Sulfonmethane: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
Tags: mobile edit mobile web edit
CSV import
 
Line 1: Line 1:
{{Short description|A sedative and hypnotic drug}}
Sulfonmethane
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477002123
| IUPAC_name = 2,2-bis(ethylsulfonyl)propane
| image = Sulfonmethane.svg
| image2 = Sulfonmethane-3D-balls.png
| image2_caption = Ball-and-stick model of sulfonmethane
| tradename = Sulfonal
| CAS_number = 115-24-2
| ATC_prefix = N05
| ATC_suffix = CM10
| PubChem = 6851
| ChemSpiderID = 6591
| UNII = 0K8C52507Q
| KEGG = D07268
| ChEBI = 32182
| ChEMBL = 1201290
| C=5
| H=12
| O=4
| S=2
| SMILES = CC(S(=O)(=O)C(C)(C)S(=O)(=O)CC)CC
| StdInChI = 1S/C7H16O4S2/c1-5-12(8,9)7(3,4)13(10,11)6-2/h5-6H2,1-4H3
| StdInChIKey = ZJQHPWUVQPJDKF-UHFFFAOYSA-N
}}


'''Sulfonmethane''', also known as '''sulfonal''', is a [[sedative]] and [[hypnotic]] drug that was historically used to treat [[insomnia]] and other sleep disorders. It belongs to the class of [[organosulfur compounds]] and is chemically classified as a [[sulfone]].
[[File:Sulfonal.svg|thumb|right|Chemical structure of sulfonmethane]]


==History==
'''Sulfonmethane''', also known as '''sulfonal''', is a [[sedative]] and [[hypnotic]] drug that was first synthesized in the late 19th century. It belongs to the class of [[organosulfur compounds]] and was historically used to treat [[insomnia]] and other sleep disorders.
Sulfonmethane was first synthesized in the late 19th century by the German chemist [[Eugen Baumann]]. It was introduced into medical practice in the 1880s as a sedative and hypnotic agent. During this period, it was commonly used to induce sleep in patients suffering from insomnia and other sleep-related disorders.


==Chemical Structure and Properties==
==Chemical Structure and Properties==
Sulfonmethane is a symmetrical molecule with the chemical formula C<sub>7</sub>H<sub>16</sub>O<sub>4</sub>S<sub>2</sub>. It consists of a central propane backbone with two ethylsulfonyl groups attached to the second carbon atom. The presence of these sulfonyl groups is responsible for its sedative properties.


[[File:Sulfonmethane-3D-balls.png|thumb|left|Ball-and-stick model of sulfonmethane]]
Sulfonmethane is a [[sulfonyl]] compound with the chemical formula C<sub>7</sub>H<sub>10</sub>O<sub>4</sub>S<sub>2</sub>. It is characterized by the presence of two [[sulfonyl]] groups attached to a central [[carbon]] atom, forming a symmetrical structure. The compound is typically a white crystalline powder that is soluble in water and alcohol.
 
[[File:Sulfonal-3D-sticks.png|thumb|left|3D model of sulfonmethane]]
 
==History==
 
Sulfonmethane was first synthesized in 1888 by the German chemist Eugen Baumann. It was introduced into medical practice shortly thereafter as a [[hypnotic]] agent. During the late 19th and early 20th centuries, it was widely used as a sleep aid before the development of more modern [[barbiturates]] and [[benzodiazepines]].


==Pharmacology==
==Pharmacology==
Sulfonmethane acts as a central nervous system [[depressant]]. It enhances the activity of the inhibitory neurotransmitter [[gamma-aminobutyric acid]] (GABA) in the brain, leading to sedative and hypnotic effects. This mechanism of action is similar to that of other [[barbiturates]], although sulfonmethane is chemically distinct from them.


==Medical Use==
Sulfonmethane acts as a [[central nervous system]] depressant. Its sedative effects are believed to result from its ability to enhance the activity of the [[gamma-aminobutyric acid]] (GABA) neurotransmitter system, which is the primary inhibitory system in the brain. This action leads to a calming effect on the [[nervous system]], promoting sleep.
Historically, sulfonmethane was used to treat insomnia and other sleep disorders. It was administered orally in the form of tablets or powders. However, due to the development of safer and more effective sedative-hypnotic drugs, such as [[benzodiazepines]], the use of sulfonmethane has declined significantly.
 
==Medical Uses==


==Side Effects==
Historically, sulfonmethane was used to treat [[insomnia]] and other sleep disorders. It was also occasionally used as a [[sedative]] for [[anxiety]] and [[nervousness]]. However, due to its potential for [[toxicity]] and the development of safer alternatives, its use has declined significantly.
The use of sulfonmethane can lead to several side effects, including [[drowsiness]], [[dizziness]], and [[headache]]. In some cases, it may cause [[gastrointestinal disturbances]] such as [[nausea]] and [[vomiting]]. Prolonged use can lead to [[tolerance]] and [[dependence]], similar to other sedative-hypnotic drugs.
 
==Side Effects and Toxicity==
 
The use of sulfonmethane can lead to several side effects, including [[drowsiness]], [[dizziness]], and [[headache]]. In cases of overdose, it can cause severe [[central nervous system]] depression, leading to [[coma]] or even [[death]]. Chronic use can result in [[tolerance]] and [[dependence]].


==Current Status==
==Current Status==
Today, sulfonmethane is rarely used in clinical practice due to the availability of newer and safer alternatives. It is primarily of historical interest and is studied for its role in the development of sedative-hypnotic pharmacology.


==Related pages==
Today, sulfonmethane is largely obsolete in clinical practice. It has been replaced by more effective and safer [[hypnotic]] agents. However, it remains of historical interest as one of the early synthetic [[sedatives]].
 
==Related Pages==
 
* [[Sedative]]
* [[Sedative]]
* [[Hypnotic]]
* [[Hypnotic]]
Line 58: Line 42:
[[Category:Hypnotics]]
[[Category:Hypnotics]]
[[Category:Organosulfur compounds]]
[[Category:Organosulfur compounds]]
[[Category:History of medicine]]

Latest revision as of 14:13, 21 February 2025

Sulfonmethane

Chemical structure of sulfonmethane

Sulfonmethane, also known as sulfonal, is a sedative and hypnotic drug that was first synthesized in the late 19th century. It belongs to the class of organosulfur compounds and was historically used to treat insomnia and other sleep disorders.

Chemical Structure and Properties[edit]

Sulfonmethane is a sulfonyl compound with the chemical formula C7H10O4S2. It is characterized by the presence of two sulfonyl groups attached to a central carbon atom, forming a symmetrical structure. The compound is typically a white crystalline powder that is soluble in water and alcohol.

3D model of sulfonmethane

History[edit]

Sulfonmethane was first synthesized in 1888 by the German chemist Eugen Baumann. It was introduced into medical practice shortly thereafter as a hypnotic agent. During the late 19th and early 20th centuries, it was widely used as a sleep aid before the development of more modern barbiturates and benzodiazepines.

Pharmacology[edit]

Sulfonmethane acts as a central nervous system depressant. Its sedative effects are believed to result from its ability to enhance the activity of the gamma-aminobutyric acid (GABA) neurotransmitter system, which is the primary inhibitory system in the brain. This action leads to a calming effect on the nervous system, promoting sleep.

Medical Uses[edit]

Historically, sulfonmethane was used to treat insomnia and other sleep disorders. It was also occasionally used as a sedative for anxiety and nervousness. However, due to its potential for toxicity and the development of safer alternatives, its use has declined significantly.

Side Effects and Toxicity[edit]

The use of sulfonmethane can lead to several side effects, including drowsiness, dizziness, and headache. In cases of overdose, it can cause severe central nervous system depression, leading to coma or even death. Chronic use can result in tolerance and dependence.

Current Status[edit]

Today, sulfonmethane is largely obsolete in clinical practice. It has been replaced by more effective and safer hypnotic agents. However, it remains of historical interest as one of the early synthetic sedatives.

Related Pages[edit]