3F-NEB - Revision history

Prab: CSV import

2025-02-13T03:56:32Z

CSV import

← Older revision		Revision as of 03:56, 13 February 2025
Line 1:		Line 1:
	~~{{Short description\|A synthetic stimulant drug}}~~		== 3F-NEB ==
	~~{{Drugbox~~
	~~\| verifiedfields~~ = ~~changed~~
	~~\| verifiedrevid~~ = ~~477002547~~
	~~\| IUPAC_name = 1~~-~~(3-fluorophenyl)-2-(ethylamino)butan-1-one~~
	~~\| image~~ = ~~3F-NEB_structure.png~~
	~~\| image_size~~ = ~~200px~~
	}}

	~~'''~~3F-~~NEB''' is a synthetic stimulant drug~~ of ~~the [[cathinone]] class. It is chemically related to other synthetic cathinones such as [[3~~-~~FMC~~]] ~~and [[4-FMC]].~~		[[File:3F-NEB_structure.png\|thumb\|right\|Chemical structure of 3F-NEB]]

	~~==Chemical structure==~~		'''3F-NEB''' is a synthetic compound that belongs to the class of [[novel psychoactive substances]] (NPS). It is a fluorinated derivative of the [[cathinone]] family, which are substances chemically similar to [[cathinone]], a naturally occurring stimulant found in the [[khat]] plant. 3F-NEB is known for its stimulant and euphoric effects, which have led to its use as a recreational drug.
	3F-NEB is a ~~fluorinated derivative~~ of [[~~NEB~~ (~~drug~~)~~\|NEB]], with the chemical formula C<sub>12</sub>H<sub>16</sub>FNO~~. It ~~features~~ a ~~fluorine atom attached to~~ the ~~phenyl ring~~, which is a ~~common modification~~ in ~~synthetic cathinones~~ to ~~alter their pharmacological properties~~.

	==~~Pharmacology~~==		== Chemical Properties ==
	The pharmacological effects of 3F-NEB are not well-documented, but it is presumed to act as a [[central nervous system]] stimulant. Like other cathinones, it likely increases the levels of [[neurotransmitter]]s such as [[dopamine]], [[norepinephrine]], and [[serotonin]] in the brain, leading to increased alertness, euphoria, and potential for abuse.

	~~==Legal status==~~		3F-NEB is chemically known as 3-fluoro-N-ethylbuphedrone. It is a derivative of [[buphedrone]], with a fluorine atom replacing a hydrogen atom in the phenyl ring. This modification is believed to alter the compound's pharmacological properties, potentially increasing its potency and duration of action compared to non-fluorinated analogs.
	~~The legal status of~~ 3F-NEB ~~varies by country~~. ~~In many jurisdictions~~, it is ~~classified as a controlled substance due~~ to its ~~structural similarity~~ to ~~other banned synthetic cathinones. Users should be aware of the legal implications of possessing or distributing this compound~~.

	==~~Potential risks~~ and ~~side~~ effects==		== Pharmacology ==
	~~As with other~~ synthetic cathinones~~, the~~ use of 3F-NEB ~~may pose~~ significant health risks. ~~Potential side~~ effects include ~~increased heart rate~~, hypertension, hyperthermia, and [[~~psychosis~~]]. ~~Long-term~~ use may lead to addiction and other ~~serious~~ health issues.
			The pharmacological effects of 3F-NEB are not well-studied, but it is presumed to act as a [[monoamine]] releasing agent, similar to other cathinones. This means it likely increases the levels of [[neurotransmitters]] such as [[dopamine]], [[norepinephrine]], and [[serotonin]] in the brain, leading to its stimulant effects. Users report increased energy, alertness, and euphoria, but these effects can be accompanied by adverse reactions such as anxiety, paranoia, and cardiovascular issues.

			== Legal Status ==

			The legal status of 3F-NEB varies by country. In many jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of medical use. It is often included in legislation targeting synthetic cathinones and other novel psychoactive substances.

			== Health Risks ==

			The use of 3F-NEB carries significant health risks. Acute effects can include [[tachycardia]], [[hypertension]], [[hyperthermia]], and [[seizures]]. Chronic use may lead to [[addiction]], [[psychosis]], and other long-term health issues. Due to the lack of research, the full extent of its toxicity and potential for harm is not fully understood.

			== Related Pages ==

	~~==Related pages==~~
	* [[Cathinone]]		* [[Cathinone]]
	* [[~~Synthetic cathinones~~]]		* [[Novel psychoactive substances]]
	* [[~~3-FMC~~]]		* [[Buphedrone]]
	* [[~~4-FMC~~]]		* [[Fluorinated compounds]]

	~~==Gallery==~~
	~~<gallery>~~
	~~3F-NEB_structure.png\|Chemical structure of 3F-NEB~~
	~~</gallery>~~

	[[Category:~~Synthetic cathinones~~]]		[[Category:Novel psychoactive substances]]
	[[Category:~~Stimulants~~]]		[[Category:Cathinones]]

Prab: CSV import

2025-02-11T20:03:49Z

CSV import

← Older revision		Revision as of 20:03, 11 February 2025
Line 1:		Line 1:
	{{Short description\|~~Synthetic cannabinoid~~}}		{{Short description\|A synthetic stimulant drug}}
	{{Drugbox		{{Drugbox
	\| verifiedfields = changed		\| verifiedfields = changed
	\| verifiedrevid = ~~477318752~~		\| verifiedrevid = 477002547
	\| IUPAC_name = (1-(5-~~fluoropentyl~~)-1H-~~indazole-3-carbonyl~~)-L-~~valine methyl ester~~		\| IUPAC_name = 1-(3-fluorophenyl)-2-(ethylamino)butan-1-one
	\| image = 3F-NEB_structure.png		\| image = 3F-NEB_structure.png
	\| ~~width~~ = ~~200~~		\| image_size = 200px
	~~\| legal_status = Legal status varies by jurisdiction~~
	~~\| routes_of_administration = Inhalation, oral~~
	~~\| CAS_number = 1800101-60-3~~
	~~\| PubChem = 11902592~~
	~~\| ChemSpiderID = 10028509~~
	~~\| UNII = 7X9V3Y0H3F~~
	~~\| C=20 \| H=27 \| F=1 \| N=3 \| O=3~~
	~~\| smiles = COC(=O)[C@@H](NC(=O)c1nn(CCCCC(F)F)c2ccccc12)C(C)C~~
	}}		}}

	'''3F-NEB''' is a synthetic [[~~cannabinoid]] that has been used in scientific research and is often found in [[designer drug~~]]s. It is ~~a potent agonist of the~~ [[~~cannabinoid receptor~~]]~~s, which are part of the~~ [[~~endocannabinoid system~~]] ~~in the human body~~.		'''3F-NEB''' is a synthetic stimulant drug of the [[cathinone]] class. It is chemically related to other synthetic cathinones such as [[3-FMC]] and [[4-FMC]].

	==Chemical ~~Structure and Properties~~==		==Chemical structure==
	3F-NEB is ~~chemically classified as an indazole-based synthetic cannabinoid. Its full chemical name is (1-~~(~~5-fluoropentyl~~)~~-1H-indazole-3-carbonyl)-L-valine methyl ester. The compound features a fluorinated pentyl chain~~, ~~which is a common modification in synthetic cannabinoids to enhance their potency and metabolic stability.~~		3F-NEB is a fluorinated derivative of [[NEB (drug)\|NEB]], with the chemical formula C<sub>12</sub>H<sub>16</sub>FNO. It features a fluorine atom attached to the phenyl ring, which is a common modification in synthetic cathinones to alter their pharmacological properties.

	~~The molecular~~ formula ~~of 3F-NEB is~~ C<sub>20</sub>H<sub>27</sub>~~FN<sub>3</sub>O<sub>3</sub>, and it has~~ a ~~molecular weight of approximately 377.45 g/mol. The presence of the~~ fluorine atom in the ~~pentyl chain~~ is ~~believed~~ to ~~contribute to its high affinity for cannabinoid receptors~~.

	==Pharmacology==		==Pharmacology==
	3F-NEB ~~acts~~ as a ~~full agonist at the~~ [[~~CB1 receptor\|CB<sub>1</sub>~~]] ~~and~~ [[~~CB2 receptor\|CB<sub>2</sub>~~]] ~~receptors, which are part of the~~ [[~~endocannabinoid system~~]]~~. This system plays a crucial role in regulating various physiological processes~~, ~~including mood, appetite, and pain sensation.~~		The pharmacological effects of 3F-NEB are not well-documented, but it is presumed to act as a [[central nervous system]] stimulant. Like other cathinones, it likely increases the levels of [[neurotransmitter]]s such as [[dopamine]], [[norepinephrine]], and [[serotonin]] in the brain, leading to increased alertness, euphoria, and potential for abuse.

	~~The activation of these receptors by 3F-NEB can lead to effects similar to those of~~ [[~~tetrahydrocannabinol~~]] ~~(THC)~~, ~~the primary psychoactive component of~~ [[~~cannabis~~]]~~. However, synthetic cannabinoids like 3F-NEB can be significantly more potent than THC~~, leading to increased ~~risks of adverse effects.~~

	~~==Legal Status==~~
	~~The legal status of 3F-NEB varies by jurisdiction. In many countries~~, ~~synthetic cannabinoids are controlled substances due to their~~ potential for abuse ~~and lack of medical use. It is important for researchers and users to be aware of the legal implications of possessing or distributing 3F-NEB in their respective regions~~.

	==~~Health Risks and Safety~~==		==Legal status==
	The ~~use~~ of ~~synthetic cannabinoids, including~~ 3F-NEB~~, has been associated with a range of adverse health effects. These can include [[tachycardia]], [[hypertension]], [[nausea]], [[vomiting]], [[anxiety]], [[hallucinations]], and [[seizures]]~~. In ~~severe cases~~, ~~use can lead~~ to ~~[[acute kidney injury]] and [[cardiovascular complications]]~~.		The legal status of 3F-NEB varies by country. In many jurisdictions, it is classified as a controlled substance due to its structural similarity to other banned synthetic cathinones. Users should be aware of the legal implications of possessing or distributing this compound.

	~~Due to the variability in potency~~ and ~~the presence of unknown impurities in street formulations~~, the use of ~~synthetic cannabinoids poses~~ significant health risks. ~~Users should exercise caution~~ and ~~seek medical attention if adverse effects occur~~.		==Potential risks and side effects==
			As with other synthetic cathinones, the use of 3F-NEB may pose significant health risks. Potential side effects include increased heart rate, hypertension, hyperthermia, and [[psychosis]]. Long-term use may lead to addiction and other serious health issues.

	==Related ~~Pages~~==		==Related pages==
	* [[~~Synthetic cannabinoids~~]]		* [[Cathinone]]
	* [[~~Cannabinoid receptor~~]]		* [[Synthetic cathinones]]
	* [[~~Designer drug~~]]		* [[3-FMC]]
	* [[~~Endocannabinoid system~~]]		* [[4-FMC]]

	==Gallery==		==Gallery==
	<gallery>		<gallery>
	~~File:~~3F-NEB_structure.png\|Chemical structure of 3F-NEB		3F-NEB_structure.png\|Chemical structure of 3F-NEB
	</gallery>		</gallery>

	[[Category:Synthetic ~~cannabinoids~~]]		[[Category:Synthetic cathinones]]
	[[Category:~~Designer drugs~~]]		[[Category:Stimulants]]

Prab: CSV import

2025-02-11T19:43:49Z

CSV import

New page

{{Short description|Synthetic cannabinoid}}
{{Drugbox
| verifiedfields = changed
| verifiedrevid = 477318752
| IUPAC_name = (1-(5-fluoropentyl)-1H-indazole-3-carbonyl)-L-valine methyl ester
| image = 3F-NEB_structure.png
| width = 200
| legal_status = Legal status varies by jurisdiction
| routes_of_administration = Inhalation, oral
| CAS_number = 1800101-60-3
| PubChem = 11902592
| ChemSpiderID = 10028509
| UNII = 7X9V3Y0H3F
| C=20 | H=27 | F=1 | N=3 | O=3
| smiles = COC(=O)[C@@H](NC(=O)c1nn(CCCCC(F)F)c2ccccc12)C(C)C
}}

'''3F-NEB''' is a synthetic [[cannabinoid]] that has been used in scientific research and is often found in [[designer drug]]s. It is a potent agonist of the [[cannabinoid receptor]]s, which are part of the [[endocannabinoid system]] in the human body.

==Chemical Structure and Properties==
3F-NEB is chemically classified as an indazole-based synthetic cannabinoid. Its full chemical name is (1-(5-fluoropentyl)-1H-indazole-3-carbonyl)-L-valine methyl ester. The compound features a fluorinated pentyl chain, which is a common modification in synthetic cannabinoids to enhance their potency and metabolic stability.

The molecular formula of 3F-NEB is C20H27FN3O3, and it has a molecular weight of approximately 377.45 g/mol. The presence of the fluorine atom in the pentyl chain is believed to contribute to its high affinity for cannabinoid receptors.

==Pharmacology==
3F-NEB acts as a full agonist at the [[CB1 receptor|CB1]] and [[CB2 receptor|CB2]] receptors, which are part of the [[endocannabinoid system]]. This system plays a crucial role in regulating various physiological processes, including mood, appetite, and pain sensation.

The activation of these receptors by 3F-NEB can lead to effects similar to those of [[tetrahydrocannabinol]] (THC), the primary psychoactive component of [[cannabis]]. However, synthetic cannabinoids like 3F-NEB can be significantly more potent than THC, leading to increased risks of adverse effects.

==Legal Status==
The legal status of 3F-NEB varies by jurisdiction. In many countries, synthetic cannabinoids are controlled substances due to their potential for abuse and lack of medical use. It is important for researchers and users to be aware of the legal implications of possessing or distributing 3F-NEB in their respective regions.

==Health Risks and Safety==
The use of synthetic cannabinoids, including 3F-NEB, has been associated with a range of adverse health effects. These can include [[tachycardia]], [[hypertension]], [[nausea]], [[vomiting]], [[anxiety]], [[hallucinations]], and [[seizures]]. In severe cases, use can lead to [[acute kidney injury]] and [[cardiovascular complications]].

Due to the variability in potency and the presence of unknown impurities in street formulations, the use of synthetic cannabinoids poses significant health risks. Users should exercise caution and seek medical attention if adverse effects occur.

==Related Pages==
* [[Synthetic cannabinoids]]
* [[Cannabinoid receptor]]
* [[Designer drug]]
* [[Endocannabinoid system]]

==Gallery==
<gallery>
File:3F-NEB_structure.png|Chemical structure of 3F-NEB
</gallery>

[[Category:Synthetic cannabinoids]]
[[Category:Designer drugs]]