https://wikimd.org/index.php?action=history&feed=atom&title=AcetylfentanylAcetylfentanyl - Revision history2026-04-26T16:29:30ZRevision history for this page on the wikiMediaWiki 1.44.2https://wikimd.org/index.php?title=Acetylfentanyl&diff=5831449&oldid=prevPrab: CSV import2024-05-27T01:22:51Z<p>CSV import</p>
<p><b>New page</b></p><div>[[File:Acetylfentanyl.svg|thumb|Acetylfentanyl|right]] [[File:Acetylfentanyl 3D BS.png|thumb|Acetylfentanyl 3D BS.png]] {{Short description|Synthetic opioid analgesic}}<br />
{{Drugbox<br />
| verifiedrevid = 477318705<br />
| image = Acetylfentanyl.svg<br />
| width = 200<br />
| image2 = <br />
| width2 = <br />
| tradename = <br />
| synonyms = <br />
| IUPAC_name = N-Phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide<br />
| CAS_number = 3258-84-2<br />
| ATC_prefix = <br />
| ATC_suffix = <br />
| PubChem = 62157<br />
| DrugBank = <br />
| ChemSpiderID = 55980<br />
| UNII = <br />
| KEGG = <br />
| ChEBI = <br />
| ChEMBL = <br />
| IUPHAR_ligand = <br />
| C=21 | H=26 | N=2 | O=1<br />
| smiles = CC(=O)N(C1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3<br />
| StdInChI = 1S/C21H26N2O/c1-18(24)23(20-10-6-2-7-11-20)21-13-16-22(17-14-21)15-19-8-4-3-5-9-19/h2-11,21H,12-17H2,1H3<br />
| StdInChIKey = YXKTVDFXDRQTKV-UHFFFAOYSA-N<br />
| StdInChI_Ref = <br />
| StdInChIKey_Ref = <br />
}}<br />
'''Acetylfentanyl''' is a [[synthetic opioid]] analgesic that is an analog of [[fentanyl]]. It is a potent [[agonist]] of the [[mu-opioid receptor]] and has been associated with numerous [[overdose]] deaths.<br />
==Chemical structure and properties==<br />
Acetylfentanyl is chemically similar to [[fentanyl]], with the primary difference being the presence of an acetyl group in place of the [[propionyl group]] found in fentanyl. Its [[IUPAC name]] is N-Phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide. The molecular formula is C21H26N2O.<br />
==Pharmacology==<br />
Acetylfentanyl acts as a potent [[agonist]] at the [[mu-opioid receptor]], which is responsible for its analgesic and euphoric effects. It is estimated to be 5 to 15 times more potent than [[heroin]] and about 80 times more potent than [[morphine]]. The drug's high potency increases the risk of [[overdose]] and [[respiratory depression]].<br />
==Medical use==<br />
Acetylfentanyl has no approved medical use and is not prescribed for any condition. It is often encountered as a [[designer drug]] and is sometimes found in [[illicit drug]] supplies, either alone or mixed with other substances.<br />
==Legal status==<br />
The legal status of acetylfentanyl varies by country. In many jurisdictions, it is classified as a controlled substance due to its high potential for abuse and lack of accepted medical use. For example, in the [[United States]], it is classified as a [[Schedule I]] substance under the [[Controlled Substances Act]].<br />
==Health risks==<br />
The primary health risks associated with acetylfentanyl are related to its potency and potential for overdose. Symptoms of overdose may include severe [[respiratory depression]], [[sedation]], [[coma]], and death. [[Naloxone]] can be used to reverse the effects of an acetylfentanyl overdose, but multiple doses may be required due to the drug's potency.<br />
==See also==<br />
* [[Fentanyl]]<br />
* [[Opioid]]<br />
* [[Designer drug]]<br />
* [[Overdose]]<br />
==References==<br />
{{Reflist}}<br />
[[Category:Opioids]]<br />
[[Category:Synthetic opioids]]<br />
[[Category:Designer drugs]]<br />
[[Category:Analgesics]]<br />
[[Category:Schedule I controlled substances]]<br />
[[Category:Mu-opioid receptor agonists]]<br />
{{medicine-stub}}</div>Prab