Prab: CSV import

2025-02-16T06:22:05Z

CSV import

← Older revision		Revision as of 06:22, 16 February 2025
Line 1:		Line 1:
	{{~~Short description\|A psychedelic drug of the amphetamine class}}~~		{{DISPLAYTITLE:2,5-Dimethoxy-4-nitroamphetamine}}
	~~{{Drugbox~~
	~~\| verifiedrevid = 477318282~~
	~~\| IUPAC_name = 1-(~~2,5-Dimethoxy-4-~~nitrophenyl)propan-2-amine~~
	~~\| image = DON2DACS.svg~~
	~~\| width = 200px~~
	~~\| legal_status = Uncontrolled~~
	~~\| routes_of_administration = Oral~~
	~~\| CAS_number = 39201-82-6~~
	~~\| PubChem = 443885~~
	~~\| ChemSpiderID = 392063~~
	~~\| UNII = 8X8VZ0L6D5~~
	~~\| C=11 \| H=16 \| N=2 \| O=4~~
	~~\| smiles = CC(Cc1cc(OC)c(cc1OC)[N+](=O)[O-])N~~
	}}

	~~'''~~2,5-Dimethoxy-4-nitroamphetamine~~''' ('''DON''') is a [[psychedelic drug]] of the [[amphetamine]] class. It is known for its [[hallucinogenic]] effects and is chemically related to other [[phenethylamines]].~~		== 2,5-Dimethoxy-4-nitroamphetamine ==

	==Chemical ~~Structure and Properties==~~		[[File:DON2DACS.svg\|thumb\|right\|Chemical structure of 2,5-Dimethoxy-4-nitroamphetamine]]
	2,5-Dimethoxy-4-nitroamphetamine ~~is a derivative of [[amphetamine~~]], with a chemical structure characterized by a phenyl ring substituted with methoxy groups at the 2 and 5 positions and a nitro group at the 4 position. The presence of these groups is responsible for its psychoactive properties.

	~~==Pharmacology==~~		'''2,5-Dimethoxy-4-nitroamphetamine''' (DON) is a synthetic psychedelic compound of the [[amphetamine]] class. It is known for its psychoactive effects and is structurally related to other phenethylamines such as [[2,5-Dimethoxy-4-methylamphetamine]] (DOM) and [[2,5-Dimethoxy-4-iodoamphetamine]] (DOI).
	DON ~~acts primarily as~~ a ~~[[serotonin receptor]] agonist, particularly at~~ the [[~~5-HT2A receptor~~]]~~, which~~ is ~~believed to be responsible~~ for its ~~psychedelic~~ effects~~. The drug's action on serotonin receptors leads~~ to ~~altered perception~~, ~~mood~~, ~~and cognition~~.

	==~~Effects~~==		== Chemical Structure ==
	The effects of 2,5-Dimethoxy-4-nitroamphetamine are similar to those of other psychedelic amphetamines, such as [[2,5-Dimethoxy-4-methylamphetamine]] (DOM). Users report visual and auditory hallucinations, changes in thought patterns, and an altered sense of time. The intensity and duration of effects can vary based on dosage and individual sensitivity.

	~~==Synthesis==~~		2,5-Dimethoxy-4-nitroamphetamine is characterized by the presence of two methoxy groups at the 2 and 5 positions of the phenyl ring, and a nitro group at the 4 position. The compound also contains an alpha-methylated side chain, typical of amphetamines, which contributes to its psychoactive properties.
	~~The synthesis~~ of ~~DON involves~~ the ~~nitration of~~ 2,5~~-dimethoxyamphetamine~~, a ~~process that introduces the~~ nitro group at the 4 position ~~of the phenyl ring~~. ~~This chemical modification is crucial for the~~ compound~~'s activity as a psychedelic~~.

	==~~Legal Status~~==		== Pharmacology ==
	2,5-Dimethoxy-4-nitroamphetamine is not specifically controlled under international drug laws, but its legal status may vary by country. It is often considered a research chemical and may be subject to analogue laws in certain jurisdictions.

	==~~Related Compounds~~==		The pharmacological effects of 2,5-Dimethoxy-4-nitroamphetamine are not well-documented, but it is believed to act as a [[serotonin receptor]] agonist, similar to other psychedelic amphetamines. This action is thought to be responsible for its hallucinogenic effects.
	DON ~~is part of a larger class~~ of psychedelic amphetamines, ~~which includes compounds such~~ as [[2,5-Dimethoxy-4-iodoamphetamine]] (DOI) ~~and~~ [[2,5-Dimethoxy-4-bromoamphetamine]] (DOB)~~. These compounds share similar structures and pharmacological profiles.~~
			== Effects ==

			The effects of DON are reported to be similar to those of other psychedelic amphetamines, including altered perception, mood changes, and visual hallucinations. The duration and intensity of these effects can vary depending on the dose and individual sensitivity.

			== Synthesis ==

			The synthesis of 2,5-Dimethoxy-4-nitroamphetamine involves the nitration of 2,5-dimethoxyamphetamine, followed by purification processes to isolate the desired compound. The synthesis requires careful handling of reagents and conditions to ensure safety and yield.

			== Legal Status ==

			The legal status of 2,5-Dimethoxy-4-nitroamphetamine varies by country. In many jurisdictions, it is classified as a controlled substance due to its potential for abuse and lack of medical use.

			== Related Compounds ==

			* [[2,5-Dimethoxy-4-methylamphetamine]] (DOM)
			* [[2,5-Dimethoxy-4-iodoamphetamine]] (DOI)
			* [[2,5-Dimethoxy-4-bromoamphetamine]] (DOB)

			== See Also ==

	~~==See Also==~~
	* [[Psychedelic drug]]		* [[Psychedelic drug]]
	* [[Phenethylamine]]		* [[Phenethylamine]]
	* [[Serotonin receptor]]
	* [[Amphetamine]]		* [[Amphetamine]]

	==~~Gallery~~==		== Related Pages ==
	~~<gallery>~~
	~~File:DON2DACS.svg\|Chemical structure of 2,5-Dimethoxy-4-nitroamphetamine~~		* [[Psychedelic research]]
	~~</gallery>~~		* [[Serotonin receptor]]

	[[Category:Psychedelic ~~amphetamines~~]]		[[Category:Psychedelic phenethylamines]]
	[[Category:~~Phenethylamines~~]]		[[Category:Amphetamines]]

Prab: CSV import

2025-02-11T20:27:37Z

CSV import

New page

{{Short description|A psychedelic drug of the amphetamine class}}
{{Drugbox
| verifiedrevid = 477318282
| IUPAC_name = 1-(2,5-Dimethoxy-4-nitrophenyl)propan-2-amine
| image = DON2DACS.svg
| width = 200px
| legal_status = Uncontrolled
| routes_of_administration = Oral
| CAS_number = 39201-82-6
| PubChem = 443885
| ChemSpiderID = 392063
| UNII = 8X8VZ0L6D5
| C=11 | H=16 | N=2 | O=4
| smiles = CC(Cc1cc(OC)c(cc1OC)[N+](=O)[O-])N
}}

'''2,5-Dimethoxy-4-nitroamphetamine''' ('''DON''') is a [[psychedelic drug]] of the [[amphetamine]] class. It is known for its [[hallucinogenic]] effects and is chemically related to other [[phenethylamines]].

==Chemical Structure and Properties==
2,5-Dimethoxy-4-nitroamphetamine is a derivative of [[amphetamine]], with a chemical structure characterized by a phenyl ring substituted with methoxy groups at the 2 and 5 positions and a nitro group at the 4 position. The presence of these groups is responsible for its psychoactive properties.

==Pharmacology==
DON acts primarily as a [[serotonin receptor]] agonist, particularly at the [[5-HT2A receptor]], which is believed to be responsible for its psychedelic effects. The drug's action on serotonin receptors leads to altered perception, mood, and cognition.

==Effects==
The effects of 2,5-Dimethoxy-4-nitroamphetamine are similar to those of other psychedelic amphetamines, such as [[2,5-Dimethoxy-4-methylamphetamine]] (DOM). Users report visual and auditory hallucinations, changes in thought patterns, and an altered sense of time. The intensity and duration of effects can vary based on dosage and individual sensitivity.

==Synthesis==
The synthesis of DON involves the nitration of 2,5-dimethoxyamphetamine, a process that introduces the nitro group at the 4 position of the phenyl ring. This chemical modification is crucial for the compound's activity as a psychedelic.

==Legal Status==
2,5-Dimethoxy-4-nitroamphetamine is not specifically controlled under international drug laws, but its legal status may vary by country. It is often considered a research chemical and may be subject to analogue laws in certain jurisdictions.

==Related Compounds==
DON is part of a larger class of psychedelic amphetamines, which includes compounds such as [[2,5-Dimethoxy-4-iodoamphetamine]] (DOI) and [[2,5-Dimethoxy-4-bromoamphetamine]] (DOB). These compounds share similar structures and pharmacological profiles.

==See Also==
* [[Psychedelic drug]]
* [[Phenethylamine]]
* [[Serotonin receptor]]
* [[Amphetamine]]

==Gallery==
<gallery>
File:DON2DACS.svg|Chemical structure of 2,5-Dimethoxy-4-nitroamphetamine
</gallery>

[[Category:Psychedelic amphetamines]]
[[Category:Phenethylamines]]

2,5-Dimethoxy-4-nitroamphetamine - Revision history

Prab: CSV import

Prab: CSV import