Phytanic acid: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
Line 1: Line 1:
{{Short description|A branched-chain fatty acid derived from phytol}}
{{DISPLAYTITLE:Phytanic acid}}
{{Infobox chemical
| name = Phytanic acid
| image = Phytanic acid.svg
| image_size = 200px
| image_alt =
| pin =
| othernames = 3,7,11,15-Tetramethylhexadecanoic acid
| section1 =
| casno = 14721-64-7
| pubchem = 5280447
| chemspiderid = 4444120
| chebi = 28802
| smiles = CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)O
| inchi = 1S/C20H40O2/c1-15(2)9-5-10-16(3)11-6-12-17(4)13-7-14-18(5,6)19(21)22/h15-17H,5-14H2,1-4H3,(H,21,22)
| inchi_key = YQWQXKXJBJGVML-UHFFFAOYSA-N
}}


'''Phytanic acid''' is a [[branched-chain fatty acid]] that is derived from [[phytol]], a component of [[chlorophyll]]. It is a saturated fatty acid with the chemical formula C<sub>20</sub>H<sub>40</sub>O<sub>2</sub>. Phytanic acid is notable for its role in human metabolism and its association with certain metabolic disorders.
== Overview ==
[[File:Phytanic_acid.png|thumb|right|Structure of phytanic acid]]
'''Phytanic acid''' is a branched-chain [[fatty acid]] that is derived from the [[phytol]] side chain of [[chlorophyll]]. It is a saturated 20-carbon fatty acid with three methyl branches, making it a complex lipid molecule. Phytanic acid is not synthesized by the human body and must be obtained through dietary sources, primarily from the consumption of ruminant animal fats and dairy products.


==Biochemistry==
== Biochemistry ==
Phytanic acid is not synthesized by the human body but is obtained through the diet, primarily from the consumption of ruminant animal fats, dairy products, and certain fish. It is absorbed in the intestine and transported in the blood as part of [[chylomicrons]].
Phytanic acid is metabolized in the body through a process known as [[alpha-oxidation]], which occurs in the [[peroxisome]]. This process is necessary because the branched structure of phytanic acid prevents it from undergoing the more common [[beta-oxidation]] pathway. The initial step in alpha-oxidation involves the conversion of phytanic acid to pristanic acid, which can then enter the beta-oxidation pathway to be further broken down into acetyl-CoA units.


In the human body, phytanic acid undergoes alpha-oxidation in the [[peroxisomes]], a process that is necessary because its branched structure prevents it from undergoing beta-oxidation directly. The enzyme phytanoyl-CoA hydroxylase catalyzes the first step of alpha-oxidation, converting phytanic acid to pristanic acid, which can then enter the beta-oxidation pathway.
== Clinical significance ==
[[File:Phytanic_acid.png|thumb|left|Phytanic acid is involved in Refsum disease]]
The accumulation of phytanic acid in the body is associated with a rare genetic disorder known as [[Refsum disease]]. This condition is caused by a deficiency in the enzyme phytanoyl-CoA hydroxylase, which is responsible for the alpha-oxidation of phytanic acid. Symptoms of Refsum disease include peripheral neuropathy, retinitis pigmentosa, cerebellar ataxia, and hearing loss. Management of the disease involves dietary restriction of phytanic acid by avoiding foods rich in this fatty acid.


==Clinical significance==
== Dietary sources ==
Phytanic acid accumulation in the body is associated with [[Refsum disease]], a rare genetic disorder caused by mutations in the PHYH gene, which encodes the enzyme phytanoyl-CoA hydroxylase. This leads to impaired alpha-oxidation of phytanic acid, resulting in its accumulation in tissues and plasma.
Phytanic acid is primarily found in the fat of ruminant animals such as cows and sheep, as well as in dairy products. This is because ruminants have a unique digestive system that allows them to convert chlorophyll from plant material into phytanic acid. As a result, foods such as beef, lamb, and dairy products like milk, cheese, and butter are significant sources of phytanic acid in the human diet.


Symptoms of Refsum disease include peripheral neuropathy, retinitis pigmentosa, anosmia, and cerebellar ataxia. Management of the disease involves dietary restriction of phytanic acid by avoiding foods rich in this fatty acid.
== Related pages ==
 
==Metabolic Pathway==
The metabolic pathway of phytanic acid involves several steps:
 
# '''Dietary intake''': Phytanic acid is ingested through foods such as dairy products, beef, lamb, and certain fish.
# '''Absorption and transport''': It is absorbed in the intestine and transported in the bloodstream as part of chylomicrons.
# '''Alpha-oxidation''': In the peroxisomes, phytanic acid undergoes alpha-oxidation, starting with the action of phytanoyl-CoA hydroxylase, converting it to pristanic acid.
# '''Beta-oxidation''': Pristanic acid is further broken down via beta-oxidation in the mitochondria to produce energy.
 
==Research and Future Directions==
Research into phytanic acid continues to explore its role in human health and disease. Studies are investigating its potential involvement in other metabolic disorders and its broader impact on metabolic health.
 
==Also see==
* [[Refsum disease]]
* [[Fatty acid metabolism]]
* [[Fatty acid metabolism]]
* [[Peroxisome]]
* [[Peroxisome]]
* [[Refsum disease]]
* [[Chlorophyll]]
* [[Chlorophyll]]
{{Fatty acids}}
{{Metabolism}}


[[Category:Fatty acids]]
[[Category:Fatty acids]]
[[Category:Biochemistry]]
[[Category:Metabolic disorders]]
[[Category:Metabolic disorders]]
[[Category:Biochemistry]]

Latest revision as of 10:57, 15 February 2025


Overview[edit]

Structure of phytanic acid

Phytanic acid is a branched-chain fatty acid that is derived from the phytol side chain of chlorophyll. It is a saturated 20-carbon fatty acid with three methyl branches, making it a complex lipid molecule. Phytanic acid is not synthesized by the human body and must be obtained through dietary sources, primarily from the consumption of ruminant animal fats and dairy products.

Biochemistry[edit]

Phytanic acid is metabolized in the body through a process known as alpha-oxidation, which occurs in the peroxisome. This process is necessary because the branched structure of phytanic acid prevents it from undergoing the more common beta-oxidation pathway. The initial step in alpha-oxidation involves the conversion of phytanic acid to pristanic acid, which can then enter the beta-oxidation pathway to be further broken down into acetyl-CoA units.

Clinical significance[edit]

Phytanic acid is involved in Refsum disease

The accumulation of phytanic acid in the body is associated with a rare genetic disorder known as Refsum disease. This condition is caused by a deficiency in the enzyme phytanoyl-CoA hydroxylase, which is responsible for the alpha-oxidation of phytanic acid. Symptoms of Refsum disease include peripheral neuropathy, retinitis pigmentosa, cerebellar ataxia, and hearing loss. Management of the disease involves dietary restriction of phytanic acid by avoiding foods rich in this fatty acid.

Dietary sources[edit]

Phytanic acid is primarily found in the fat of ruminant animals such as cows and sheep, as well as in dairy products. This is because ruminants have a unique digestive system that allows them to convert chlorophyll from plant material into phytanic acid. As a result, foods such as beef, lamb, and dairy products like milk, cheese, and butter are significant sources of phytanic acid in the human diet.

Related pages[edit]