Prab: CSV import

2025-02-17T02:09:39Z

CSV import

← Older revision		Revision as of 02:09, 17 February 2025
Line 64:		Line 64:
	[[Category:Psychedelic tryptamines]]		[[Category:Psychedelic tryptamines]]
	[[Category:Serotonin receptor agonists]]		[[Category:Serotonin receptor agonists]]
			<gallery>
			File:5-MeO-DPT.svg
			File:5-MeO-DPT.png
			</gallery>

Prab: CSV import

2025-02-11T21:16:57Z

CSV import

New page

{{Short description|A psychedelic compound}}
{{Drugbox
| verifiedrevid = 477318123
| IUPAC_name = 3-[2-[Di(propan-2-yl)amino]ethyl]-5-methoxy-1H-indole
| image = 5-MeO-DPT.svg
| image2 = 5-MeO-DPT.png
| width = 200
| width2 = 200
| legal_status = Unscheduled
| routes_of_administration = Oral, Insufflation
| CAS_number = 69496-76-0
| PubChem = 443303
| ChemSpiderID = 391292
| UNII = 8X8VZ0R3QZ
| C=17 | H=26 | N=2 | O=1
| smiles = CC(C)N(CCc1c[nH]c2c1cc(cc2)OC)C(C)C
| StdInChI = 1S/C17H26N2O/c1-13(2)19(14(3)4)9-8-12-11-18-17-7-6-15(20-5)10-16(12)17/h6-7,10-11,13-14,18H,8-9H2,1-5H3
| StdInChIKey = ZQXKQXUSKJQZKQ-UHFFFAOYSA-N
}}

'''5-MeO-DPT''' (5-Methoxy-N,N-dipropyltryptamine) is a [[psychedelic]] compound belonging to the [[tryptamine]] class. It is known for its psychoactive effects and is structurally related to other tryptamines such as [[5-MeO-DMT]] and [[DPT]].

==Chemical structure and properties==
5-MeO-DPT is a synthetic compound with the chemical formula C17H26N2O. It features a methoxy group at the 5-position of the indole ring, which is a common modification in the tryptamine family that can alter the compound's pharmacological properties. The presence of the diisopropylamino group contributes to its unique effects compared to other tryptamines.

==Pharmacology==
The pharmacological profile of 5-MeO-DPT is not well-documented, but it is believed to act as a partial agonist at the [[serotonin receptor|5-HT2A receptor]], similar to other psychedelic tryptamines. This interaction is thought to be responsible for its psychoactive effects, which can include alterations in perception, mood, and cognition.

==Effects==
Users of 5-MeO-DPT report a range of effects, including:
* Visual and auditory hallucinations
* Altered sense of time
* Enhanced mood and euphoria
* Increased introspection and philosophical thinking

The intensity and duration of these effects can vary depending on the dose and route of administration.

==Usage and administration==
5-MeO-DPT is typically administered orally or via insufflation. The onset of effects is generally quicker with insufflation, but the duration may be shorter compared to oral administration. Dosage can vary widely, and users should exercise caution due to the potential for intense experiences.

==Legal status==
The legal status of 5-MeO-DPT varies by country. In many places, it is not specifically scheduled, but it may fall under analog laws that regulate substances similar to controlled drugs. Users should be aware of the legal implications in their jurisdiction.

==Safety and risks==
As with many psychedelics, the use of 5-MeO-DPT carries potential risks, including:
* Psychological distress or "bad trips"
* Anxiety and paranoia
* Potential for substance abuse

Users are advised to approach this compound with caution and to ensure a safe and supportive environment if they choose to use it.

==Related pages==
* [[Tryptamine]]
* [[5-MeO-DMT]]
* [[Psychedelic drug]]
* [[Serotonin receptor]]

==Gallery==
<gallery>
File:5-MeO-DPT.svg|Chemical structure of 5-MeO-DPT
File:5-MeO-DPT.png|3D model of 5-MeO-DPT
</gallery>

[[Category:Psychedelic tryptamines]]
[[Category:Serotonin receptor agonists]]

5-MeO-DPT - Revision history

Prab: CSV import

Prab: CSV import