Eosin B: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
Line 1: Line 1:
== Eosin B ==


[[File:Eosin B structure.png|thumb|right|Chemical structure of Eosin B]]
{{Infobox chemical
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477239870
| ImageFile = Eosin B.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 4,5,6,7-tetrabromo-2-[[2,4,5,7-tetrabromo-6-oxo-3-[[3,6,9-trioxodecyl)oxy]xanthen-9-yl]benzoic acid
| OtherNames = Eosin bluish
| Section1 = {{Chembox Identifiers
  | CASNo_Ref = <ref>{{cite web |url=https://pubchem.ncbi.nlm.nih.gov/compound/5359400 |title=Eosin B |website=PubChem |accessdate=2023-10-01}}</ref>
  | CASNo = 548-24-3
  | PubChem = 5359400
  | ChemSpiderID = 4514950
  | UNII = 8B9I0XVD0E
  | ChEMBL = 1201668
  | SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3C2=O)Br)Br)Br)Br)Br
  | InChI = 1S/C20H6Br4O5/c21-9-1-5-11(13(25)7-9)20(29)12-6-2-10(22)8-14(12)26)23)3-4-15(24)19(28)18(27)16(17(20)30)31-12/h1-8,27-28H
  | InChIKey = ZQZVJXQKZKXKQF-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
  | C = 20
  | H = 6
  | Br = 4
  | O = 5
  | Appearance = Reddish-brown powder
  | Solubility = Soluble in water
}}
}}


'''Eosin B''' is a synthetic dye commonly used in histology and microbiology laboratories. It belongs to the family of eosin dyes, which are characterized by their bright red color. Eosin B is widely used as a counterstain in various staining techniques, allowing for the visualization of specific cellular structures and tissues.
'''Eosin B''' is a [[bromine]]-containing [[fluorescent dye]] used in [[histology]] and [[cytology]] for [[staining]] purposes. It is a derivative of [[fluorescein]] and is commonly referred to as eosin bluish due to its color.


=== History ===
== Applications ==
Eosin B is primarily used in the [[biological sciences]] for staining [[tissue]] samples. It is often used in combination with [[hematoxylin]] in the [[H&E stain]], which is one of the most widely used [[staining techniques]] in [[histopathology]]. The dye binds to [[cytoplasmic]] components and [[extracellular matrix]] proteins, providing contrast to the [[nucleus]] stained by hematoxylin.


Eosin B was first synthesized in the late 19th century by German chemist Paul Ehrlich. It was initially used as a textile dye, but its application in the field of biology and medicine quickly became apparent. Eosin B's ability to selectively stain certain cellular components made it a valuable tool in histological studies.
== Chemical Properties ==
Eosin B is a [[tetrabromo]] derivative of fluorescein. It is characterized by its reddish-brown color and its ability to fluoresce under [[ultraviolet light]]. The presence of bromine atoms in its structure enhances its staining properties and fluorescence.


=== Chemical Properties ===
== Safety and Handling ==
As with many chemical dyes, proper [[safety precautions]] should be taken when handling Eosin B. It should be used in a well-ventilated area, and [[personal protective equipment]] such as [[gloves]] and [[safety goggles]] should be worn to prevent skin and eye contact.


Eosin B is a water-soluble dye that belongs to the xanthene class of dyes. Its chemical formula is C20H8Br4O5 and its molecular weight is 691.89 g/mol. The dye appears as a dark red powder and is highly soluble in water, alcohol, and other polar solvents.
== See Also ==
 
* [[Eosin Y]]
=== Uses ===
* [[Fluorescein]]
 
* [[Histology]]
Eosin B is primarily used as a counterstain in histological staining techniques, such as hematoxylin and eosin (H&E) staining. In H&E staining, eosin B is used to stain the cytoplasm and extracellular matrix of cells, allowing for the differentiation of various tissue components. This staining technique is widely used in pathology to examine tissue samples and diagnose diseases.
* [[Cytology]]
 
Apart from histology, eosin B is also used in microbiology to stain certain microorganisms. It can be used to differentiate between different types of bacteria and fungi, aiding in their identification and classification.
 
=== Safety Considerations ===
 
Eosin B is generally considered safe to handle when used in laboratory settings. However, it is important to follow proper safety precautions, such as wearing gloves and protective eyewear, to avoid direct contact with the dye. Ingestion or inhalation of eosin B should be avoided, as it may cause irritation or other adverse effects.
 
=== References ===


== References ==
<references />
<references />


== See Also ==
== External Links ==
 
* [PubChem Entry for Eosin B](https://pubchem.ncbi.nlm.nih.gov/compound/5359400)
* [[Histology]]
* [[Microbiology]]
* [[Staining techniques]]
* [[Hematoxylin and eosin staining]]


[[Category:Dyes]]
[[Category:Histology stains]]
[[Category:Histology]]
[[Category:Fluorescent dyes]]
[[Category:Microbiology]]
[[Category:Bromine compounds]]
[[Category:Staining techniques]]
[[Category:Staining dyes]]

Revision as of 21:25, 27 December 2024

{{Infobox chemical | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477239870 | ImageFile = Eosin B.svg | ImageSize = 200px | ImageAlt = | IUPACName = 4,5,6,7-tetrabromo-2-[[2,4,5,7-tetrabromo-6-oxo-3-[[3,6,9-trioxodecyl)oxy]xanthen-9-yl]benzoic acid | OtherNames = Eosin bluish | Section1 = Template:Chembox Identifiers | Section2 = Template:Chembox Properties }}

Eosin B is a bromine-containing fluorescent dye used in histology and cytology for staining purposes. It is a derivative of fluorescein and is commonly referred to as eosin bluish due to its color.

Applications

Eosin B is primarily used in the biological sciences for staining tissue samples. It is often used in combination with hematoxylin in the H&E stain, which is one of the most widely used staining techniques in histopathology. The dye binds to cytoplasmic components and extracellular matrix proteins, providing contrast to the nucleus stained by hematoxylin.

Chemical Properties

Eosin B is a tetrabromo derivative of fluorescein. It is characterized by its reddish-brown color and its ability to fluoresce under ultraviolet light. The presence of bromine atoms in its structure enhances its staining properties and fluorescence.

Safety and Handling

As with many chemical dyes, proper safety precautions should be taken when handling Eosin B. It should be used in a well-ventilated area, and personal protective equipment such as gloves and safety goggles should be worn to prevent skin and eye contact.

See Also

References

<references />

External Links