https://wikimd.org/index.php?action=history&feed=atom&title=Levosulpiride
Levosulpiride - Revision history
2026-04-25T20:50:07Z
Revision history for this page on the wiki
MediaWiki 1.44.2
https://wikimd.org/index.php?title=Levosulpiride&diff=5806213&oldid=prev
Prab: CSV import
2024-05-22T15:43:47Z
<p>CSV import</p>
<p><b>New page</b></p><div>[[File:Levosulpiride.svg|thumb|Levosulpiride.svg]] {{Short description|Atypical antipsychotic and prokinetic agent}}<br />
{{Drugbox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 477318015<br />
| IUPAC_name = (RS)-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide<br />
| image = Levosulpiride.svg<br />
| width = 200<br />
| tradename = <br />
| Drugs.com = <br />
| MedlinePlus = <br />
| pregnancy_AU = <br />
| pregnancy_US = <br />
| pregnancy_category = <br />
| legal_AU = <br />
| legal_CA = <br />
| legal_UK = <br />
| legal_US = <br />
| legal_status = <br />
| routes_of_administration = Oral, Intramuscular, Intravenous<br />
| bioavailability = <br />
| protein_bound = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion = <br />
| CAS_number = 23672-07-3<br />
| ATC_prefix = N05<br />
| ATC_suffix = AL07<br />
| PubChem = 28860<br />
| DrugBank = DB09210<br />
| ChemSpiderID = 26834<br />
| UNII = 0G4X367WA3<br />
| KEGG = D08110<br />
| ChEBI = 31826<br />
| ChEMBL = 2104740<br />
| synonyms = <br />
| C=15<br />
| H=23<br />
| N=3<br />
| O=4<br />
| S=1<br />
| smiles = C1CN(C(=CC1)CC(=O)NC2=CC(=C(C=C2)OC)S(=O)(=O)N)CC<br />
| StdInChI = 1S/C15H23N3O4S/c1-3-18-8-4-5-12(18)9-14(19)17-11-6-7-13(22-2)15(10-11)23(16,20)21/h6-7,10,12H,3-5,8-9H2,1-2H3,(H,17,19)(H2,16,20,21)<br />
| StdInChIKey = YVVUHBSJBNVGSZ-UHFFFAOYSA-N<br />
}}<br />
<br />
'''Levosulpiride''' is an [[atypical antipsychotic]] and [[prokinetic]] agent used primarily in the treatment of [[schizophrenia]], [[depression (mood)|depression]], and [[irritable bowel syndrome]]. It is the levo-enantiomer of [[sulpiride]], which means it is a mirror image of the sulpiride molecule that has been isolated for its specific pharmacological effects.<br />
<br />
==Pharmacology==<br />
Levosulpiride acts as a selective antagonist of the [[dopamine]] D2 receptors, which are implicated in the pathophysiology of several psychiatric and gastrointestinal disorders. By blocking these receptors, levosulpiride helps to alleviate symptoms of [[psychosis]] and improve gastrointestinal motility.<br />
<br />
==Medical Uses==<br />
Levosulpiride is used in the management of:<br />
* [[Schizophrenia]]<br />
* [[Depression (mood)|Depression]]<br />
* [[Irritable bowel syndrome]]<br />
* [[Dyspepsia]]<br />
* [[Gastroesophageal reflux disease]]<br />
<br />
==Side Effects==<br />
Common side effects of levosulpiride include:<br />
* [[Drowsiness]]<br />
* [[Dizziness]]<br />
* [[Weight gain]]<br />
* [[Hyperprolactinemia]]<br />
* [[Extrapyramidal symptoms]]<br />
<br />
==Mechanism of Action==<br />
Levosulpiride's primary mechanism of action is the antagonism of dopamine D2 receptors. This action is responsible for its antipsychotic and prokinetic effects. By inhibiting these receptors, levosulpiride can modulate neurotransmitter activity in the brain and enhance gastrointestinal motility.<br />
<br />
==Dosage and Administration==<br />
Levosulpiride is available in various forms, including oral tablets, intramuscular injections, and intravenous formulations. The dosage and administration depend on the condition being treated and the patient's response to the medication.<br />
<br />
==See Also==<br />
* [[Sulpiride]]<br />
* [[Atypical antipsychotic]]<br />
* [[Prokinetic agent]]<br />
* [[Dopamine antagonist]]<br />
<br />
==References==<br />
{{Reflist}}<br />
<br />
[[Category:Antipsychotics]]<br />
[[Category:Prokinetics]]<br />
[[Category:Dopamine antagonists]]<br />
[[Category:Psychiatric drugs]]<br />
[[Category:Medicine]]<br />
<br />
{{medicine-stub}}</div>
Prab