5-Bromo-DMT: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
Line 1: Line 1:
{{Short description|A brominated derivative of dimethyltryptamine}}
== 5-Bromo-DMT ==
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477002123
| IUPAC_name = 2-(5-bromo-1H-indol-3-yl)-N,N-dimethylethanamine
| image = 5-Bromo-DMT.svg
| image_size = 200px
| image_alt =
| width =
| alt =
| legal_status =
| routes_of_administration =
| CAS_number = 17274-28-5
| PubChem = 443378
| ChemSpiderID = 391558
| UNII =
| KEGG =
| ChEMBL = 127630
| C=12
| H=15
| Br=1
| N=2
| smiles = CN(C)CCc1c[nH]c2ccc(Br)cc12
| StdInChI = 1S/C12H15BrN2/c1-15(2)7-6-9-8-14-12-5-4-10(13)3-11(9)12/h3-5,8,14H,6-7H2,1-2H3
| StdInChIKey = ZFQQUVTXQXKJTP-UHFFFAOYSA-N
}}


'''5-Bromo-DMT''' is a [[psychedelic]] compound that belongs to the [[tryptamine]] class. It is a brominated derivative of [[dimethyltryptamine]] (DMT), a naturally occurring psychedelic substance found in various plants and animals.
[[File:5-Bromo-DMT.svg|thumb|right|Chemical structure of 5-Bromo-DMT]]


==Chemical Structure and Properties==
'''5-Bromo-DMT''' (5-bromo-N,N-dimethyltryptamine) is a [[psychedelic]] compound of the [[tryptamine]] class. It is a derivative of [[DMT]] (N,N-dimethyltryptamine) with a bromine atom substituted at the 5-position of the indole ring.
5-Bromo-DMT is chemically known as 2-(5-bromo-1H-indol-3-yl)-N,N-dimethylethanamine. It is characterized by the presence of a bromine atom at the 5-position of the indole ring, which distinguishes it from its parent compound, DMT. The molecular formula of 5-Bromo-DMT is C<sub>12</sub>H<sub>15</sub>BrN<sub>2</sub>.


==Pharmacology==
== Chemical Properties ==
The pharmacological properties of 5-Bromo-DMT are not as well-studied as those of DMT. However, it is believed to interact with [[serotonin receptors]], similar to other tryptamines. The presence of the bromine atom may alter its binding affinity and activity at these receptors, potentially leading to different psychoactive effects.


==Effects==
5-Bromo-DMT is a [[brominated]] tryptamine, which means it has a bromine atom attached to its indole ring. The presence of the bromine atom can affect the compound's [[pharmacokinetics]] and [[pharmacodynamics]], potentially altering its [[psychoactive]] effects compared to other tryptamines.
The effects of 5-Bromo-DMT are not well-documented in scientific literature. Anecdotal reports suggest that it may produce psychedelic effects similar to those of DMT, including altered perception, visual hallucinations, and changes in thought processes. However, the specific effects and their intensity can vary depending on the dose and individual differences.


==Legal Status==
== Pharmacology ==
The legal status of 5-Bromo-DMT varies by country. In some jurisdictions, it may be classified as a controlled substance due to its structural similarity to DMT and other tryptamines. It is important to consult local regulations to determine its legal status in a specific area.


==Synthesis==
The pharmacological effects of 5-Bromo-DMT are not well-documented, but it is believed to act as a [[serotonin receptor]] agonist, similar to other tryptamines. This action is thought to be responsible for its psychedelic effects. The compound may interact with various [[serotonin receptors]], including the [[5-HT2A receptor]], which is commonly associated with the effects of classic psychedelics.
The synthesis of 5-Bromo-DMT involves the bromination of DMT. This can be achieved through various chemical reactions that introduce a bromine atom into the indole ring. The specific methods and reagents used can vary depending on the desired yield and purity of the final product.


==Related Compounds==
== Effects ==
* [[Dimethyltryptamine]] (DMT)
* [[5-MeO-DMT]]
* [[4-AcO-DMT]]
* [[Bufotenin]]


==See Also==
The effects of 5-Bromo-DMT are not extensively studied, but anecdotal reports suggest it may produce [[hallucinogenic]] effects similar to other tryptamines. Users have reported experiencing [[visual hallucinations]], [[altered states of consciousness]], and [[euphoria]]. The duration and intensity of these effects can vary depending on the dose and individual factors.
* [[Psychedelic tryptamines]]
 
* [[Serotonin receptor agonists]]
== Legal Status ==
 
The legal status of 5-Bromo-DMT varies by country. In some jurisdictions, it may be classified as a controlled substance due to its structural similarity to other regulated tryptamines. It is important to consult local laws and regulations regarding its possession and use.
 
== Related Compounds ==
 
5-Bromo-DMT is part of a larger family of tryptamines, which includes:
 
* [[DMT]] (N,N-dimethyltryptamine)
* [[5-MeO-DMT]] (5-methoxy-N,N-dimethyltryptamine)
* [[4-AcO-DMT]] (4-acetoxy-N,N-dimethyltryptamine)
 
These compounds share a common tryptamine backbone but differ in their substituents, which can lead to variations in their effects and potency.
 
== See Also ==


==Related Pages==
* [[Psychedelic drug]]
* [[Psychedelic drug]]
* [[Serotonin receptor]]
* [[Tryptamine]]
* [[Tryptamine]]
* [[Indole]]
 
== Related Pages ==
 
* [[DMT]]
* [[Psychedelic research]]
* [[Hallucinogen]]


[[Category:Psychedelic tryptamines]]
[[Category:Psychedelic tryptamines]]
[[Category:Serotonin receptor agonists]]
[[Category:Organobromides]]

Latest revision as of 03:47, 13 February 2025

5-Bromo-DMT[edit]

Chemical structure of 5-Bromo-DMT

5-Bromo-DMT (5-bromo-N,N-dimethyltryptamine) is a psychedelic compound of the tryptamine class. It is a derivative of DMT (N,N-dimethyltryptamine) with a bromine atom substituted at the 5-position of the indole ring.

Chemical Properties[edit]

5-Bromo-DMT is a brominated tryptamine, which means it has a bromine atom attached to its indole ring. The presence of the bromine atom can affect the compound's pharmacokinetics and pharmacodynamics, potentially altering its psychoactive effects compared to other tryptamines.

Pharmacology[edit]

The pharmacological effects of 5-Bromo-DMT are not well-documented, but it is believed to act as a serotonin receptor agonist, similar to other tryptamines. This action is thought to be responsible for its psychedelic effects. The compound may interact with various serotonin receptors, including the 5-HT2A receptor, which is commonly associated with the effects of classic psychedelics.

Effects[edit]

The effects of 5-Bromo-DMT are not extensively studied, but anecdotal reports suggest it may produce hallucinogenic effects similar to other tryptamines. Users have reported experiencing visual hallucinations, altered states of consciousness, and euphoria. The duration and intensity of these effects can vary depending on the dose and individual factors.

Legal Status[edit]

The legal status of 5-Bromo-DMT varies by country. In some jurisdictions, it may be classified as a controlled substance due to its structural similarity to other regulated tryptamines. It is important to consult local laws and regulations regarding its possession and use.

Related Compounds[edit]

5-Bromo-DMT is part of a larger family of tryptamines, which includes:

  • DMT (N,N-dimethyltryptamine)
  • 5-MeO-DMT (5-methoxy-N,N-dimethyltryptamine)
  • 4-AcO-DMT (4-acetoxy-N,N-dimethyltryptamine)

These compounds share a common tryptamine backbone but differ in their substituents, which can lead to variations in their effects and potency.

See Also[edit]

Related Pages[edit]

Retrieved from "https://wikimd.com/index.php?title=5-Bromo-DMT&oldid=6291321"