Eosin B: Difference between revisions
CSV import |
CSV import |
||
| Line 1: | Line 1: | ||
[[ | {{Infobox chemical | ||
| Verifiedfields = changed | |||
| Watchedfields = changed | |||
| verifiedrevid = 477239870 | |||
| ImageFile = Eosin B.svg | |||
| ImageSize = 200px | |||
| ImageAlt = | |||
| IUPACName = 4,5,6,7-tetrabromo-2-[[2,4,5,7-tetrabromo-6-oxo-3-[[3,6,9-trioxodecyl)oxy]xanthen-9-yl]benzoic acid | |||
| OtherNames = Eosin bluish | |||
| Section1 = {{Chembox Identifiers | |||
| CASNo_Ref = <ref>{{cite web |url=https://pubchem.ncbi.nlm.nih.gov/compound/5359400 |title=Eosin B |website=PubChem |accessdate=2023-10-01}}</ref> | |||
| CASNo = 548-24-3 | |||
| PubChem = 5359400 | |||
| ChemSpiderID = 4514950 | |||
| UNII = 8B9I0XVD0E | |||
| ChEMBL = 1201668 | |||
| SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3C2=O)Br)Br)Br)Br)Br | |||
| InChI = 1S/C20H6Br4O5/c21-9-1-5-11(13(25)7-9)20(29)12-6-2-10(22)8-14(12)26)23)3-4-15(24)19(28)18(27)16(17(20)30)31-12/h1-8,27-28H | |||
| InChIKey = ZQZVJXQKZKXKQF-UHFFFAOYSA-N | |||
}} | |||
| Section2 = {{Chembox Properties | |||
| C = 20 | |||
| H = 6 | |||
| Br = 4 | |||
| O = 5 | |||
| Appearance = Reddish-brown powder | |||
| Solubility = Soluble in water | |||
}} | |||
}} | |||
'''Eosin B''' is a | '''Eosin B''' is a [[bromine]]-containing [[fluorescent dye]] used in [[histology]] and [[cytology]] for [[staining]] purposes. It is a derivative of [[fluorescein]] and is commonly referred to as eosin bluish due to its color. | ||
== | == Applications == | ||
Eosin B is primarily used in the [[biological sciences]] for staining [[tissue]] samples. It is often used in combination with [[hematoxylin]] in the [[H&E stain]], which is one of the most widely used [[staining techniques]] in [[histopathology]]. The dye binds to [[cytoplasmic]] components and [[extracellular matrix]] proteins, providing contrast to the [[nucleus]] stained by hematoxylin. | |||
Eosin B | == Chemical Properties == | ||
Eosin B is a [[tetrabromo]] derivative of fluorescein. It is characterized by its reddish-brown color and its ability to fluoresce under [[ultraviolet light]]. The presence of bromine atoms in its structure enhances its staining properties and fluorescence. | |||
== | == Safety and Handling == | ||
As with many chemical dyes, proper [[safety precautions]] should be taken when handling Eosin B. It should be used in a well-ventilated area, and [[personal protective equipment]] such as [[gloves]] and [[safety goggles]] should be worn to prevent skin and eye contact. | |||
== See Also == | |||
* [[Eosin Y]] | |||
* [[Fluorescein]] | |||
* [[Histology]] | |||
Eosin | * [[Cytology]] | ||
== References == | |||
<references /> | <references /> | ||
== | == External Links == | ||
* [PubChem Entry for Eosin B](https://pubchem.ncbi.nlm.nih.gov/compound/5359400) | |||
* [ | |||
[[Category: | [[Category:Histology stains]] | ||
[[Category: | [[Category:Fluorescent dyes]] | ||
[[Category: | [[Category:Bromine compounds]] | ||
[[Category:Staining | [[Category:Staining dyes]] | ||
Revision as of 21:25, 27 December 2024
{{Infobox chemical | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477239870 | ImageFile = Eosin B.svg | ImageSize = 200px | ImageAlt = | IUPACName = 4,5,6,7-tetrabromo-2-[[2,4,5,7-tetrabromo-6-oxo-3-[[3,6,9-trioxodecyl)oxy]xanthen-9-yl]benzoic acid | OtherNames = Eosin bluish | Section1 = Template:Chembox Identifiers | Section2 = Template:Chembox Properties }}
Eosin B is a bromine-containing fluorescent dye used in histology and cytology for staining purposes. It is a derivative of fluorescein and is commonly referred to as eosin bluish due to its color.
Applications
Eosin B is primarily used in the biological sciences for staining tissue samples. It is often used in combination with hematoxylin in the H&E stain, which is one of the most widely used staining techniques in histopathology. The dye binds to cytoplasmic components and extracellular matrix proteins, providing contrast to the nucleus stained by hematoxylin.
Chemical Properties
Eosin B is a tetrabromo derivative of fluorescein. It is characterized by its reddish-brown color and its ability to fluoresce under ultraviolet light. The presence of bromine atoms in its structure enhances its staining properties and fluorescence.
Safety and Handling
As with many chemical dyes, proper safety precautions should be taken when handling Eosin B. It should be used in a well-ventilated area, and personal protective equipment such as gloves and safety goggles should be worn to prevent skin and eye contact.
See Also
References
<references />
External Links
- [PubChem Entry for Eosin B](https://pubchem.ncbi.nlm.nih.gov/compound/5359400)