AM-1241: Difference between revisions

From WikiMD's Wellness Encyclopedia

CSV import
 
CSV import
Tags: mobile edit mobile web edit
 
Line 1: Line 1:
{{Short description|Cannabinoid receptor agonist}}
== AM-1241 ==
{{Drugbox
| verifiedrevid = 477318679
| IUPAC_name = (2''R'')-2-[(1''R'',2''R'')-3-(4-chlorophenyl)-1-methyl-2-(methylamino)propyl]-1,3-benzoxazole
| image = AM-1241-2D-skeletal.svg
| width = 200
| CAS_number = 444912-48-5
| PubChem = 10130836
| ChemSpiderID = 8301874
| UNII = 0K3C7F7F9U
| C=19
| H=22
| Cl=1
| N=3
| O=1
| smiles = CC(C1=CC=CC=C1)C(C)NC2=NC3=CC=CC=C3O2
}}


'''AM-1241''' is a synthetic [[cannabinoid]] that acts as a selective agonist for the [[cannabinoid receptor]] [[CB2 receptor|CB<sub>2</sub>]] subtype. It is part of a class of compounds known as [[cannabinoid receptor agonists]], which interact with the [[endocannabinoid system]] in the body.
[[File:AM-1241-2D-skeletal.svg|thumb|right|200px|2D skeletal structure of AM-1241]]


==Pharmacology==
'''AM-1241''' is a synthetic [[cannabinoid]] that acts as a selective agonist for the [[cannabinoid receptor]] [[CB2 receptor|CB<sub>2</sub>]] subtype. It is known for its potential [[analgesic]] and [[anti-inflammatory]] properties, making it a subject of interest in [[medical research]].
AM-1241 is known for its high selectivity towards the [[CB2 receptor]], which is primarily found in the [[immune system]] and [[peripheral nervous system]]. This selectivity makes AM-1241 a compound of interest for research into [[pain management]] and [[inflammation]], as activation of the CB<sub>2</sub> receptor is associated with anti-inflammatory and analgesic effects without the psychoactive effects typically associated with [[CB1 receptor|CB<sub>1</sub>]] activation.


==Mechanism of Action==
=== Chemical Structure ===
AM-1241 binds to the CB<sub>2</sub> receptor, which is a [[G protein-coupled receptor]] (GPCR). Upon binding, it activates intracellular signaling pathways that lead to the modulation of [[cytokine]] release and inhibition of [[neurotransmitter]] release, contributing to its anti-inflammatory and analgesic properties.
AM-1241 is characterized by its specific chemical structure, which allows it to selectively bind to the CB<sub>2</sub> receptors. The [[File:AM-1241-2D-skeletal.svg|thumb|left|200px|Chemical structure of AM-1241]] image illustrates the 2D skeletal structure of AM-1241, highlighting its key functional groups and molecular configuration.


==Research and Applications==
=== Mechanism of Action ===
Research on AM-1241 has focused on its potential therapeutic applications in conditions such as [[neuropathic pain]], [[arthritis]], and other inflammatory disorders. Studies have shown that AM-1241 can reduce pain and inflammation in animal models, suggesting its potential as a novel therapeutic agent.
AM-1241 functions primarily by activating the CB<sub>2</sub> receptors, which are predominantly found in the [[immune system]] and [[peripheral nervous system]]. Unlike the [[CB1 receptor|CB<sub>1</sub>]] receptors, which are primarily located in the [[central nervous system]], CB<sub>2</sub> receptors do not produce the psychoactive effects typically associated with cannabinoids. This selective activation is believed to mediate the compound's analgesic and anti-inflammatory effects without the central side effects.


==Safety and Side Effects==
=== Potential Therapeutic Uses ===
As a research chemical, the safety profile of AM-1241 in humans is not well-established. However, its selectivity for the CB<sub>2</sub> receptor suggests a lower risk of psychoactive side effects compared to non-selective cannabinoids that also activate the CB<sub>1</sub> receptor.
Research into AM-1241 has suggested several potential therapeutic applications:


==Related pages==
* '''Pain Management''': Due to its action on CB<sub>2</sub> receptors, AM-1241 may be effective in managing [[chronic pain]] and [[neuropathic pain]].
* '''Inflammation''': Its anti-inflammatory properties make it a candidate for treating conditions characterized by excessive inflammation, such as [[arthritis]].
* '''Neuroprotection''': There is ongoing research into its potential neuroprotective effects, which could be beneficial in [[neurodegenerative diseases]].
 
=== Research and Development ===
AM-1241 is still under investigation, with studies focusing on its pharmacokinetics, safety profile, and efficacy in various [[animal models]]. The compound's ability to provide pain relief without the psychoactive effects of other cannabinoids makes it a promising candidate for further development.
 
== Related Pages ==
* [[Cannabinoid receptor]]
* [[Cannabinoid receptor]]
* [[CB2 receptor]]
* [[CB2 receptor]]
* [[Endocannabinoid system]]
* [[Analgesic]]
* [[Cannabinoid receptor agonist]]
* [[Anti-inflammatory]]
 
==Gallery==
<gallery>
File:AM-1241-2D-skeletal.svg|2D skeletal structure of AM-1241
</gallery>


[[Category:Cannabinoids]]
[[Category:Cannabinoids]]
[[Category:CB2 receptor agonists]]
[[Category:Pharmacology]]
[[Category:Experimental drugs]]

Latest revision as of 10:46, 15 February 2025

AM-1241[edit]

2D skeletal structure of AM-1241

AM-1241 is a synthetic cannabinoid that acts as a selective agonist for the cannabinoid receptor CB2 subtype. It is known for its potential analgesic and anti-inflammatory properties, making it a subject of interest in medical research.

Chemical Structure[edit]

AM-1241 is characterized by its specific chemical structure, which allows it to selectively bind to the CB2 receptors. The

Chemical structure of AM-1241

image illustrates the 2D skeletal structure of AM-1241, highlighting its key functional groups and molecular configuration.

Mechanism of Action[edit]

AM-1241 functions primarily by activating the CB2 receptors, which are predominantly found in the immune system and peripheral nervous system. Unlike the CB1 receptors, which are primarily located in the central nervous system, CB2 receptors do not produce the psychoactive effects typically associated with cannabinoids. This selective activation is believed to mediate the compound's analgesic and anti-inflammatory effects without the central side effects.

Potential Therapeutic Uses[edit]

Research into AM-1241 has suggested several potential therapeutic applications:

  • Pain Management: Due to its action on CB2 receptors, AM-1241 may be effective in managing chronic pain and neuropathic pain.
  • Inflammation: Its anti-inflammatory properties make it a candidate for treating conditions characterized by excessive inflammation, such as arthritis.
  • Neuroprotection: There is ongoing research into its potential neuroprotective effects, which could be beneficial in neurodegenerative diseases.

Research and Development[edit]

AM-1241 is still under investigation, with studies focusing on its pharmacokinetics, safety profile, and efficacy in various animal models. The compound's ability to provide pain relief without the psychoactive effects of other cannabinoids makes it a promising candidate for further development.

Related Pages[edit]