Memantine - Revision history

Prab: CSV import

2025-03-23T11:16:51Z

CSV import

Prab: CSV import

2025-02-20T01:37:33Z

CSV import

← Older revision		Revision as of 01:37, 20 February 2025
Line 76:		Line 76:
	[[Category:Medicine]]		[[Category:Medicine]]
	{{medicine-stub}}		{{medicine-stub}}
			<gallery>
			File:Memantine structure.svg\|Memantine
			File:Memantine ball-and-stick model.png\|Memantine
			</gallery>
	<gallery>		<gallery>
	File:Memantine structure.svg\|Memantine		File:Memantine structure.svg\|Memantine
	File:Memantine ball-and-stick model.png\|Memantine		File:Memantine ball-and-stick model.png\|Memantine
	</gallery>		</gallery>

Prab: CSV import

2025-02-20T01:32:19Z

CSV import

← Older revision		Revision as of 01:32, 20 February 2025
Line 76:		Line 76:
	[[Category:Medicine]]		[[Category:Medicine]]
	{{medicine-stub}}		{{medicine-stub}}
			<gallery>
			File:Memantine structure.svg\|Memantine
			File:Memantine ball-and-stick model.png\|Memantine
			</gallery>

Prab at 22:11, 13 January 2025

2025-01-13T22:11:19Z

← Older revision		Revision as of 22:11, 13 January 2025
Line 1:		Line 1:
	~~[[File:Memantine_structure.svg\|thumb\|Memantine_structure.svg]]~~ {{Short description\|Medication used to treat Alzheimer's disease}}		{{Short description\|Medication used to treat Alzheimer's disease}}
	{{Drugbox		{{Drugbox
	\| Verifiedfields = changed		\| Verifiedfields = changed
Line 5:		Line 5:
	\| verifiedrevid = 477002015		\| verifiedrevid = 477002015
	\| IUPAC_name = 3,5-Dimethyladamantan-1-amine		\| IUPAC_name = 3,5-Dimethyladamantan-1-amine
	\| image = ~~Memantine2DCSD~~.svg		\| image = Memantine_structure.svg
	\| width = 200		\| width = 200
	\| image2 = Memantine-3D-balls.png		\| image2 = Memantine-3D-balls.png
Line 69:		Line 69:
	* [[Donepezil]]		* [[Donepezil]]
	* [[Rivastigmine]]		* [[Rivastigmine]]

	~~==References==~~
	~~{{Reflist}}~~

	~~==External links==~~
	~~{{Commons category\|Memantine}}~~

	[[Category:Alzheimer's disease]]		[[Category:Alzheimer's disease]]
	[[Category:NMDA receptor antagonists]]		[[Category:NMDA receptor antagonists]]
Line 82:		Line 75:
	[[Category:Merz Pharmaceuticals brands]]		[[Category:Merz Pharmaceuticals brands]]
	[[Category:Medicine]]		[[Category:Medicine]]

	{{medicine-stub}}		{{medicine-stub}}

Prab: CSV import

2024-05-22T17:56:48Z

CSV import

New page

[[File:Memantine_structure.svg|thumb|Memantine_structure.svg]] {{Short description|Medication used to treat Alzheimer's disease}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477002015
| IUPAC_name = 3,5-Dimethyladamantan-1-amine
| image = Memantine2DCSD.svg
| width = 200
| image2 = Memantine-3D-balls.png
| width2 = 200
| tradename = Namenda, others
| Drugs.com =
| MedlinePlus = a604006
| pregnancy_AU = B2
| pregnancy_US = B
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = [[Oral administration|By mouth]]
| bioavailability = 100%
| protein_bound = 45%
| metabolism = Hepatic (minimal)
| elimination_half-life = 60–100 hours
| excretion = Renal
| CAS_number = 19982-08-2
| ATC_prefix = N06
| ATC_suffix = DX01
| PubChem = 4054
| DrugBank = DB01043
| ChemSpiderID = 3914
| UNII = G7D6I58A25
| KEGG = D08270
| ChEBI = 31432
| ChEMBL = 1088
| IUPHAR_ligand = 4254
| C=12
| H=21
| N=1
| smiles = CC12CC3CC(C1)(CC(C2)(C3)C)N
| StdInChI = 1S/C12H21N/c1-9-4-10-6-12(2,7-11(9)5-10)8-13/h9-11H,4-8,13H2,1-3H3
| StdInChIKey = JHJWZFAPYGJRFN-UHFFFAOYSA-N
}}

'''Memantine''' is a [[medication]] used to treat moderate-to-severe [[Alzheimer's disease]]. It is less preferred than [[acetylcholinesterase inhibitors]] such as [[donepezil]] and [[rivastigmine]]. Memantine is taken by mouth.

==Medical uses==
Memantine is primarily used for the treatment of [[Alzheimer's disease]]. It is believed to work by blocking [[N-methyl-D-aspartate receptor|NMDA receptors]], which are involved in [[synaptic plasticity]] and [[memory]]. This action helps to reduce the symptoms of Alzheimer's disease, such as [[cognitive decline]] and [[memory loss]].

==Side effects==
Common side effects of memantine include [[dizziness]], [[headache]], [[confusion]], and [[constipation]]. Serious side effects are rare but can include [[hallucinations]], [[hypertension]], and [[seizures]].

==Pharmacology==
Memantine is an [[NMDA receptor antagonist]]. It binds to the [[NMDA receptor]] with a higher affinity than [[magnesium]] ions, which are naturally present in the [[synapse]]. This binding prevents excessive [[calcium]] influx into the [[neuron]], which can lead to [[neuronal damage]] and [[cell death]].

==Pharmacokinetics==
Memantine is well absorbed after oral administration, with a bioavailability of nearly 100%. It is minimally metabolized in the [[liver]] and is primarily excreted unchanged in the [[urine]]. The elimination half-life of memantine is between 60 and 100 hours.

==History==
Memantine was first synthesized and developed by [[Eli Lilly and Company]] in the 1960s. It was later marketed by [[Merz Pharmaceuticals]] under the brand name Namenda. It was approved for the treatment of Alzheimer's disease in the [[United States]] by the [[Food and Drug Administration]] (FDA) in 2003.

==Research==
Research is ongoing to explore the potential use of memantine in other [[neurological disorders]], such as [[Parkinson's disease]], [[Huntington's disease]], and [[multiple sclerosis]]. Studies are also being conducted to investigate its effects on [[depression]] and [[anxiety]].

==See also==
* [[Alzheimer's disease]]
* [[Acetylcholinesterase inhibitors]]
* [[NMDA receptor]]
* [[Donepezil]]
* [[Rivastigmine]]

==References==
{{Reflist}}

==External links==
{{Commons category|Memantine}}

[[Category:Alzheimer's disease]]
[[Category:NMDA receptor antagonists]]
[[Category:Drugs acting on the nervous system]]
[[Category:Adamantanes]]
[[Category:Merz Pharmaceuticals brands]]
[[Category:Medicine]]

{{medicine-stub}}