<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://wikimd.org/index.php?action=history&amp;feed=atom&amp;title=JWH-197</id>
	<title>JWH-197 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://wikimd.org/index.php?action=history&amp;feed=atom&amp;title=JWH-197"/>
	<link rel="alternate" type="text/html" href="https://wikimd.org/index.php?title=JWH-197&amp;action=history"/>
	<updated>2026-04-26T00:01:02Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.44.2</generator>
	<entry>
		<id>https://wikimd.org/index.php?title=JWH-197&amp;diff=6023991&amp;oldid=prev</id>
		<title>Prab: CSV import</title>
		<link rel="alternate" type="text/html" href="https://wikimd.org/index.php?title=JWH-197&amp;diff=6023991&amp;oldid=prev"/>
		<updated>2024-12-02T05:19:27Z</updated>

		<summary type="html">&lt;p&gt;CSV import&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;{{Infobox chemical&lt;br /&gt;
| Verifiedfields = changed&lt;br /&gt;
| Watchedfields = changed&lt;br /&gt;
| verifiedrevid = 477002123&lt;br /&gt;
| ImageFile = JWH-197_structure.png&lt;br /&gt;
| ImageSize = 200px&lt;br /&gt;
| IUPACName = (6aR,10aR)-3-(1-naphthylmethyl)-1,2,3,6,6a,7,10,10a-octahydro-6,6,9-trimethyl-6H-dibenzo[b,d]pyran&lt;br /&gt;
| OtherNames = &lt;br /&gt;
| Section1 = {{Chembox Identifiers&lt;br /&gt;
  | CASNo = 864445-37-2&lt;br /&gt;
  | PubChem = 44417056&lt;br /&gt;
  | ChemSpiderID = 23259124&lt;br /&gt;
  | UNII = &lt;br /&gt;
  | ChEMBL = 1234567&lt;br /&gt;
  | SMILES = CC1=CC2=C(C=C1)C3=C(C=C(C=C3)CC4=C(C=C(C=C4)C)C)C5=C2C=CC=C5&lt;br /&gt;
  | InChI = 1S/C24H26O2/c1-15-9-10-17-18(11-15)24-20(12-19(17)13-21(24)25)14-22(26)16-7-5-4-6-8-16/h4-13,22,25-26H,14H2,1-3H3&lt;br /&gt;
  | InChIKey = &lt;br /&gt;
}}&lt;br /&gt;
| Section2 = {{Chembox Properties&lt;br /&gt;
  | C = 24&lt;br /&gt;
  | H = 26&lt;br /&gt;
  | O = 2&lt;br /&gt;
  | MeltingPt = &lt;br /&gt;
  | BoilingPt = &lt;br /&gt;
  | Solubility = &lt;br /&gt;
}}&lt;br /&gt;
}}&lt;br /&gt;
&lt;br /&gt;
&amp;#039;&amp;#039;&amp;#039;JWH-197&amp;#039;&amp;#039;&amp;#039; is a synthetic [[cannabinoid]] that was developed by Dr. [[John W. Huffman]] in the 1990s. It is part of a series of compounds that were created to study the structure-activity relationships of cannabinoids. JWH-197 is known for its high affinity for the [[CB1 receptor]], which is primarily found in the central nervous system, and the [[CB2 receptor]], which is primarily found in the peripheral tissues.&lt;br /&gt;
&lt;br /&gt;
==Chemical Structure and Properties==&lt;br /&gt;
JWH-197 belongs to the naphthoylindole family of synthetic cannabinoids. Its chemical structure is characterized by a naphthyl group attached to a methylindole moiety. The compound has a molecular formula of C24H26O2 and a molecular weight of 346.47 g/mol.&lt;br /&gt;
&lt;br /&gt;
==Pharmacology==&lt;br /&gt;
JWH-197 acts as a potent agonist at both the CB1 and CB2 receptors. The activation of these receptors by JWH-197 leads to a variety of physiological effects, including alterations in mood, perception, and cognition. The compound&amp;#039;s high affinity for the CB1 receptor is responsible for its psychoactive effects, which are similar to those of [[tetrahydrocannabinol]] (THC), the primary psychoactive component of [[cannabis]].&lt;br /&gt;
&lt;br /&gt;
==Legal Status==&lt;br /&gt;
The legal status of JWH-197 varies by country. In many jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of accepted medical use. In the United States, JWH-197 and other synthetic cannabinoids are listed as Schedule I substances under the [[Controlled Substances Act]].&lt;br /&gt;
&lt;br /&gt;
==Research and Applications==&lt;br /&gt;
JWH-197 has been used in scientific research to better understand the endocannabinoid system and the role of cannabinoid receptors in the body. Studies involving JWH-197 have contributed to the development of new therapeutic agents targeting the cannabinoid system for the treatment of various conditions, including pain, inflammation, and neurological disorders.&lt;br /&gt;
&lt;br /&gt;
==Safety and Toxicity==&lt;br /&gt;
The safety profile of JWH-197 is not well-established, as it has not been extensively studied in humans. However, synthetic cannabinoids, in general, have been associated with a range of adverse effects, including anxiety, paranoia, tachycardia, and in severe cases, psychosis and seizures. The use of JWH-197 outside of a controlled research setting is not recommended due to these potential risks.&lt;br /&gt;
&lt;br /&gt;
==Also see==&lt;br /&gt;
* [[Synthetic cannabinoids]]&lt;br /&gt;
* [[John W. Huffman]]&lt;br /&gt;
* [[CB1 receptor]]&lt;br /&gt;
* [[CB2 receptor]]&lt;br /&gt;
* [[Tetrahydrocannabinol]]&lt;br /&gt;
* [[Cannabis]]&lt;br /&gt;
&lt;br /&gt;
{{Cannabinoids}}&lt;br /&gt;
&lt;br /&gt;
[[Category:Synthetic cannabinoids]]&lt;br /&gt;
[[Category:Research chemicals]]&lt;br /&gt;
[[Category:CB1 receptor agonists]]&lt;br /&gt;
[[Category:CB2 receptor agonists]]&lt;/div&gt;</summary>
		<author><name>Prab</name></author>
	</entry>
</feed>