Prab: CSV import

2025-02-15T10:59:13Z

CSV import

← Older revision		Revision as of 10:59, 15 February 2025
Line 1:		Line 1:
	{{Short description\|~~Synthetic~~ opioid analgesic}}		{{Short description\|A synthetic opioid analgesic}}
	{{Drugbox		{{Drugbox
	\| verifiedfields = changed		\| verifiedfields = changed
	\| verifiedrevid = ~~477318680~~		\| verifiedrevid = 477002123
	\| image = Acetylmethadol.svg		\| image = Acetylmethadol.svg
	\| image_size = 200px		\| image_size = 200px
	\| ~~IUPAC_name~~ = ~~6-(Dimethylamino)-4,4-diphenyl-3-hexanone acetate~~		\| image_alt = Structural formula of acetylmethadol
	~~\| CAS_number = 509-74-0~~
	~~\| ATC_prefix = N07~~
	~~\| ATC_suffix = BC03~~
	~~\| PubChem = 5284590~~
	~~\| DrugBank = DB01450~~
	~~\| ChemSpiderID = 4447600~~
	~~\| UNII = 0F5U9N377L~~
	~~\| KEGG = D02763~~
	~~\| ChEMBL = 2104660~~
	~~\| C=23~~
	~~\| H=31~~
	~~\| N=1~~
	~~\| O=2~~
	~~\| smiles = CC(=O)OC(CC(C)N(C)C)C(=O)C1=CC=CC=C1C2=CC=CC=C2~~
	}}		}}

	'''Acetylmethadol''' is a synthetic opioid analgesic that is chemically related to [[methadone]]. It is used primarily in the treatment of opioid dependence. Acetylmethadol is a racemic mixture, meaning it contains ~~equal parts of~~ two enantiomers, which are mirror images of each other.		'''Acetylmethadol''' is a synthetic opioid analgesic that is chemically related to [[methadone]]. It is used primarily in the treatment of [[opioid dependence]] and is known for its long-acting properties. Acetylmethadol is a racemic mixture, meaning it contains two enantiomers, which are mirror images of each other.

	==Pharmacology==		==Pharmacology==
	Acetylmethadol acts ~~as an agonist at~~ the [[mu-opioid receptor]], ~~which is responsible for its analgesic and euphoric~~ effects~~. It is metabolized in the liver~~ to ~~form~~ [[~~LAAM~~]] ~~(levo-alpha-acetylmethadol)~~, ~~which is also an active opioid agonist~~. ~~The drug has a~~ long ~~half-life, allowing~~ for ~~less frequent dosing compared to other opioids~~.		Acetylmethadol acts on the [[mu-opioid receptor]] in the [[central nervous system]], producing effects similar to those of other opioids, such as [[analgesia]], [[euphoria]], and [[respiratory depression]]. Its long duration of action makes it suitable for use in [[opioid substitution therapy]].

	==~~Medical use~~==		==Synthesis and Structure==
	~~Acetylmethadol~~ is ~~used in~~ the ~~management~~ of ~~opioid dependence~~. ~~It is administered orally and is typically used in~~ a ~~controlled clinical setting~~. The ~~long duration~~ of ~~action makes it suitable for maintenance therapy, reducing~~ the ~~need for frequent dosing and helping to stabilize patients~~.		The chemical structure of acetylmethadol is similar to that of methadone, with the addition of an acetyl group. This modification affects its pharmacokinetics, allowing for a longer duration of action. The structural formula of acetylmethadol is depicted in the image on the right.

	~~==Side effects==~~		[[File:Acetylmethadol.svg\|thumb\|right\|200px\|Structural formula of acetylmethadol]]
	~~Common side effects~~ of acetylmethadol ~~include:~~
	* [[Nausea]]
	* [[Vomiting]]
	* [[Constipation]]
	* [[Drowsiness]]
	* [[Dizziness]]

	~~Serious side effects can include respiratory depression~~, ~~which~~ is a ~~risk with all~~ opioid ~~medications~~.		==Clinical Use==
			Acetylmethadol is used in the management of opioid dependence, providing a longer-acting alternative to methadone. It is administered orally and is typically used in a controlled clinical setting. The drug helps to reduce withdrawal symptoms and cravings in individuals undergoing treatment for opioid addiction.

	==~~Legal status~~==		==Side Effects==
	~~Acetylmethadol~~ is a ~~controlled substance in many countries due~~ to its potential for abuse and ~~dependence~~. It is ~~classified under various schedules depending on the jurisdiction~~.		Common side effects of acetylmethadol include [[nausea]], [[vomiting]], [[constipation]], and [[drowsiness]]. As with other opioids, there is a risk of [[addiction]] and [[overdose]], particularly if the drug is not used as prescribed.

			==Regulation==
			Due to its potential for abuse and addiction, acetylmethadol is classified as a controlled substance in many countries. Its use is typically restricted to specific medical settings and requires careful monitoring by healthcare professionals.

	==Related pages==		==Related pages==
	* [[Methadone]]		* [[Methadone]]
	* [[Opioid dependence]]		* [[Opioid dependence]]
	* [[~~LAAM]]~~		* [[Opioid receptor]]
	* [[Mu-opioid receptor]]

	~~==Gallery==~~
	~~<gallery>~~
	~~File:Acetylmethadol.svg\|Chemical structure of Acetylmethadol~~
	~~</gallery>~~

	[[Category:Opioids]]		[[Category:Opioids]]
	[[Category:Synthetic opioids]]		[[Category:Synthetic opioids]]
	[[Category:Analgesics]]		[[Category:Analgesics]]

Prab: CSV import

2025-02-11T21:23:27Z

CSV import

New page

{{Short description|Synthetic opioid analgesic}}
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477318680
| image = Acetylmethadol.svg
| image_size = 200px
| IUPAC_name = 6-(Dimethylamino)-4,4-diphenyl-3-hexanone acetate
| CAS_number = 509-74-0
| ATC_prefix = N07
| ATC_suffix = BC03
| PubChem = 5284590
| DrugBank = DB01450
| ChemSpiderID = 4447600
| UNII = 0F5U9N377L
| KEGG = D02763
| ChEMBL = 2104660
| C=23
| H=31
| N=1
| O=2
| smiles = CC(=O)OC(CC(C)N(C)C)C(=O)C1=CC=CC=C1C2=CC=CC=C2
}}

'''Acetylmethadol''' is a synthetic opioid analgesic that is chemically related to [[methadone]]. It is used primarily in the treatment of opioid dependence. Acetylmethadol is a racemic mixture, meaning it contains equal parts of two enantiomers, which are mirror images of each other.

==Pharmacology==
Acetylmethadol acts as an agonist at the [[mu-opioid receptor]], which is responsible for its analgesic and euphoric effects. It is metabolized in the liver to form [[LAAM]] (levo-alpha-acetylmethadol), which is also an active opioid agonist. The drug has a long half-life, allowing for less frequent dosing compared to other opioids.

==Medical use==
Acetylmethadol is used in the management of opioid dependence. It is administered orally and is typically used in a controlled clinical setting. The long duration of action makes it suitable for maintenance therapy, reducing the need for frequent dosing and helping to stabilize patients.

==Side effects==
Common side effects of acetylmethadol include:
* [[Nausea]]
* [[Vomiting]]
* [[Constipation]]
* [[Drowsiness]]
* [[Dizziness]]

Serious side effects can include respiratory depression, which is a risk with all opioid medications.

==Legal status==
Acetylmethadol is a controlled substance in many countries due to its potential for abuse and dependence. It is classified under various schedules depending on the jurisdiction.

==Related pages==
* [[Methadone]]
* [[Opioid dependence]]
* [[LAAM]]
* [[Mu-opioid receptor]]

==Gallery==
<gallery>
File:Acetylmethadol.svg|Chemical structure of Acetylmethadol
</gallery>

[[Category:Opioids]]
[[Category:Synthetic opioids]]
[[Category:Analgesics]]

Acetylmethadol - Revision history

Prab: CSV import

Prab: CSV import