https://wikimd.org/index.php?action=history&feed=atom&title=AmenamevirAmenamevir - Revision history2026-05-01T17:05:39ZRevision history for this page on the wikiMediaWiki 1.44.2https://wikimd.org/index.php?title=Amenamevir&diff=5897578&oldid=prevPrab: CSV import2024-06-11T16:51:32Z<p>CSV import</p>
<p><b>New page</b></p><div>[[File:Amenamevir.svg|thumb|Amenamevir]] {{Short description|Antiviral drug}}<br />
{{Drugbox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 477002015<br />
| IUPAC_name = (2S)-2-[[4-(2-amino-1,3-thiazol-4-yl)phenyl]methyl]-1,4-dioxaspiro[4.5]decane-2,3-dione<br />
| image = Amenamevir.svg<br />
| width = 200<br />
| tradename = <br />
| Drugs.com = <br />
| pregnancy_AU = <br />
| pregnancy_US = <br />
| legal_AU = <br />
| legal_CA = <br />
| legal_UK = <br />
| legal_US = <br />
| legal_status = <br />
| routes_of_administration = <br />
| bioavailability = <br />
| protein_bound = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion = <br />
| CAS_number = 841301-32-4<br />
| ATC_prefix = <br />
| ATC_suffix = <br />
| PubChem = 11525743<br />
| DrugBank = <br />
| ChemSpiderID = 9702971<br />
| UNII = <br />
| KEGG = <br />
| ChEBI = <br />
| ChEMBL = <br />
| synonyms = ASP2151<br />
| C=16 | H=16 | N=2 | O=4 | S=1<br />
| smiles = O=C1OC2(CCCCC2)C1(Cc3ccc(cc3)c4nc(sc4)N)O<br />
| StdInChI = 1S/C16H16N2O4S/c17-15-18-12(11-23-15)10-8-6-9(7-10)5-16(20)13(19)22-14(16)21-4-2-1-3-11-21/h6-8,11H,1-5H2,(H2,17,18)<br />
| StdInChIKey = QXKJXQFZKQJZQF-UHFFFAOYSA-N<br />
}}<br />
<br />
'''Amenamevir''' is an [[antiviral drug]] that is used for the treatment of [[herpes zoster]] (shingles). It is a member of the [[oxadiazole]] class of compounds and works by inhibiting the [[helicase-primase complex]] of the [[herpes simplex virus]] (HSV) and [[varicella-zoster virus]] (VZV).<br />
<br />
==Mechanism of Action==<br />
Amenamevir targets the helicase-primase complex, which is essential for the replication of HSV and VZV. By inhibiting this complex, amenamevir prevents the viral DNA from unwinding and replicating, thereby halting the spread of the virus within the host.<br />
<br />
==Clinical Use==<br />
Amenamevir is primarily used to treat herpes zoster, a condition caused by the reactivation of the varicella-zoster virus. It is particularly useful in patients who are resistant to other antiviral medications such as [[acyclovir]] and [[valacyclovir]].<br />
<br />
==Side Effects==<br />
Common side effects of amenamevir include [[headache]], [[nausea]], and [[diarrhea]]. More severe side effects are rare but can include [[allergic reactions]] and [[liver enzyme abnormalities]].<br />
<br />
==Related Compounds==<br />
Amenamevir is related to other antiviral drugs such as [[acyclovir]], [[valacyclovir]], and [[famciclovir]]. These drugs also target the replication mechanisms of herpes viruses but through different mechanisms.<br />
<br />
==See Also==<br />
* [[Herpes zoster]]<br />
* [[Herpes simplex virus]]<br />
* [[Varicella-zoster virus]]<br />
* [[Acyclovir]]<br />
* [[Valacyclovir]]<br />
* [[Famciclovir]]<br />
<br />
==References==<br />
{{Reflist}}<br />
<br />
[[Category:Antiviral drugs]]<br />
[[Category:Herpes zoster]]<br />
[[Category:Oxadiazoles]]<br />
[[Category:Herpes simplex virus]]<br />
<br />
{{antiviral-drug-stub}}</div>Prab