2,5-Dimethoxy-4-chloroamphetamine: Difference between revisions

From WikiMD's Medical Encyclopedia

CSV import
Tags: mobile edit mobile web edit
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[File:DOC2DACS.svg|thumb|DOC2DACS.svg]] {{Short description|Chemical compound}}
[[File:DOC2DACS.svg|thumb|DOC2DACS.svg]] {{Short description|Chemical compound}}
{{Infobox drug
| image = 2,5-Dimethoxy-4-chloroamphetamine_structure.png
| width = 200
| image2 =
| width2 =
| alt2 =
| caption =
| pronun =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_US =
| DailyMedID =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| routes_of_administration =
| ATC_prefix =
| ATC_suffix =
| legal_AU =
| legal_BR =
| legal_CA =
| legal_DE =
| legal_NZ =
| legal_UK =
| legal_US =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 10124-87-7
| PubChem = 5362436
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 4515062
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| PDB_ligand =
| synonyms = DOC, 4-Chloro-2,5-dimethoxyamphetamine
| IUPAC_name = 1-(4-chloro-2,5-dimethoxyphenyl)propan-2-amine
| chemical_formula = C11H16ClNO2
| SMILES = CC(CC1=CC(=C(C=C1OC)Cl)OC)N
| StdInChI = 1S/C11H16ClNO2/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2/h5-7H,4,13H2,1-3H3
| StdInChIKey =
}}
'''2,5-Dimethoxy-4-chloroamphetamine''' ('''DOC''') is a [[psychedelic]] drug and a substituted [[amphetamine]] of the [[phenethylamine]] class. It is known for its potent [[hallucinogenic]] effects and long duration of action.
'''2,5-Dimethoxy-4-chloroamphetamine''' ('''DOC''') is a [[psychedelic]] drug and a substituted [[amphetamine]] of the [[phenethylamine]] class. It is known for its potent [[hallucinogenic]] effects and long duration of action.


Line 72: Line 22:
* [[Phenethylamine]]
* [[Phenethylamine]]
* [[Psychedelic drug]]
* [[Psychedelic drug]]
== References ==
{{Reflist}}
== External Links ==
{{Commons category|2,5-Dimethoxy-4-chloroamphetamine}}


[[Category:Psychedelic phenethylamines]]
[[Category:Psychedelic phenethylamines]]
Line 86: Line 30:
[[Category:Chemical compounds found in PiHKAL]]
[[Category:Chemical compounds found in PiHKAL]]
[[Category:Medicine]]
[[Category:Medicine]]
 
{{nt}}
{{medicine-stub}}

Latest revision as of 20:13, 13 January 2025

DOC2DACS.svg

Chemical compound


2,5-Dimethoxy-4-chloroamphetamine (DOC) is a psychedelic drug and a substituted amphetamine of the phenethylamine class. It is known for its potent hallucinogenic effects and long duration of action.

Chemical Structure and Properties[edit]

DOC is chemically classified as a substituted amphetamine, with the chemical formula C11H16ClNO2. It features a methoxy group at the 2 and 5 positions of the benzene ring, and a chloro group at the 4 position. The amphetamine backbone is characterized by a phenyl ring bound to an ethylamine chain.

Pharmacology[edit]

DOC acts primarily as a serotonin receptor agonist, particularly at the 5-HT2A receptor, which is believed to be responsible for its psychedelic effects. It also has affinity for other serotonin receptors, including 5-HT2B and 5-HT2C.

Effects[edit]

The effects of DOC can last from 12 to 24 hours, depending on the dose. Users report intense visual hallucinations, altered perception of time, and profound changes in thought processes. Due to its potency and long duration, it is often considered a substance that should be used with caution.

Legal Status[edit]

The legal status of DOC varies by country. In some jurisdictions, it is classified as a controlled substance, while in others it remains legal or unregulated. Users should be aware of the legal implications of possessing or using DOC in their respective countries.

History[edit]

DOC was first synthesized by Alexander Shulgin and described in his book PiHKAL (Phenethylamines I Have Known And Loved). It has since gained popularity in the psychedelic community for its powerful effects and long duration.

See Also[edit]