has a molecular weight of approximately 377.45 g/mol. The presence of the fluorine atom in the pentyl chain is believed to contribute to its high affinity for cannabinoid receptors.


==Pharmacology==
==Pharmacology==
3F-NEB acts as a full agonist at the [[CB1 receptor|CB<sub>1</sub>]] and [[CB2 receptor|CB<sub>2</sub>]] receptors, which are part of the [[endocannabinoid system]]. This system plays a crucial role in regulating various physiological processes, including mood, appetite, and pain sensation.
The pharmacological effects of 3F-NEB are not well-documented, but it is presumed to act as a [[central nervous system]] stimulant. Like other cathinones, it likely increases the levels of [[neurotransmitter]]s such as [[dopamine]], [[norepinephrine]], and [[serotonin]] in the brain, leading to increased alertness, euphoria, and potential for abuse.
 
The activation of these receptors by 3F-NEB can lead to effects similar to those of [[tetrahydrocannabinol]] (THC), the primary psychoactive component of [[cannabis]]. However, synthetic cannabinoids like 3F-NEB can be significantly more potent than THC, leading to increased risks of adverse effects.
 
==Legal Status==
The legal status of 3F-NEB varies by jurisdiction. In many countries, synthetic cannabinoids are controlled substances due to their potential for abuse and lack of medical use. It is important for researchers and users to be aware of the legal implications of possessing or distributing 3F-NEB in their respective regions.


==Health Risks and Safety==
==Legal status==
The use of synthetic cannabinoids, including 3F-NEB, has been associated with a range of adverse health effects. These can include [[tachycardia]], [[hypertension]], [[nausea]], [[vomiting]], [[anxiety]], [[hallucinations]], and [[seizures]]. In severe cases, use can lead to [[acute kidney injury]] and [[cardiovascular complications]].
The legal status of 3F-NEB varies by country. In many jurisdictions, it is classified as a controlled substance due to its structural similarity to other banned synthetic cathinones. Users should be aware of the legal implications of possessing or distributing this compound.


Due to the variability in potency and the presence of unknown impurities in street formulations, the use of synthetic cannabinoids poses significant health risks. Users should exercise caution and seek medical attention if adverse effects occur.
==Potential risks and side effects==
As with other synthetic cathinones, the use of 3F-NEB may pose significant health risks. Potential side effects include increased heart rate, hypertension, hyperthermia, and [[psychosis]]. Long-term use may lead to addiction and other serious health issues.


==Related Pages==
==Related pages==
* [[Synthetic cannabinoids]]
* [[Cathinone]]
* [[Cannabinoid receptor]]
* [[Synthetic cathinones]]
* [[Designer drug]]
* [[3-FMC]]
* [[Endocannabinoid system]]
* [[4-FMC]]


==Gallery==
==Gallery==
<gallery>
<gallery>
File:3F-NEB_structure.png|Chemical structure of 3F-NEB
3F-NEB_structure.png|Chemical structure of 3F-NEB
</gallery>
</gallery>


[[Category:Synthetic cannabinoids]]
[[Category:Synthetic cathinones]]
[[Category:Designer drugs]]
[[Category:Stimulants]]

Revision as of 20:03, 11 February 2025

A synthetic stimulant drug


3F-NEB
File:3F-NEB structure.png
INN
Drug class
Routes of administration
Pregnancy category
Bioavailability
Metabolism
Elimination half-life
Excretion
Legal status
CAS Number
PubChem
DrugBank
ChemSpider
KEGG


3F-NEB is a synthetic stimulant drug of the cathinone class. It is chemically related to other synthetic cathinones such as 3-FMC and 4-FMC.

Chemical structure

3F-NEB is a fluorinated derivative of NEB, with the chemical formula C12H16FNO. It features a fluorine atom attached to the phenyl ring, which is a common modification in synthetic cathinones to alter their pharmacological properties.

Pharmacology

The pharmacological effects of 3F-NEB are not well-documented, but it is presumed to act as a central nervous system stimulant. Like other cathinones, it likely increases the levels of neurotransmitters such as dopamine, norepinephrine, and serotonin in the brain, leading to increased alertness, euphoria, and potential for abuse.

Legal status

The legal status of 3F-NEB varies by country. In many jurisdictions, it is classified as a controlled substance due to its structural similarity to other banned synthetic cathinones. Users should be aware of the legal implications of possessing or distributing this compound.

Potential risks and side effects

As with other synthetic cathinones, the use of 3F-NEB may pose significant health risks. Potential side effects include increased heart rate, hypertension, hyperthermia, and psychosis. Long-term use may lead to addiction and other serious health issues.

Related pages

Gallery