4-HO-MALT: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
 
Line 1: Line 1:
{{Short description|A psychedelic compound}}
{{DISPLAYTITLE:4-HO-MALT}}
{{Drugbox
| verifiedrevid = 477318123
| IUPAC_name = 3-[2-(methylamino)ethyl]-1H-indol-4-ol
| image = 4-HO-MALT_structure.png
| image_size = 200px
| width =
| alt =
| caption = Chemical structure of 4-HO-MALT
| legal_status =
| routes_of_administration =
| CAS_number =
| ATC_prefix =
| ATC_suffix =
| PubChem =
| ChemSpiderID =
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| C=13
| H=18
| N=2
| O=1
| smiles = CC(C)NCCc1c[nH]c2c1cc(O)cc2
| StdInChI =
| StdInChIKey =
}}


'''4-HO-MALT''' (4-hydroxy-N-methyl-N-allyltryptamine) is a [[psychedelic]] compound of the [[tryptamine]] class. It is structurally related to [[psilocin]], the active component in [[psilocybin mushrooms]].
== 4-HO-MALT ==
[[File:4-HO-MALT_structure.png|thumb|right|Chemical structure of 4-HO-MALT]]
4-HO-MALT, also known as 4-hydroxy-N-methyl-N-allyltryptamine, is a synthetic psychedelic compound belonging to the [[tryptamine]] class. It is structurally related to [[psilocin]], the active metabolite of [[psilocybin]], and is known for its psychoactive effects.


==Chemical structure==
=== Chemical Structure ===
4-HO-MALT is a [[tryptamine]] derivative, featuring a core indole structure with a hydroxy group at the 4-position and a methyl and allyl group attached to the nitrogen atom. This structure is similar to other psychedelic tryptamines such as [[4-HO-DMT]] and [[4-HO-MiPT]].
4-HO-MALT is a derivative of tryptamine, featuring a hydroxy group at the fourth position of the indole ring, an N-methyl group, and an N-allyl group. This structure is similar to other 4-hydroxy tryptamines, such as [[4-HO-DMT]] (psilocin), but with the addition of an allyl group, which alters its pharmacological properties.


==Pharmacology==
=== Pharmacology ===
The pharmacological effects of 4-HO-MALT are not well-documented, but it is believed to act as a partial agonist at the [[serotonin receptor|5-HT2A receptor]], similar to other psychedelic tryptamines. This receptor is thought to play a significant role in the psychedelic effects of these compounds.
4-HO-MALT acts primarily as a [[serotonin receptor]] agonist, particularly at the 5-HT2A receptor, which is believed to be responsible for its psychedelic effects. The compound's interaction with serotonin receptors leads to alterations in perception, mood, and cognition, characteristic of psychedelic experiences.


==Effects==
=== Effects ===
The subjective effects of 4-HO-MALT are reported to be similar to those of other psychedelic tryptamines, including altered perception, mood changes, and visual hallucinations. The intensity and duration of these effects can vary based on dosage and individual sensitivity.
The effects of 4-HO-MALT are similar to those of other psychedelic tryptamines, such as [[psilocybin]] and [[LSD]]. Users report visual and auditory hallucinations, altered sense of time, and profound changes in thought and mood. The intensity and duration of effects can vary based on dosage, individual physiology, and environmental factors.


==Legal status==
=== Legal Status ===
The legal status of 4-HO-MALT varies by country. In some jurisdictions, it may be considered a controlled substance due to its structural similarity to other regulated tryptamines.
The legal status of 4-HO-MALT varies by country. In some jurisdictions, it may be classified as a controlled substance, while in others, it may not be specifically regulated. Users should be aware of the legal implications of possessing or using this compound in their region.


==Synthesis==
== Related Pages ==
The synthesis of 4-HO-MALT involves the alkylation of [[tryptamine]] with allyl bromide, followed by methylation and subsequent hydroxylation at the 4-position. This process requires advanced knowledge of organic chemistry and access to specialized laboratory equipment.
* [[Tryptamine]]
 
* [[Psychedelic drug]]
==Related compounds==
* [[Serotonin receptor]]
* [[Psilocin]]
* [[4-HO-DMT]]
* [[4-HO-DMT]]
* [[4-HO-MiPT]]
* [[Psilocin]]
* [[Psilocybin]]
==See also==
* [[List of psychedelic tryptamines]]
* [[Serotonin receptor]]
==Related pages==
* [[Psychedelic drug]]
* [[Tryptamine]]
* [[Serotonin]]


[[Category:Psychedelic tryptamines]]
[[Category:Psychedelic tryptamines]]
[[Category:Serotonin receptor agonists]]
[[Category:Serotonin receptor agonists]]
[[Category:Research chemicals]]

Latest revision as of 11:20, 15 February 2025


4-HO-MALT[edit]

Chemical structure of 4-HO-MALT

4-HO-MALT, also known as 4-hydroxy-N-methyl-N-allyltryptamine, is a synthetic psychedelic compound belonging to the tryptamine class. It is structurally related to psilocin, the active metabolite of psilocybin, and is known for its psychoactive effects.

Chemical Structure[edit]

4-HO-MALT is a derivative of tryptamine, featuring a hydroxy group at the fourth position of the indole ring, an N-methyl group, and an N-allyl group. This structure is similar to other 4-hydroxy tryptamines, such as 4-HO-DMT (psilocin), but with the addition of an allyl group, which alters its pharmacological properties.

Pharmacology[edit]

4-HO-MALT acts primarily as a serotonin receptor agonist, particularly at the 5-HT2A receptor, which is believed to be responsible for its psychedelic effects. The compound's interaction with serotonin receptors leads to alterations in perception, mood, and cognition, characteristic of psychedelic experiences.

Effects[edit]

The effects of 4-HO-MALT are similar to those of other psychedelic tryptamines, such as psilocybin and LSD. Users report visual and auditory hallucinations, altered sense of time, and profound changes in thought and mood. The intensity and duration of effects can vary based on dosage, individual physiology, and environmental factors.

Legal Status[edit]

The legal status of 4-HO-MALT varies by country. In some jurisdictions, it may be classified as a controlled substance, while in others, it may not be specifically regulated. Users should be aware of the legal implications of possessing or using this compound in their region.

Related Pages[edit]