Testifenon: Difference between revisions

From WikiMD's Wellness Encyclopedia

← Older edit
CSV import
CSV import
 
Line 1: Line 1:
{{Drugbox
{{Short description|A medication used in the treatment of certain medical conditions}}
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(5''S'',8''R'',9''S'',10''S'',13''S'',14''S'',17''S'')-10,13-Dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[''a'']phenanthren-17-yl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate
| image = Testifenon.svg
| width = 250px
| image2 = Testifenon molecule ball.png
| width2 = 250px


<!--Clinical data-->
'''Testifenon''' is a pharmaceutical compound used in the management of specific medical conditions. It is primarily utilized in the treatment of [[endocrine disorders]] and has applications in [[hormone replacement therapy]].
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =


<!--Pharmacokinetic data-->
==Pharmacology==
| bioavailability =  
Testifenon functions as a synthetic analog of naturally occurring hormones. It interacts with [[hormone receptors]] in the body to exert its effects. The drug is designed to mimic the action of endogenous hormones, thereby restoring balance in patients with deficiencies or imbalances.
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =


<!-- Identifiers -->
==Medical Uses==
| CAS_number_Ref =
Testifenon is indicated for use in several medical conditions, including:
| CAS_number = 104730-58-7
| CAS_supplemental =  
| ATC_prefix =  
| ATC_suffix =  
| ATC_supplemental =  
| PubChem = 128659
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 114020
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = Testiphenon; Testiphenone; Chlorphenacyl dihydrotestosterone ester; Dihydrotestosterone 17β-(4-(bis(2-chloroethyl)amino)phenyl)acetate; LS-19378


<!--Chemical data-->
* [[Hypogonadism]]: It is used to treat low levels of [[testosterone]] in males, which can lead to symptoms such as decreased libido, fatigue, and loss of muscle mass.
| C=31 | H=43 | Cl=2 | N=1 | O=3
* [[Menopausal symptoms]]: In females, Testifenon can be part of hormone replacement therapy to alleviate symptoms associated with menopause, such as hot flashes and osteoporosis.
| SMILES = C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4OC(=O)CC5=CC=C(C=C5)N(CCCl)CCCl)C
* [[Delayed puberty]]: It may be prescribed to stimulate the onset of puberty in individuals with delayed development.
| StdInChI_Ref =
| StdInChI = 1S/C31H43Cl2NO3/c1-30-13-11-24(35)20-22(30)5-8-25-26-9-10-28(31(26,2)14-12-27(25)30)37-29(36)19-21-3-6-23(7-4-21)34(17-15-32)18-16-33/h3-4,6-7,22,25-28H,5,8-20H2,1-2H3/t22-,25-,26-,27-,28-,30-,31-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = JWLXQUMDRGJLMS-SJQIPMMSSA-N
}}


'''Testifenon''', also known as '''testiphenon''', '''testiphenone''', '''chlorphenacyl dihydrotestosterone ester''', or '''dihydrotestosterone 17β-(4-(bis(2-chloroethyl)amino)phenyl)acetate''', is a [[synthetic compound|synthetic]] [[anabolic–androgenic steroid]] (AAS) and a [[cytostatic]] [[antineoplastic agent]] (i.e., [[chemotherapy|chemotherapeutic]]) that was never marketed.<ref name="pmid3201773">{{cite journal | vauthors = Lagova ND, Sof'ina ZP, Shkodinskaia EN, Kurdiumova KN, Valueva IM | title = [The antineoplastic activity of testiphenon] | language = Russian | journal = Vopr Onkol | volume = 34 | issue = 11 | pages = 1363–8 | year = 1988 | pmid = 3201773 | doi = | url = }}</ref><ref name="DemidovaSerebryakova1995">{{cite journal|last1=Demidova|first1=N. V.|last2=Serebryakova|first2=E. A.|last3=Gasan-Guseinova|first3=Z. G.|last4=Zimakova|first4=N. I.|last5=Arzamastsev|first5=A. P.|title=Comparative pharmacokinetics of3H-testiphenone and3H-chlorophenacyl in peroral administration to mice|journal=Pharmaceutical Chemistry Journal|volume=29|issue=11|year=1995|pages=737–739|issn=0091-150X|doi=10.1007/BF02331848}}</ref><ref name="pmid11882971">{{cite journal | vauthors = Oborotova NA, Smirnova ZS, Polozkova ZS, Baryshnikov AI | title = [Pharmacological aspects in the development of liposomal medicinal preparations for the internal injection of hydrophobic cytostatics] | language = Russian | journal = Vestn. Akad. Med. Nauk SSSR | volume = | issue = 1 | pages = 42–5 | year = 2002 | pmid = 11882971 | doi = | url = }}</ref> It is an [[androgen ester]] – specifically, a [[chlorine|chlor]][[phenyl group|phen]][[acyl group|acyl]] [[nitrogen mustard]] [[ester]] of [[dihydrotestosterone]] (DHT) – and acts as a [[prodrug]] of these two components in the body.<ref name="pmid3201773" /><ref name="DemidovaSerebryakova1995" /> The drug was developed in [[Russia]] as a [[tissue selectivity|tissue-selective]] [[cytostasis|cytostatic]] [[drug]] for the treatment of various [[cancer]]s occurring in [[androgen receptor]]-expressing [[tissue (biology)|tissue]]s that would have reduced [[side effect]]s and [[toxicity]] relative to other chemotherapy drugs.<ref name="pmid3201773" /><ref name="DemidovaSerebryakova1995" />
==Mechanism of Action==
The mechanism of action of Testifenon involves binding to specific hormone receptors in target tissues. This binding initiates a cascade of cellular events that result in the modulation of gene expression and protein synthesis, ultimately leading to the desired physiological effects.


==See also==
==Administration==
* [[List of hormonal cytostatic antineoplastic agents]]
Testifenon is typically administered via [[oral]] or [[injectable]] routes, depending on the specific formulation and the condition being treated. The dosage and frequency of administration are determined by the healthcare provider based on the patient's needs and response to therapy.
* [[List of androgen esters#Dihydrotestosterone esters|List of androgen esters § Dihydrotestosterone esters]]


==References==
==Side Effects==
{{Reflist}}
Common side effects of Testifenon may include:


* [[Nausea]]
* [[Headache]]
* [[Acne]]
* Changes in mood or behavior


{{Androgen receptor modulators}}
Serious side effects, although rare, can occur and may include:


[[Category:Abandoned drugs]]
* [[Cardiovascular events]]
[[Category:Androgens and anabolic steroids]]
* [[Liver dysfunction]]
[[Category:Androstanes]]
* [[Thromboembolic disorders]]
[[Category:Antineoplastic drugs]]
[[Category:Dihydrotestosterone esters]]
[[Category:Nitrogen mustards]]
[[Category:Organochlorides]]
[[Category:Prodrugs]]
[[Category:Russian drugs]]


Patients are advised to report any unusual symptoms to their healthcare provider promptly.


{{Steroid-stub}}
==Contraindications==
{{Antineoplastic-drug-stub}}
Testifenon is contraindicated in individuals with:
{{dictionary-stub1}}
 
<gallery>
* Known hypersensitivity to the drug or its components
File:Testifenon.svg|Diagram of Testifenon
* History of [[breast cancer]] or [[prostate cancer]]
File:Testifenon_molecule_ball.png|Ball-and-stick model of Testifenon
* Severe [[liver disease]]
</gallery>
 
==Related Pages==
* [[Hormone replacement therapy]]
* [[Endocrine system]]
* [[Testosterone]]
 
[[Category:Pharmaceutical drugs]]
[[Category:Endocrinology]]

Latest revision as of 19:19, 22 March 2025

A medication used in the treatment of certain medical conditions


Testifenon is a pharmaceutical compound used in the management of specific medical conditions. It is primarily utilized in the treatment of endocrine disorders and has applications in hormone replacement therapy.

Pharmacology[edit]

Testifenon functions as a synthetic analog of naturally occurring hormones. It interacts with hormone receptors in the body to exert its effects. The drug is designed to mimic the action of endogenous hormones, thereby restoring balance in patients with deficiencies or imbalances.

Medical Uses[edit]

Testifenon is indicated for use in several medical conditions, including:

  • Hypogonadism: It is used to treat low levels of testosterone in males, which can lead to symptoms such as decreased libido, fatigue, and loss of muscle mass.
  • Menopausal symptoms: In females, Testifenon can be part of hormone replacement therapy to alleviate symptoms associated with menopause, such as hot flashes and osteoporosis.
  • Delayed puberty: It may be prescribed to stimulate the onset of puberty in individuals with delayed development.

Mechanism of Action[edit]

The mechanism of action of Testifenon involves binding to specific hormone receptors in target tissues. This binding initiates a cascade of cellular events that result in the modulation of gene expression and protein synthesis, ultimately leading to the desired physiological effects.

Administration[edit]

Testifenon is typically administered via oral or injectable routes, depending on the specific formulation and the condition being treated. The dosage and frequency of administration are determined by the healthcare provider based on the patient's needs and response to therapy.

Side Effects[edit]

Common side effects of Testifenon may include:

Serious side effects, although rare, can occur and may include:

Patients are advised to report any unusual symptoms to their healthcare provider promptly.

Contraindications[edit]

Testifenon is contraindicated in individuals with:

Related Pages[edit]

Retrieved from "https://wikimd.com/index.php?title=Testifenon&oldid=6534230"