A-349821: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
Line 1: Line 1:
{{Short description|A selective cannabinoid receptor antagonist}}
== A-349,821 ==
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477002123
| IUPAC_name = 1-(2,4-Dichlorophenyl)-5-(4-morpholinyl)-4-methyl-1H-pyrazole-3-carboxamide
| image = A-349,821.svg
| width = 200
| CAS_number = 221636-80-6
| PubChem = 9829140
| ChemSpiderID = 8004827
| UNII = 0F1Q5O5Q3X
| C=15
| H=17
| Cl=2
| N=4
| O=2
| smiles = CC1=C(C(=NN1C2=CC=C(C=C2)Cl)C(=O)N)N3CCOCC3
}}


'''A-349821''' is a chemical compound that acts as a selective antagonist for the [[cannabinoid receptor]] [[CB1 receptor|CB1]]. It is used primarily in scientific research to study the role of the CB1 receptor in various physiological processes.
[[File:A-349,821.svg|thumb|right|Chemical structure of A-349,821]]


==Mechanism of Action==
'''A-349,821''' is a chemical compound that has been studied for its potential effects on the [[central nervous system]]. It is classified as a [[pharmacological agent]] and has been the subject of research in the field of [[neuropharmacology]].
A-349821 functions by binding to the [[CB1 receptor]], which is a type of [[G protein-coupled receptor]] found predominantly in the [[central nervous system]]. By blocking the action of endogenous [[cannabinoids]] such as [[anandamide]] and [[2-arachidonoylglycerol]], A-349821 inhibits the downstream signaling pathways that are typically activated by these ligands.


==Pharmacological Effects==
== Chemical Properties ==
The blockade of CB1 receptors by A-349821 has been shown to affect several physiological and behavioral processes. These include:


* Modulation of [[appetite]] and [[food intake]]
A-349,821 is a synthetic compound with a specific [[chemical structure]] that allows it to interact with certain [[receptors]] in the brain. The structure of A-349,821 is depicted in the image to the right. This compound is known for its high affinity for certain [[neurotransmitter]] receptors, which makes it a candidate for further research in [[psychopharmacology]].
* Alteration of [[pain perception]]
* Influence on [[memory]] and [[cognition]]
* Impact on [[mood]] and [[anxiety]]


==Research Applications==
== Mechanism of Action ==
A-349821 is primarily used in [[preclinical research]] to explore the role of the CB1 receptor in various [[disease models]]. It has been instrumental in advancing our understanding of the [[endocannabinoid system]] and its potential as a target for therapeutic intervention in conditions such as [[obesity]], [[chronic pain]], and [[neurodegenerative diseases]].


==Chemical Properties==
A-349,821 acts primarily on the [[glutamate]] receptor system, which is one of the major excitatory neurotransmitter systems in the brain. By modulating the activity of these receptors, A-349,821 can influence [[synaptic transmission]] and [[neuroplasticity]]. This makes it a compound of interest for studying conditions such as [[schizophrenia]], [[depression]], and [[anxiety disorders]].
A-349821 is characterized by its chemical structure, which includes a dichlorophenyl group, a morpholine ring, and a pyrazole carboxamide moiety. These structural features contribute to its high affinity and selectivity for the CB1 receptor.


==Safety and Toxicology==
== Potential Applications ==
As with many research chemicals, the safety profile of A-349821 is not fully established. It is used under controlled conditions in laboratory settings, and its effects in humans are not well-documented.


==Related pages==
Research into A-349,821 has suggested potential applications in the treatment of various [[neurological disorders]]. Its ability to modulate neurotransmitter systems could make it useful in developing new therapies for [[mental health]] conditions. However, further studies are needed to fully understand its efficacy and safety profile.
* [[Cannabinoid receptor]]
* [[CB1 receptor]]
* [[Endocannabinoid system]]
* [[Cannabinoid receptor antagonist]]


==Gallery==
== Related Pages ==
<gallery>
File:A-349,821.svg|Chemical structure of A-349821
</gallery>


[[Category:Cannabinoid receptor antagonists]]
* [[Neuropharmacology]]
[[Category:Pyrazoles]]
* [[Glutamate receptor]]
[[Category:Chloroarenes]]
* [[Psychopharmacology]]
* [[Central nervous system]]
 
[[Category:Pharmacology]]
[[Category:Neuropharmacology]]

Latest revision as of 03:54, 13 February 2025

A-349,821[edit]

File:A-349,821.svg
Chemical structure of A-349,821

A-349,821 is a chemical compound that has been studied for its potential effects on the central nervous system. It is classified as a pharmacological agent and has been the subject of research in the field of neuropharmacology.

Chemical Properties[edit]

A-349,821 is a synthetic compound with a specific chemical structure that allows it to interact with certain receptors in the brain. The structure of A-349,821 is depicted in the image to the right. This compound is known for its high affinity for certain neurotransmitter receptors, which makes it a candidate for further research in psychopharmacology.

Mechanism of Action[edit]

A-349,821 acts primarily on the glutamate receptor system, which is one of the major excitatory neurotransmitter systems in the brain. By modulating the activity of these receptors, A-349,821 can influence synaptic transmission and neuroplasticity. This makes it a compound of interest for studying conditions such as schizophrenia, depression, and anxiety disorders.

Potential Applications[edit]

Research into A-349,821 has suggested potential applications in the treatment of various neurological disorders. Its ability to modulate neurotransmitter systems could make it useful in developing new therapies for mental health conditions. However, further studies are needed to fully understand its efficacy and safety profile.

Related Pages[edit]

Retrieved from "https://wikimd.com/index.php?title=A-349821&oldid=6291831"