Taurocholic acid: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
No edit summary
Line 1: Line 1:
{{Short description|A bile acid involved in the digestion of fats}}
{{Short description|A bile acid involved in the digestion of fats}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477239679
| ImageFile = Taurocholic acid.svg
| ImageSize = 200px
| IUPACName = 2-[[(3α,5β,7α,12α)-3,7,12-trihydroxycholan-24-yl]amino]ethanesulfonic acid
| OtherNames = N-Choloyltaurine
| Section1 = {{Chembox Identifiers
  | CASNo_Ref = <ref>{{Cite web |url=https://pubchem.ncbi.nlm.nih.gov/compound/Taurocholic-acid |title=Taurocholic acid |website=PubChem |access-date=2023-10-01}}</ref>
  | CASNo = 81-24-3
  | PubChem = 439225
  | ChemSpiderID = 388211
  | UNII = 7LYO5VOR8H
  | ChEBI = 28832
  | ChEMBL = 1201630
  | SMILES = C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@@H]1[C@H]2[C@H]3[C@@H](CC[C@]3(C)[C@H]2[C@@H](O)C1)O
  | InChI = 1S/C26H45NO7S/c1-16(2)7-8-19(28)27-9-10-35(32,33)34)26(6)14-18(30)22-20(26)11-12-21-23(22)15-24(31)25(21,3)13-17(16)4-5-17/h16-18,20-24,28,30-31H,4-15H2,1-3H3,(H,27,28)(H,32,33,34)/t16-,17-,18-,20-,21-,22+,23-,24-,25-,26-/m0/s1
  | InChIKey = RUDATBOHQWOJDD-CEGNMAFCSA-N
}}
| Section2 = {{Chembox Properties
  | C = 26
  | H = 45
  | N = 1
  | O = 7
  | S = 1
  | MolarMass = 515.7 g/mol
}}
}}
'''Taurocholic acid''' is a [[bile acid]] that is conjugated with [[taurine]]. It is one of the primary bile acids produced in the [[liver]] and is involved in the [[digestion]] and [[absorption]] of [[fats]] and [[fat-soluble vitamins]] in the [[small intestine]].
'''Taurocholic acid''' is a [[bile acid]] that is conjugated with [[taurine]]. It is one of the primary bile acids produced in the [[liver]] and is involved in the [[digestion]] and [[absorption]] of [[fats]] and [[fat-soluble vitamins]] in the [[small intestine]].


Line 43: Line 12:
* [[Glycocholic acid]]
* [[Glycocholic acid]]
* [[Bile salt]]
* [[Bile salt]]
==References==
<references />
==External Links==
==External Links==
* [https://pubchem.ncbi.nlm.nih.gov/compound/Taurocholic-acid PubChem - Taurocholic acid]
* [https://pubchem.ncbi.nlm.nih.gov/compound/Taurocholic-acid PubChem - Taurocholic acid]
[[Category:Bile acids]]
[[Category:Bile acids]]
[[Category:Sulfonic acids]]
[[Category:Sulfonic acids]]
[[Category:Cholanes]]
[[Category:Cholanes]]
[[Category:Biochemistry]]
[[Category:Biochemistry]]

Revision as of 20:18, 5 January 2025

A bile acid involved in the digestion of fats


Taurocholic acid is a bile acid that is conjugated with taurine. It is one of the primary bile acids produced in the liver and is involved in the digestion and absorption of fats and fat-soluble vitamins in the small intestine.

Biological Role

Taurocholic acid is synthesized in the liver from cholesterol and is secreted into the bile duct. It plays a crucial role in the emulsification of dietary fats, which is essential for their digestion by lipase enzymes. The presence of taurocholic acid in the intestine also facilitates the absorption of fat-soluble vitamins such as vitamin A, vitamin D, vitamin E, and vitamin K.

Clinical Significance

Abnormal levels of taurocholic acid can be indicative of liver dysfunction or bile acid malabsorption. It is also studied in the context of gallstone formation and cholestasis.

See Also

External Links