Eosin B: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
No edit summary
Line 1: Line 1:
{{Infobox chemical
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477239870
| ImageFile = Eosin B.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 4,5,6,7-tetrabromo-2-[[2,4,5,7-tetrabromo-6-oxo-3-[[3,6,9-trioxodecyl)oxy]xanthen-9-yl]benzoic acid
| OtherNames = Eosin bluish
| Section1 = {{Chembox Identifiers
  | CASNo_Ref = <ref>{{cite web |url=https://pubchem.ncbi.nlm.nih.gov/compound/5359400 |title=Eosin B |website=PubChem |accessdate=2023-10-01}}</ref>
  | CASNo = 548-24-3
  | PubChem = 5359400
  | ChemSpiderID = 4514950
  | UNII = 8B9I0XVD0E
  | ChEMBL = 1201668
  | SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3C2=O)Br)Br)Br)Br)Br
  | InChI = 1S/C20H6Br4O5/c21-9-1-5-11(13(25)7-9)20(29)12-6-2-10(22)8-14(12)26)23)3-4-15(24)19(28)18(27)16(17(20)30)31-12/h1-8,27-28H
  | InChIKey = ZQZVJXQKZKXKQF-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
  | C = 20
  | H = 6
  | Br = 4
  | O = 5
  | Appearance = Reddish-brown powder
  | Solubility = Soluble in water
}}
}}
'''Eosin B''' is a [[bromine]]-containing [[fluorescent dye]] used in [[histology]] and [[cytology]] for [[staining]] purposes. It is a derivative of [[fluorescein]] and is commonly referred to as eosin bluish due to its color.
'''Eosin B''' is a [[bromine]]-containing [[fluorescent dye]] used in [[histology]] and [[cytology]] for [[staining]] purposes. It is a derivative of [[fluorescein]] and is commonly referred to as eosin bluish due to its color.



Revision as of 20:17, 5 January 2025

Eosin B is a bromine-containing fluorescent dye used in histology and cytology for staining purposes. It is a derivative of fluorescein and is commonly referred to as eosin bluish due to its color.

Applications

Eosin B is primarily used in the biological sciences for staining tissue samples. It is often used in combination with hematoxylin in the H&E stain, which is one of the most widely used staining techniques in histopathology. The dye binds to cytoplasmic components and extracellular matrix proteins, providing contrast to the nucleus stained by hematoxylin.

Chemical Properties

Eosin B is a tetrabromo derivative of fluorescein. It is characterized by its reddish-brown color and its ability to fluoresce under ultraviolet light. The presence of bromine atoms in its structure enhances its staining properties and fluorescence.

Safety and Handling

As with many chemical dyes, proper safety precautions should be taken when handling Eosin B. It should be used in a well-ventilated area, and personal protective equipment such as gloves and safety goggles should be worn to prevent skin and eye contact.

See Also

References

<references />

External Links