Prab: CSV import

2024-05-22T18:02:39Z

CSV import

New page

[[File:Desipramine.svg|thumb|Desipramine.svg]] {{Short description|Tricyclic antidepressant medication}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 477318015
| image = Desipramine.svg
| width = 200
| image2 = Desipramine molecule ball.png
| width2 = 200
| pronounce =
| tradename = Norpramin, Pertofrane
| Drugs.com =
| MedlinePlus = a682387
| pregnancy_AU = C
| pregnancy_US = N
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = Oral
| bioavailability = 60-70%
| protein_bound = 90%
| metabolism = Hepatic
| elimination_half-life = 12-54 hours
| excretion = Renal
| IUPAC_name = (3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N-methylpropan-1-amine)
| CAS_number = 50-47-5
| ATC_prefix = N06
| ATC_suffix = AA01
| PubChem = 2995
| IUPHAR_ligand = 2394
| DrugBank = DB01151
| ChemSpiderID = 2888
| UNII = TG537D343B
| KEGG = D03630
| ChEBI = 47755
| ChEMBL = 717
| NIAID_ChemDB = 007537
| Synonyms =
| C=18
| H=22
| N=2
| smiles = CNCCC1=CC=CC2=C1C3=C(CC2)N(C)CC3
| StdInChI = 1S/C18H22N2/c1-19-12-11-15-6-2-3-7-17-16-8-4-5-9-18(16)20(17)10-14(15)13-19/h2-3,6-7,14H,4-5,8-13H2,1H3
| StdInChIKey = HSJDBSCOQWCQNR-UHFFFAOYSA-N
}}

'''Desipramine''' is a [[tricyclic antidepressant]] (TCA) used primarily in the treatment of [[depression (mood)|depression]]. It is also sometimes used to treat [[anxiety disorders]], [[chronic pain]], and [[attention deficit hyperactivity disorder]] (ADHD). Desipramine is marketed under the brand names Norpramin and Pertofrane.

== Medical uses ==
Desipramine is primarily used to treat [[major depressive disorder]]. It is also prescribed for [[anxiety disorders]], [[chronic pain]] conditions such as [[neuropathic pain]], and [[attention deficit hyperactivity disorder]] (ADHD).

== Mechanism of action ==
Desipramine works by inhibiting the reuptake of [[norepinephrine]] and, to a lesser extent, [[serotonin]], thereby increasing the levels of these neurotransmitters in the brain. This action helps to alleviate symptoms of depression and anxiety.

== Side effects ==
Common side effects of desipramine include [[dry mouth]], [[constipation]], [[urinary retention]], [[blurred vision]], and [[drowsiness]]. Serious side effects can include [[cardiac arrhythmias]], [[seizures]], and [[orthostatic hypotension]].

== Contraindications ==
Desipramine should not be used in individuals with a history of [[myocardial infarction]], [[arrhythmias]], or [[bipolar disorder]] without careful monitoring. It is also contraindicated in patients who are taking [[monoamine oxidase inhibitors]] (MAOIs).

== Pharmacokinetics ==
Desipramine is well absorbed from the gastrointestinal tract and has a bioavailability of 60-70%. It is highly protein-bound (90%) and is metabolized in the liver. The elimination half-life of desipramine ranges from 12 to 54 hours, and it is excreted primarily through the kidneys.

== History ==
Desipramine was first introduced in the 1960s and has been used extensively since then for the treatment of depression and other conditions.

== See also ==
* [[Tricyclic antidepressant]]
* [[Major depressive disorder]]
* [[Anxiety disorder]]
* [[Chronic pain]]
* [[Attention deficit hyperactivity disorder]]

== References ==
{{Reflist}}

== External links ==

[[Category:Tricyclic antidepressants]]
[[Category:Antidepressants]]
[[Category:Anxiolytics]]
[[Category:Analgesics]]
[[Category:Attention deficit hyperactivity disorder management]]
[[Category:Drugs with unknown mechanisms of action]]
[[Category:Drugs acting on the nervous system]]

{{medicine-stub}}

Desipramine - Revision history

Prab: CSV import