Prab: CSV import

2025-02-20T01:30:46Z

CSV import

← Older revision		Revision as of 01:30, 20 February 2025
Line 71:		Line 71:
	[[Category:Bronchodilators]]		[[Category:Bronchodilators]]
	[[Category:Respiratory system drugs]]		[[Category:Respiratory system drugs]]
			<gallery>
			File:Salmefamol.svg\|Salmefamol
			</gallery>

Prab: CSV import

2024-12-03T21:26:47Z

CSV import

New page

{{Short description|A detailed overview of the drug Salmefamol, its uses, mechanism, and related information.}}

'''Salmefamol''' is a [[beta-2 adrenergic receptor agonist]] primarily used as a [[bronchodilator]] in the treatment of [[asthma]] and other conditions involving reversible airway obstruction. It is part of the [[sympathomimetic]] class of drugs, which mimic the effects of endogenous catecholamines like [[epinephrine]] and [[norepinephrine]].

==Pharmacology==
Salmefamol works by selectively stimulating beta-2 adrenergic receptors in the smooth muscle of the airways, leading to muscle relaxation and bronchodilation. This action helps to alleviate symptoms such as wheezing, coughing, and shortness of breath in patients with obstructive airway diseases.

===Mechanism of Action===
Upon inhalation, Salmefamol binds to beta-2 adrenergic receptors on the surface of bronchial smooth muscle cells. This binding activates [[adenylate cyclase]], increasing the intracellular concentration of [[cyclic adenosine monophosphate]] (cAMP). Elevated cAMP levels lead to the activation of [[protein kinase A]] (PKA), which phosphorylates target proteins that result in muscle relaxation and bronchodilation.

===Pharmacokinetics===
Salmefamol is typically administered via inhalation, allowing for rapid onset of action. The drug is metabolized primarily in the liver and excreted in the urine. The half-life of Salmefamol is approximately 4-6 hours, making it suitable for use in both acute and maintenance therapy.

==Clinical Uses==
Salmefamol is indicated for the relief of bronchospasm in conditions such as:
* [[Asthma]]
* [[Chronic obstructive pulmonary disease]] (COPD)
* [[Exercise-induced bronchoconstriction]]

==Side Effects==
Common side effects of Salmefamol include:
* [[Tremor]]
* [[Tachycardia]]
* [[Palpitations]]
* [[Headache]]
* [[Nervousness]]

Serious side effects, though rare, may include:
* [[Paradoxical bronchospasm]]
* [[Hypokalemia]]
* [[Hyperglycemia]]

==Contraindications==
Salmefamol should not be used in patients with known hypersensitivity to the drug or any of its components. Caution is advised in patients with cardiovascular disorders, [[hyperthyroidism]], or [[diabetes mellitus]].

==Interactions==
Salmefamol may interact with other medications, including:
* [[Beta-blockers]], which may reduce its effectiveness
* [[Diuretics]], which may increase the risk of hypokalemia
* [[Monoamine oxidase inhibitors]] (MAOIs) and [[tricyclic antidepressants]], which may potentiate cardiovascular effects

==Also see==
* [[Beta-2 adrenergic receptor]]
* [[Bronchodilator]]
* [[Asthma management]]
* [[Chronic obstructive pulmonary disease]]

{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 477002123
| IUPAC_name = (RS)-1-(4-hydroxy-3-hydroxymethylphenyl)-2-(tert-butylamino)ethanol
| image = Salmefamol.svg
| width = 200
| CAS_number = 15302-04-0
| ATC_prefix = R03
| ATC_suffix = AC06
| PubChem = 3033981
| DrugBank = DB01285
| ChemSpiderID = 2298495
| UNII = 9J3B6U2J0B
| KEGG = D08595
| ChEMBL = 1201205
| C=13
| H=21
| N=1
| O=3
| smiles = CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O
}}

[[Category:Beta-2 adrenergic agonists]]
[[Category:Bronchodilators]]
[[Category:Respiratory system drugs]]

Salmefamol - Revision history

Prab: CSV import

Prab: CSV import