Template:Chembox
From WikiMD's Medical Encyclopedia
Page Template:Chembox/styles.css has no content.
| Chemical Formula | |
| Molar Mass |
- - - - |
| Data sourced from verified databases | |
Usage
This template displays chemical compound data in an infobox format.
Example
{{Chembox
| Name = Cholic acid
| ImageFile = Cholic acid.svg
| ImageAlt = Skeletal formula of cholic acid
| ImageCaption = Cholic acid chemical structure
| ImageFile1 = Cholic acid 3D ball.png
| ImageAlt1 = 3D ball model
| ImageCaption1= Cholic acid 3D structure
| IUPACName = (R)-4-[(3R,5S,7R,8R,9S,10R,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
| OtherNames = 3α,7α,12α-Trihydroxy-5β-cholan-24-oic acid
| CAS_number = 81-25-4
| PubChem = 221493
| ChemSpiderID = 192104
| ChEBI = 16359
| DrugBank = DB02659
| Formula = C<sub>24</sub>H<sub>40</sub>O<sub>5</sub>
| MolarMass = 408.57 g/mol
| MeltingPoint = 198–200 °C
| SMILES = C[C@H]1CC[C@H]2[C@@H]3CC[C@H]4[C@@H](C[C@@H](O)[C@H]4[C@@H]3CC[C@H]2[C@@]1(C)C)C[C@@H](CC(=O)O)O
| InChI = 1S/C24H40O5/c1-13-4-5-14-15-6-7-17-20(27)18(15)8-9-21(17)24(14,2)16(13)10-19(26)22(3)11-23(28)12-25/h13-22,25-28H,4-12H2,1-3H3/t13-,14-,15+,16-,17-,18-,19-,20-,21-,22-,24-/m0/s1
| InChIKey = BHQCQFFYRZLCQQ-HPLJOQBZSA-N
}}Parameters
- `Name` - Name of the compound.
- `ImageFile`, `ImageFile1` - File names for images.
- `ImageAlt`, `ImageCaption` - Alternative text and captions for images.
- `IUPACName` - IUPAC name of the compound.
- `OtherNames` - Synonyms for the compound.
- `CAS_number`, `PubChem`, `ChemSpiderID`, `ChEBI`, `DrugBank` - External chemical identifiers.
- `Formula` - Molecular formula.
- `MolarMass` - Molecular weight.
- `MeltingPoint` - Melting point temperature.
- `SMILES`, `InChI`, `InChIKey` - Chemical notations.
Notes
- Empty fields are automatically hidden.
- The design is clean, functional, and compatible with MediaWiki without Lua dependencies.