3F-NEB: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
{{Short description|Synthetic cannabinoid}}
== 3F-NEB ==
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477318752
| IUPAC_name = (1-(5-fluoropentyl)-1H-indazole-3-carbonyl)-L-valine methyl ester
| image = 3F-NEB_structure.png
| width = 200
| legal_status = Legal status varies by jurisdiction
| routes_of_administration = Inhalation, oral
| CAS_number = 1800101-60-3
| PubChem = 11902592
| ChemSpiderID = 10028509
| UNII = 7X9V3Y0H3F
| C=20 | H=27 | F=1 | N=3 | O=3
| smiles = COC(=O)[C@@H](NC(=O)c1nn(CCCCC(F)F)c2ccccc12)C(C)C
}}


'''3F-NEB''' is a synthetic [[cannabinoid]] that has been used in scientific research and is often found in [[designer drug]]s. It is a potent agonist of the [[cannabinoid receptor]]s, which are part of the [[endocannabinoid system]] in the human body.
[[File:3F-NEB_structure.png|thumb|right|Chemical structure of 3F-NEB]]


==Chemical Structure and Properties==
'''3F-NEB''' is a synthetic compound that belongs to the class of [[novel psychoactive substances]] (NPS). It is a fluorinated derivative of the [[cathinone]] family, which are substances chemically similar to [[cathinone]], a naturally occurring stimulant found in the [[khat]] plant. 3F-NEB is known for its stimulant and euphoric effects, which have led to its use as a recreational drug.
3F-NEB is chemically classified as an indazole-based synthetic cannabinoid. Its full chemical name is (1-(5-fluoropentyl)-1H-indazole-3-carbonyl)-L-valine methyl ester. The compound features a fluorinated pentyl chain, which is a common modification in synthetic cannabinoids to enhance their potency and metabolic stability.


The molecular formula of 3F-NEB is C<sub>20</sub>H<sub>27</sub>FN<sub>3</sub>O<sub>3</sub>, and it has a molecular weight of approximately 377.45 g/mol. The presence of the fluorine atom in the pentyl chain is believed to contribute to its high affinity for cannabinoid receptors.
== Chemical Properties ==


==Pharmacology==
3F-NEB is chemically known as 3-fluoro-N-ethylbuphedrone. It is a derivative of [[buphedrone]], with a fluorine atom replacing a hydrogen atom in the phenyl ring. This modification is believed to alter the compound's pharmacological properties, potentially increasing its potency and duration of action compared to non-fluorinated analogs.
3F-NEB acts as a full agonist at the [[CB1 receptor|CB<sub>1</sub>]] and [[CB2 receptor|CB<sub>2</sub>]] receptors, which are part of the [[endocannabinoid system]]. This system plays a crucial role in regulating various physiological processes, including mood, appetite, and pain sensation.


The activation of these receptors by 3F-NEB can lead to effects similar to those of [[tetrahydrocannabinol]] (THC), the primary psychoactive component of [[cannabis]]. However, synthetic cannabinoids like 3F-NEB can be significantly more potent than THC, leading to increased risks of adverse effects.
== Pharmacology ==


==Legal Status==
The pharmacological effects of 3F-NEB are not well-studied, but it is presumed to act as a [[monoamine]] releasing agent, similar to other cathinones. This means it likely increases the levels of [[neurotransmitters]] such as [[dopamine]], [[norepinephrine]], and [[serotonin]] in the brain, leading to its stimulant effects. Users report increased energy, alertness, and euphoria, but these effects can be accompanied by adverse reactions such as anxiety, paranoia, and cardiovascular issues.
The legal status of 3F-NEB varies by jurisdiction. In many countries, synthetic cannabinoids are controlled substances due to their potential for abuse and lack of medical use. It is important for researchers and users to be aware of the legal implications of possessing or distributing 3F-NEB in their respective regions.


==Health Risks and Safety==
== Legal Status ==
The use of synthetic cannabinoids, including 3F-NEB, has been associated with a range of adverse health effects. These can include [[tachycardia]], [[hypertension]], [[nausea]], [[vomiting]], [[anxiety]], [[hallucinations]], and [[seizures]]. In severe cases, use can lead to [[acute kidney injury]] and [[cardiovascular complications]].


Due to the variability in potency and the presence of unknown impurities in street formulations, the use of synthetic cannabinoids poses significant health risks. Users should exercise caution and seek medical attention if adverse effects occur.
The legal status of 3F-NEB varies by country. In many jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of medical use. It is often included in legislation targeting synthetic cathinones and other novel psychoactive substances.


==Related Pages==
== Health Risks ==
* [[Synthetic cannabinoids]]
* [[Cannabinoid receptor]]
* [[Designer drug]]
* [[Endocannabinoid system]]


==Gallery==
The use of 3F-NEB carries significant health risks. Acute effects can include [[tachycardia]], [[hypertension]], [[hyperthermia]], and [[seizures]]. Chronic use may lead to [[addiction]], [[psychosis]], and other long-term health issues. Due to the lack of research, the full extent of its toxicity and potential for harm is not fully understood.
<gallery>
File:3F-NEB_structure.png|Chemical structure of 3F-NEB
</gallery>


[[Category:Synthetic cannabinoids]]
== Related Pages ==
[[Category:Designer drugs]]
 
* [[Cathinone]]
* [[Novel psychoactive substances]]
* [[Buphedrone]]
* [[Fluorinated compounds]]
 
[[Category:Novel psychoactive substances]]
[[Category:Cathinones]]

Latest revision as of 03:56, 13 February 2025

3F-NEB[edit]

Chemical structure of 3F-NEB

3F-NEB is a synthetic compound that belongs to the class of novel psychoactive substances (NPS). It is a fluorinated derivative of the cathinone family, which are substances chemically similar to cathinone, a naturally occurring stimulant found in the khat plant. 3F-NEB is known for its stimulant and euphoric effects, which have led to its use as a recreational drug.

Chemical Properties[edit]

3F-NEB is chemically known as 3-fluoro-N-ethylbuphedrone. It is a derivative of buphedrone, with a fluorine atom replacing a hydrogen atom in the phenyl ring. This modification is believed to alter the compound's pharmacological properties, potentially increasing its potency and duration of action compared to non-fluorinated analogs.

Pharmacology[edit]

The pharmacological effects of 3F-NEB are not well-studied, but it is presumed to act as a monoamine releasing agent, similar to other cathinones. This means it likely increases the levels of neurotransmitters such as dopamine, norepinephrine, and serotonin in the brain, leading to its stimulant effects. Users report increased energy, alertness, and euphoria, but these effects can be accompanied by adverse reactions such as anxiety, paranoia, and cardiovascular issues.

Legal Status[edit]

The legal status of 3F-NEB varies by country. In many jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of medical use. It is often included in legislation targeting synthetic cathinones and other novel psychoactive substances.

Health Risks[edit]

The use of 3F-NEB carries significant health risks. Acute effects can include tachycardia, hypertension, hyperthermia, and seizures. Chronic use may lead to addiction, psychosis, and other long-term health issues. Due to the lack of research, the full extent of its toxicity and potential for harm is not fully understood.

Related Pages[edit]

Retrieved from "https://wikimd.com/index.php?title=3F-NEB&oldid=6291982"