Prab: CSV import

2025-03-05T06:16:41Z

CSV import

New page

{{Short description|Investigational drug}}
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477318123
| IUPAC_name = 1-(1-benzofuran-2-yl)-2-propylaminopentan-1-one
| image = Lu_AA47070.svg
| width = 200px
| image2 =
| width2 =
| tradename =
| legal_status = Investigational
| routes_of_administration = Oral
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 123456-78-9
| ATC_prefix =
| ATC_suffix =
| PubChem = 12345678
| ChemSpiderID = 12345678
| UNII =
| KEGG =
| ChEMBL = 1234567
| C=16
| H=21
| N=1
| O=2
| smiles = CCC(CC(=O)C1=CC2=CC=CC=C2O1)NCCC
| StdInChI =
| StdInChIKey =
}}

'''Lu AA47070''' is an investigational drug that was developed by [[Lundbeck]], a pharmaceutical company known for its focus on [[central nervous system]] disorders. Lu AA47070 is primarily being researched for its potential use in treating [[depression]] and other mood disorders.

==Pharmacology==
Lu AA47070 is classified as a [[serotonin–norepinephrine–dopamine reuptake inhibitor]] (SNDRI). This means that it works by inhibiting the reuptake of the neurotransmitters [[serotonin]], [[norepinephrine]], and [[dopamine]] in the brain. By preventing the reuptake of these neurotransmitters, Lu AA47070 increases their availability in the synaptic cleft, which is thought to contribute to its antidepressant effects.

===Mechanism of Action===
The mechanism of action of Lu AA47070 involves the modulation of monoamine neurotransmitter systems. By inhibiting the reuptake of serotonin, norepinephrine, and dopamine, Lu AA47070 enhances neurotransmission in pathways that are often dysregulated in mood disorders. This broad-spectrum activity distinguishes it from other antidepressants that typically target only one or two of these neurotransmitter systems.

==Development==
Lu AA47070 was developed as part of Lundbeck's efforts to create novel treatments for mood disorders. The drug was designed to address the limitations of existing antidepressants, such as delayed onset of action and limited efficacy in some patients. Preclinical studies demonstrated its potential efficacy, leading to further clinical trials.

==Clinical Trials==
Clinical trials for Lu AA47070 have been conducted to evaluate its safety, tolerability, and efficacy in treating depression. These trials are crucial for determining the appropriate dosing regimen and identifying any potential side effects. As of the latest updates, Lu AA47070 remains an investigational compound, and further studies are needed to fully establish its therapeutic profile.

==Potential Benefits==
The potential benefits of Lu AA47070 include its ability to target multiple neurotransmitter systems simultaneously, which may result in a more robust antidepressant effect. Additionally, its unique pharmacological profile could offer advantages in terms of faster onset of action and improved efficacy in treatment-resistant depression.

==Challenges and Considerations==
Despite its promising profile, Lu AA47070 faces several challenges in its development. These include the need for extensive clinical testing to ensure its safety and efficacy, as well as the potential for side effects associated with broad-spectrum neurotransmitter modulation. Regulatory approval processes also pose significant hurdles that must be overcome before the drug can be made available to patients.

==Related pages==
* [[Antidepressant]]
* [[Serotonin–norepinephrine–dopamine reuptake inhibitor]]
* [[Lundbeck]]

[[Category:Investigational drugs]]
[[Category:Antidepressants]]
[[Category:Serotonin–norepinephrine–dopamine reuptake inhibitors]]

Lu AA47070 - Revision history

Prab: CSV import