Cyclarbamate: Difference between revisions
CSV import |
CSV import |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|A muscle relaxant drug}} | |||
{{Drugbox | |||
| verifiedfields = changed | |||
| verifiedrevid = 477318282 | |||
| IUPAC_name = 2-(2-cyclohexylphenoxy)ethyl carbamate | |||
| image = Cyclarbamate.svg | |||
| image2 = | |||
| width = 200 | |||
| alt = | |||
| caption = Chemical structure of Cyclarbamate | |||
| tradename = | |||
| Drugs.com = | |||
| pregnancy_AU = | |||
| pregnancy_US = | |||
| legal_AU = | |||
| legal_CA = | |||
| legal_UK = | |||
| legal_US = | |||
| legal_status = | |||
| routes_of_administration = | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
| CAS_number = 66-94-4 | |||
| ATC_prefix = | |||
| ATC_suffix = | |||
| PubChem = 68648 | |||
| DrugBank = | |||
| ChemSpiderID = 61889 | |||
| UNII = 0F5N573A2Y | |||
| KEGG = | |||
| ChEBI = | |||
| ChEMBL = | |||
| C=15 | H=21 | N=1 | O=3 | |||
| smiles = O=C(OCCOc1ccccc1C2CCCCC2)N | |||
| InChI = 1S/C15H21NO3/c16-15(17)18-10-9-19-14-8-5-4-7-13(14)12-6-2-1-3-11-12/h4-5,7-8,12H,1-3,6,9-11H2,(H2,16,17) | |||
| InChIKey = ZQKZGWXMSVZQNC-UHFFFAOYSA-N | |||
}} | |||
'''Cyclarbamate''' is a [[carbamate]] derivative that has been used as a [[muscle relaxant]]. It is known for its ability to alleviate muscle spasms and discomfort associated with various musculoskeletal conditions. | |||
Cyclarbamate | ==Chemical Structure and Properties== | ||
[[File:Cyclarbamate.svg|Chemical structure of Cyclarbamate|thumb|right]] | |||
Cyclarbamate is chemically classified as a carbamate ester. Its IUPAC name is 2-(2-cyclohexylphenoxy)ethyl carbamate. The molecular formula is C<sub>15</sub>H<sub>21</sub>NO<sub>3</sub>, and it has a molecular weight of 263.33 g/mol. The structure consists of a phenoxy group linked to a cyclohexyl ring, which is further connected to an ethyl carbamate moiety. | |||
== | ==Pharmacology== | ||
Cyclarbamate functions primarily as a central muscle relaxant. It acts on the central nervous system to reduce muscle tone and alleviate spasms. The exact mechanism of action is not fully understood, but it is believed to involve modulation of neurotransmitter activity in the central nervous system. | |||
==Uses== | |||
Cyclarbamate has been used in the treatment of muscle spasms and related conditions. It is particularly useful in cases where muscle relaxation is required to relieve pain and improve mobility. However, its use has declined with the development of newer muscle relaxants with improved safety profiles. | |||
== | ==Side Effects== | ||
As with many muscle relaxants, cyclarbamate can cause side effects such as drowsiness, dizziness, and fatigue. These effects are due to its action on the central nervous system. Patients are advised to avoid activities that require full alertness, such as driving, while taking this medication. | |||
==Regulatory Status== | |||
Cyclarbamate is not widely used today and may not be available in all countries. Its use has been largely replaced by other muscle relaxants that offer better efficacy and safety. | |||
== | |||
==Related Pages== | |||
* [[Carbamate]] | * [[Carbamate]] | ||
* [[Muscle relaxant]] | * [[Muscle relaxant]] | ||
* [[ | * [[Central nervous system]] | ||
[[Category:Muscle relaxants]] | |||
[[Category:Carbamates]] | |||
Latest revision as of 11:31, 23 March 2025
A muscle relaxant drug
| Cyclarbamate | |
|---|---|
| |
| INN | |
| Drug class | |
| Routes of administration | |
| Pregnancy category | |
| Bioavailability | |
| Metabolism | |
| Elimination half-life | |
| Excretion | |
| Legal status | |
| CAS Number | 66-94-4 |
| PubChem | 68648 |
| DrugBank | |
| ChemSpider | 61889 |
| KEGG | |
Cyclarbamate is a carbamate derivative that has been used as a muscle relaxant. It is known for its ability to alleviate muscle spasms and discomfort associated with various musculoskeletal conditions.
Chemical Structure and Properties[edit]
Cyclarbamate is chemically classified as a carbamate ester. Its IUPAC name is 2-(2-cyclohexylphenoxy)ethyl carbamate. The molecular formula is C15H21NO3, and it has a molecular weight of 263.33 g/mol. The structure consists of a phenoxy group linked to a cyclohexyl ring, which is further connected to an ethyl carbamate moiety.
Pharmacology[edit]
Cyclarbamate functions primarily as a central muscle relaxant. It acts on the central nervous system to reduce muscle tone and alleviate spasms. The exact mechanism of action is not fully understood, but it is believed to involve modulation of neurotransmitter activity in the central nervous system.
Uses[edit]
Cyclarbamate has been used in the treatment of muscle spasms and related conditions. It is particularly useful in cases where muscle relaxation is required to relieve pain and improve mobility. However, its use has declined with the development of newer muscle relaxants with improved safety profiles.
Side Effects[edit]
As with many muscle relaxants, cyclarbamate can cause side effects such as drowsiness, dizziness, and fatigue. These effects are due to its action on the central nervous system. Patients are advised to avoid activities that require full alertness, such as driving, while taking this medication.
Regulatory Status[edit]
Cyclarbamate is not widely used today and may not be available in all countries. Its use has been largely replaced by other muscle relaxants that offer better efficacy and safety.
