Template:Chembox: Difference between revisions

Revision as of 17:59, 17 December 2024

Page Template:Chembox/styles.css has no content.

Usage

This template displays chemical information in a clean infobox.

Example

{{Chembox
| Name        = Flavopiridol
| ImageFile   = Flavopiridol.svg
| ImageSize   = 200px
| ImageFile1  = Alvocidib ball-and-stick.png
| ImageSize1  = 200px
| IUPACName   = 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methyl-4-piperidinyl]-4-chromenone
| OtherNames  = Flavopiridol, HMR 1275, L-868275

| Section1    = {{Chembox Identifiers
| UNII = 45AD6X575G
| CASNo = 146426-40-6
| PubChem = 5287969
| ChEBI = 47344
| ChEMBL = 428690
| ChemSpiderID = 4450222
| KEGG = D09868
| StdInChI = 1S/C21H20ClNO5/...
| DrugBank = DB03496
| SMILES = Clc4ccccc4C=2Oc1c(c(O)cc(O)c1...)
}}

| Section2    = {{Chembox Properties
| Formula = C<sub>21</sub>H<sub>20</sub>ClNO<sub>5</sub>
| MolarMass = 401.8402
}}

| Section3    = {{Chembox Hazards
| MainHazards = 
}}
}}

Parameters

`Name` - Title displayed in the infobox header.
`ImageFile`, `ImageFile1` - Chemical structure or other images.
`ImageSize` - Image size (default 200px).
`IUPACName` - Official IUPAC name.
`OtherNames` - Alternate names.
`Section1` - Identifier section using `Chembox Identifiers`.
`Section2` - Properties section using `Chembox Properties`.
`Section3` - Hazards section using `Chembox Hazards`.

Notes

Sections like `Section1`, `Section2`, and `Section3` are optional.
Add as many sections as needed for chemical data.

@@ Line 1: / Line 1: @@
 <templatestyles src="Chembox/styles.css"/>
 {| class="infobox" style="width:22em; background:#f9f9f9; border:1px solid #aaa; padding:5px; font-size:90%;"
-|+ style="font-weight:bold; font-size:110%; background:#efefef; padding:3px;" | {{{name|{{PAGENAME}}}}}
+|+ style="font-weight:bold; font-size:110%; background:#efefef; padding:3px;" | {{{Name|{{PAGENAME}}}}}
-<!-- IMAGE SECTION -->
+<!-- IMAGES -->
+{{#if: {{{ImageFile|}}} |
 |-
-| style="text-align:center;" | {{#if: {{{image|}}} |
+| style="text-align:center;" | [[File:{{{ImageFile}}}|{{{ImageSize|200px}}}|alt={{{ImageAlt|}}}]]
-[[File:{{{image}}}|{{{image_size|200px}}}|alt={{{image_alt|}}}]]<br>
+<br><small>{{{ImageCaption|}}}</small>
-<small>{{{image_alt|}}}</small>
 }}
-{{#if: {{{image2|}}} |
+{{#if: {{{ImageFile1|}}} |
-<br>[[File:{{{image2}}}|{{{image2_size|200px}}}|alt={{{image2_alt|}}}]]<br>
+|-
-<small>{{{image2_alt|}}}</small>
+| style="text-align:center;" | [[File:{{{ImageFile1}}}|{{{ImageSize1|200px}}}|alt={{{ImageAlt1|}}}]]
+<br><small>{{{ImageCaption1|}}}</small>
 }}
-<!-- IUPAC NAME -->
+<!-- IDENTIFIERS -->
+{{#if: {{{IUPACName|}}} |
 |-
 | style="background:#efefef;" | IUPAC Name
-| {{{IUPAC_name|}}}
+| {{{IUPACName}}}
+}}
-<!-- OTHER NAMES -->
+{{#if: {{{OtherNames|}}} |
-{{#if: {{{other_names|}}} |
 |-
 | style="background:#efefef;" | Other Names
-| {{{other_names}}}
+| {{{OtherNames}}}
 }}
-<!-- IDENTIFIERS -->
+<!-- SECTION 1: IDENTIFIERS -->
-{{#if: {{{CAS_number|}}} |
+{{#if: {{{Section1|}}} |
-|-
-| style="background:#efefef;" | CAS Number
-| {{{CAS_number}}}
-}}
-{{#if: {{{PubChem|}}} |
-|-
-| style="background:#efefef;" | PubChem
-| [https://pubchem.ncbi.nlm.nih.gov/compound/{{{PubChem}}} {{{PubChem}}}]
-}}
-{{#if: {{{ChemSpiderID|}}} |
-|-
-| style="background:#efefef;" | ChemSpider
-| [https://www.chemspider.com/Chemical-Structure.{{{ChemSpiderID}}}.html {{{ChemSpiderID}}}]
-}}
-{{#if: {{{UNII|}}} |
-|-
-| style="background:#efefef;" | UNII
-| {{{UNII}}}
-}}
-{{#if: {{{ChEBI|}}} |
-|-
-| style="background:#efefef;" | ChEBI
-| [https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:{{{ChEBI}}} {{{ChEBI}}}]
-}}
-{{#if: {{{ChEMBL|}}} |
-|-
-| style="background:#efefef;" | ChEMBL
-| [https://www.ebi.ac.uk/chembl/compound_report_card/{{{ChEMBL}}}/ {{{ChEMBL}}}]
-}}
-{{#if: {{{IUPHAR_ligand|}}} |
-|-
-| style="background:#efefef;" | IUPHAR Ligand
-| [https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId={{{IUPHAR_ligand}}} {{{IUPHAR_ligand}}}]
-}}
-{{#if: {{{KEGG|}}} |
 |-
-| style="background:#efefef;" | KEGG
+| colspan="2" style="background:#d9edf7; text-align:center; font-weight:bold;" | Identifiers
-| [https://www.genome.jp/dbget-bin/www_bget?cpd:{{{KEGG}}} {{{KEGG}}}]
-}}
-{{#if: {{{DrugBank|}}} |
 |-
-| style="background:#efefef;" | DrugBank
+| colspan="2" style="padding:5px;" | {{{Section1}}}
-| [https://go.drugbank.com/drugs/{{{DrugBank}}} {{{DrugBank}}}]
 }}
-<!-- CHEMICAL FORMULA -->
+<!-- SECTION 2: PROPERTIES -->
+{{#if: {{{Section2|}}} |
 |-
-| style="background:#efefef;" | Chemical Formula
+| colspan="2" style="background:#d9edf7; text-align:center; font-weight:bold;" | Properties
-| {{{formula|}}}
-<!-- MOLAR MASS -->
 |-
-| style="background:#efefef;" | Molar Mass
+| colspan="2" style="padding:5px;" | {{{Section2}}}
-| {{{molar_mass|}}}
-<!-- MELTING POINT -->
-{{#if: {{{melting_point|}}} |
-|-
-| style="background:#efefef;" | Melting Point
-| {{{melting_point}}}
 }}
-<!-- SMILES -->
+<!-- SECTION 3: HAZARDS -->
-{{#if: {{{SMILES|}}} |
+{{#if: {{{Section3|}}} |
 |-
-| style="background:#efefef;" | SMILES
+| colspan="2" style="background:#d9534f; color:#fff; text-align:center; font-weight:bold;" | Hazards
-| {{{SMILES}}}
-}}
-<!-- InChI -->
-{{#if: {{{InChI|}}} |
-|-
-| style="background:#efefef;" | InChI
-| {{{InChI}}}
-}}
-<!-- InChIKey -->
-{{#if: {{{InChIKey|}}} |
 |-
-| style="background:#efefef;" | InChIKey
+| colspan="2" style="padding:5px;" | {{{Section3}}}
-| {{{InChIKey}}}
 }}
+<!-- FOOTER -->
 |-
-| style="text-align:center; font-size:85%; padding:5px;" colspan="2" |
+| colspan="2" style="text-align:center; font-size:85%; padding:5px;" | <small>Data sourced from verified databases</small>
-<small>Data sourced from verified databases</small>
 |}
 <noinclude>
 == Usage ==
-This is a non-Lua version of the `Chembox` template for displaying chemical compound data in an infobox.
+This template displays chemical information in a clean infobox.
 === Example ===
 <syntaxhighlight lang="mediawiki">
 {{Chembox
-| name          = Cholic acid
+| Name        = Flavopiridol
-| image         = Cholic acid.svg
+| ImageFile   = Flavopiridol.svg
-| image_alt     = Skeletal formula of cholic acid
+| ImageSize   = 200px
-| image2        = Cholic acid 3D ball.png
+| ImageFile1  = Alvocidib ball-and-stick.png
-| image2_alt    = Ball-and-stick model of cholic acid molecule
+| ImageSize1  = 200px
-| IUPAC_name    = (R)-4-[(3R,5S,7R,8R,9S,10R,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
+| IUPACName   = 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methyl-4-piperidinyl]-4-chromenone
-| other_names   = 3α,7α,12α-Trihydroxy-5β-cholan-24-oic acid
+| OtherNames  = Flavopiridol, HMR 1275, L-868275
-| CAS_number    = 81-25-4
-| PubChem       = 221493
+| Section1    = {{Chembox Identifiers
-| ChemSpiderID  = 192104
+| UNII = 45AD6X575G
-| UNII          = G0S7T6QH5O
+| CASNo = 146426-40-6
-| ChEBI         = 16359
+| PubChem = 5287969
-| ChEMBL        = 1201632
+| ChEBI = 47344
-| IUPHAR_ligand = 609
+| ChEMBL = 428690
-| KEGG          = C05436
+| ChemSpiderID = 4450222
-| DrugBank      = DB02659
+| KEGG = D09868
-| formula       = C<sub>24</sub>H<sub>40</sub>O<sub>5</sub>
+| StdInChI = 1S/C21H20ClNO5/...
-| molar_mass    = 408.57 g/mol
+| DrugBank = DB03496
-| melting_point = 198-200 °C
+| SMILES = Clc4ccccc4C=2Oc1c(c(O)cc(O)c1...)
-| SMILES        = C[C@H]1CC[C@H]2[C@@H]3CC[C@H]4[C@@H](C[C@@H](O)[C@H]4[C@@H]3CC[C@H]2[C@@]1(C)C)C[C@@H](CC(=O)O)O
+}}
-| InChI         = 1S/C24H40O5/c1-13-4-5-14-15-6-7-17-20(27)18(15)8-9-21(17)24(14,2)16(13)10-19(26)22(3)11-23(28)12-25/h13-22,25-28H,4-12H2,1-3H3/t13-,14-,15+,16-,17-,18-,19-,20-,21-,22-,24-/m0/s1
-| InChIKey      = BHQCQFFYRZLCQQ-HPLJOQBZSA-N
+| Section2    = {{Chembox Properties
+| Formula = C<sub>21</sub>H<sub>20</sub>ClNO<sub>5</sub>
+| MolarMass = 401.8402
+}}
+| Section3    = {{Chembox Hazards
+| MainHazards =
+}}
 }}
 </syntaxhighlight>
 === Parameters ===
-* `name` - Name of the compound.
+* `Name` - Title displayed in the infobox header.
-* `image` / `image2` - Image file names.
+* `ImageFile`, `ImageFile1` - Chemical structure or other images.
-* `image_alt` / `image2_alt` - Alternative text for images.
+* `ImageSize` - Image size (default 200px).
-* `IUPAC_name` - IUPAC-approved name.
+* `IUPACName` - Official IUPAC name.
-* `other_names` - Other names or synonyms.
+* `OtherNames` - Alternate names.
-* `CAS_number`, `PubChem`, `ChemSpiderID`, `UNII`, `ChEBI`, `ChEMBL`, `IUPHAR_ligand`, `KEGG`, `DrugBank` - Database identifiers.
+* `Section1` - Identifier section using `Chembox Identifiers`.
-* `formula` - Chemical formula.
+* `Section2` - Properties section using `Chembox Properties`.
-* `molar_mass` - Molar mass of the compound.
+* `Section3` - Hazards section using `Chembox Hazards`.
-* `melting_point` - Melting point.
-* `SMILES`, `InChI`, `InChIKey` - Chemical notations.
 == Notes ==
-* This template uses standard MediaWiki parser functions.
+* Sections like `Section1`, `Section2`, and `Section3` are optional.
-* Empty parameters are automatically hidden for clean display.
+* Add as many sections as needed for chemical data.
 </noinclude>